연구용
Mitomycin C DNA 합성 억제제
제품 번호S8146
화학 구조
분자량: 334.37
바로가기
품질 관리
배치:
순도:
99.74%
99.74
| 관련 타겟 | HDAC PARP ATM/ATR DNA-PK WRN DNA/RNA Synthesis Topoisomerase PPAR Sirtuin Casein Kinase |
|---|---|
| 기타 Antineoplastic and Immunosuppressive Antibiotics 억제제 | Staurosporine (STS) Cyclosporin A Oligomycin A (MCH 32) Puromycin Dihydrochloride Nigericin sodium salt Geldanamycin (NSC 122750) Honokiol Streptozotocin (STZ) Sodium Monensin (NSC 343257) Cephalomannine |
세포 배양, 처리 및 작업 농도
| 세포주 | 분석 유형 | 농도 | 배양 시간 | 제형 | 활성 설명 | PMID |
|---|---|---|---|---|---|---|
| human CH1 (ovarian) tumor cell | Cytotoxic assay | The compound was evaluated for the cytotoxicity against human CH1 (ovarian) tumor cell lines, IC50=40 nM | 10698444 | |||
| human HT-29 (colon) tumor cell | Cytotoxic assay | The compound was evaluated for the cytotoxicity against human HT-29 (colon) tumor cell lines, IC50=40 nM | 10698444 | |||
| human A2780 (ovarian) tumor cell | Cytotoxic assay | The compound was evaluated for the cytotoxicity against human A2780 (ovarian) tumor cell lines, IC50=50 nM | 10698444 | |||
| human colon cancer cell line HCT15 | Cytotoxic assay | 72 h | In vitro cytotoxic activity against human colon cancer cell line HCT15 after 72 hr of drug exposure determined by the SRB assay, IC50=70 nM | 14980672 | ||
| Human Caki-1 Renal CellCarcinoma Cell | Function assay | 96 h | Inhibitory concentration against Human Caki-1 Renal CellCarcinoma Cell Lines (CD70+) at 96th hour, ic50=40 nM | 15743178 | ||
| SW480 colon cancer cell | Growth inhibition assay | In vitro inhibition of SW480 colon cancer cell line, IC50=7 nM | 1920349 | |||
| WiDr colon cancer cell | Growth inhibition assay | In vitro inhibition of WiDr colon cancer cell line, IC50=10 nM | 1920349 | |||
| HeLa | Function assay | In vitro anticellular activity against HeLa cells., IC50 = 0.81 μM. | 1495011 | |||
| L1210 | Function assay | Inhibitory concentration on parentral (sensitive) L1210 leukemia cells., IC50 = 0.09 μM. | 1906107 | |||
| L1210 | Function assay | Inhibitory concentration on multidrug-resistant L1210 leukemia cells., IC50 = 1.5 μM. | 1906107 | |||
| P388 | Antitumor assay | Antitumor potency on P388 leukemia cells in culture, IC50 = 0.0508 μM. | 1906109 | |||
| HT-29 | Antiproliferative assay | 96 hrs | Antiproliferative activity against human HT-29 cells after 96 hrs by MTT assay, IC50 = 0.099 μM. | 2778449 | ||
| P388 | Antiproliferative assay | 48 hrs | Antiproliferative activity against mouse P388 cells after 48 hrs by MTT assay, IC50 = 3 μM. | 2778449 | ||
| AA8 | Function assay | 4 hrs | Inhibitory activity of compound for AA8 cells to reduce cell density by 50% (exposed to compound for 4 hours), IC50 = 0.00108 μM. | 2909741 | ||
| L1210 | Growth inhibition assay | 8-9 hrs | Inhibition of L1210 leukemia cells, after exposure to compound for period of 8-9 hr, ID50 = 0.18 μM. | 3397995 | ||
| L1210 | Growth inhibition assay | 1 hr | Inhibition of L1210 leukemia cells, after exposure to compound for period of 1 hr, ID50 = 3.1 μM. | 3397995 | ||
| EMT6 | Function assay | 1 hr | Compound is measured for surviving fractions of EMT6 tumor cells treated in culture with (0.50 uM) concentration for 1 hr under hypoxic condition., ED50 = 0.001 μM. | 7452674 | ||
| EMT6 | Function assay | 1 hr | Compound is measured for surviving fractions of EMT6 tumor cells treated in culture with (0.50 uM) concentration for 1 hr under aerobic condition., ED50 = 0.7 μM. | 7452674 | ||
| V79 | Function assay | Inhibitory concentration required to kill 50% of the cells was evaluated under anaerobic (N2) conditions from chinese hamster V79 cells., IC50 = 0.4 μM. | 7966141 | |||
| V79 | Function assay | Inhibitory concentration required to kill 50% of the cells was evaluated under aerobic conditions from chinese hamster V79 cells., IC50 = 0.8 μM. | 7966141 | |||
| HeLa S3 | Function assay | In vitro anticellular activity against HeLa S3 cells; 0.59-1.1, IC50 = 1.1 μM. | 8021918 | |||
| HeLa S3 | Function assay | In vitro anticellular activity against HeLa S3 cells; 0.82-1.4, IC50 = 1.4 μM. | 8021918 | |||
| HeLa S3 | Function assay | In vitro anticellular activity against HeLa S3 cells, IC50 = 0.59 μM. | 8021919 | |||
| P388 | Function assay | Evaluation of inhibitory activity against drug sensitive P388 cells (P388/S) cells, IC50 = 0.048 μM. | 8544183 | |||
| P388 | Function assay | Evaluation of inhibitory activity against multidrug resistant P388 cells (P388/ADR) cells, IC50 = 0.535 μM. | 8544183 | |||
| HL-60 | Growth inhibition assay | Inhibition of cell growth was studied in human promyelocytic leukemic (HL-60) cells., IC50 = 0.05 μM. | 8709111 | |||
| DC-3F | Growth inhibition assay | Inhibition of cell growth was studied in chinese hamster lung cells (DC-3F), IC50 = 0.082 μM. | 8709111 | |||
| DC-3F/AD-II | Growth inhibition assay | Inhibition of cell growth was studied in chinese hamster lung cells resistant to actinomycin D (DC-3F/AD-II)., IC50 = 0.11 μM. | 8709111 | |||
| V79-379A | Function assay | In vitro concentration required to kill hypoxic cells V79-379A cells, C50 = 0.4 μM. | 9240349 | |||
| aerobic cell | Function assay | In vitro concentration required to kill 50% of the aerobic cells, C50 = 0.8 μM. | 9240349 | |||
| SupT1 | Antiproliferative assay | Antiproliferative activity of compound was evaluated on SupT1 cells from human non-Hodgkin lymphoma, ID50 = 0.7 μM. | 11012027 | |||
| Molt3 | Antiproliferative assay | Antiproliferative activity of compound was evaluated on Molt3 cells from human lymphoblastic leukemia, ID50 = 2.66 μM. | 11012027 | |||
| MCF-7 | Antiproliferative assay | Antiproliferative activity of compound was evaluated on MCF-7 cells from human breast adenocarcinoma, ID50 = 42.92 μM. | 11012027 | |||
| lung cancer cell | Cytotoxicity assay | Cytotoxicity against human lung cancer cells, GI50 = 0.023 μM. | 11473418 | |||
| breast cancer cell | Cytotoxicity assay | Cytotoxicity against human breast cancer cells, GI50 = 0.034 μM. | 11473418 | |||
| CNS cancer cell | Cytotoxicity assay | Cytotoxicity against human CNS cancer cells, GI50 = 0.064 μM. | 11473418 | |||
| stomach cancer cell | Cytotoxicity assay | Cytotoxicity against human stomach cancer cells, GI50 = 0.1 μM. | 11473418 | |||
| ovarian cancer cell | Cytotoxicity assay | Cytotoxicity against human ovarian cancer cells, GI50 = 0.12 μM. | 11473418 | |||
| colon cancer cell | Cytotoxicity assay | Cytotoxicity against human colon cancer cells, GI50 = 0.18 μM. | 11473418 | |||
| HeLa | Cytotoxicity assay | 5 to 8 days | Cytotoxicity against human HeLa cells assessed as inhibition of colony formation after 5 to 8 days by colony assay, IC50 = 0.068 μM. | 11975488 | ||
| K562 | Function assay | In vitro inhibitory activity against K562 leukemia cells, IC50 = 0.001 μM. | 12699386 | |||
| K562 | Function assay | In vitro inhibitory activity against K562 leukemia cells in the presence of pd2, IC50 = 0.0158 μM. | 12699386 | |||
| SCL9 | Cytotoxicity assay | Cytotoxicity against human SCL9 cells by MTT assay, ED50 = 17.4 μM. | 12880314 | |||
| SCL37'6 | Cytotoxicity assay | Cytotoxicity against human SCL37'6 cells by MTT assay, ED50 = 19 μM. | 12880314 | |||
| NUGC4 | Cytotoxicity assay | Cytotoxicity against human NUGC4 cells by MTT assay, ED50 = 19.1 μM. | 12880314 | |||
| SCL | Cytotoxicity assay | Cytotoxicity against human SCL cells by MTT assay, ED50 = 20.2 μM. | 12880314 | |||
| SCL6 | Cytotoxicity assay | Cytotoxicity against human SCL6 cells by MTT assay, ED50 = 20.7 μM. | 12880314 | |||
| KATO III | Cytotoxicity assay | Cytotoxicity against human KATO III cells by MTT assay, ED50 = 49 μM. | 12880314 | |||
| A549 | Cytotoxicity assay | 3 days | Cytotoxicity against human A549 cells after 3 days by SRB assay, IC50 = 0.3 μM. | 16038545 | ||
| KB | Cytotoxicity assay | 3 days | Cytotoxicity against human KB cells after 3 days by SRB assay, IC50 = 0.6 μM. | 16038545 | ||
| HCT8 | Cytotoxicity assay | 3 days | Cytotoxicity against human HCT8 cells after 3 days by SRB assay, IC50 = 0.6 μM. | 16038545 | ||
| MCF7 | Cytotoxicity assay | 3 days | Cytotoxicity against human MCF7 cells after 3 days by SRB assay, IC50 = 1.5 μM. | 16038545 | ||
| PC3 | Cytotoxicity assay | Cytotoxicity against human PC3 cells assessed as cell viability by tryptan blue staining method, EC50 = 0.14 μM. | 17950604 | |||
| A549 | Cytotoxicity assay | Cytotoxicity against human A549 cells assessed as cell viability by tryptan blue staining method, EC50 = 0.43 μM. | 17950604 | |||
| Fb | Cytotoxicity assay | Cytotoxicity against human Fb cells assessed as cell viability by tryptan blue staining method, EC50 = 0.93 μM. | 17950604 | |||
| MCF7 | Cytotoxicity assay | Cytotoxicity against human MCF7 cells assessed as cell viability by tryptan blue staining method, EC50 = 0.96 μM. | 17950604 | |||
| Hc | Cytotoxicity assay | Cytotoxicity against human Hc cells assessed as cell viability by tryptan blue staining method, EC50 = 1.46 μM. | 17950604 | |||
| IE | Cytotoxicity assay | Cytotoxicity against human IE cells assessed as cell viability by tryptan blue staining method, EC50 = 1.46 μM. | 17950604 | |||
| MPC5 | Cytotoxicity assay | Cytotoxicity against human MPC5 cells assessed as cell viability by tryptan blue staining method, EC50 = 2.1 μM. | 17950604 | |||
| MCF7 | Cytotoxicity assay | Cytotoxicity against human MCF7 cells by Alamar blue assay, IC50 = 0.2 μM. | 18037301 | |||
| A549 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human A549 cells after 72 hrs, IC50 = 0.24 μM. | 18037301 | ||
| A549 | Cytotoxicity assay | Cytotoxicity against human A549 cells by Alamar blue assay, IC50 = 0.4 μM. | 18037301 | |||
| MCF7 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human MCF7 cells after 72 hrs, IC50 = 1.2 μM. | 18037301 | ||
| A549 | Cytotoxicity assay | 24 hrs | Cytotoxicity against human A549 cells after 24 hrs, IC50 = 4.5 μM. | 18037301 | ||
| MCF7 | Cytotoxicity assay | 24 hrs | Cytotoxicity against human MCF7 cells after 24 hrs, IC50 = 5 μM. | 18037301 | ||
| HT29 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human HT29 cells after 72 hrs by MTT assay, IC50 = 0.9 μM. | 18222567 | ||
| HT29 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human HT29 cells after 72 hrs by MTT assay in presence of 2 uM dicoumarol, IC50 = 2.1 μM. | 18222567 | ||
| V-C8 | Cytotoxicity assay | 3 days | Cytotoxicity against BRCA2-deficient Chinese hamster V-C8 mutant cells after 3 days by WST1 cell viability assay, IC50 = 0.005 μM. | 18505284 | ||
| BAC29 | Cytotoxicity assay | 3 days | Cytotoxicity against BRCA2-proficient Chinese hamster BAC29 mutant cells after 3 days by WST1 cell viability assay, IC50 = 0.4 μM. | 18505284 | ||
| MCF7 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human MCF7 cells after 72 hrs by Alamar Blue assay, IC50 = 0.2 μM. | 18752870 | ||
| A549 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human A549 cells after 72 hrs by Alamar Blue assay, IC50 = 0.4 μM. | 18752870 | ||
| HCT8 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human HCT8 cells after 72 hrs by SRB assay, IC50 = 0.083 μM. | 18845441 | ||
| HCT8 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human HCT8 cells after 72 hrs by SRB assay, IC90 = 5.7 μM. | 18845441 | ||
| WiDr | Cytotoxicity assay | Cytotoxicity against human WiDr cells by MTT assay, ED50 = 0.18 μM. | 19061391 | |||
| Daoy | Cytotoxicity assay | Cytotoxicity against human Daoy cells by MTT assay, ED50 = 0.21 μM. | 19061391 | |||
| HL60 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HL60 cells after 48 hrs by SRB assay, IC50 = 1.5 μM. | 19432411 | ||
| HeLa | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HeLa cells after 48 hrs by SRB assay, IC50 = 3.3 μM. | 19432411 | ||
| SMMC7721 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human SMMC7721 cells after 48 hrs by SRB assay, IC50 = 5.4 μM. | 19432411 | ||
| PC3 | Antiproliferative assay | 72 hrs | Antiproliferative activity against human PC3 cells after 72 hrs by trypan blue exclusion assay, EC50 = 0.14 μM. | 19674905 | ||
| A549 | Antiproliferative assay | 72 hrs | Antiproliferative activity against human A549 cells after 72 hrs by trypan blue exclusion assay, EC50 = 0.43 μM. | 19674905 | ||
| Hs888Lu | Antiproliferative assay | 72 hrs | Antiproliferative activity against human Hs888Lu cells after 72 hrs by trypan blue exclusion assay, EC50 = 0.56 μM. | 19674905 | ||
| MCF7 | Antiproliferative assay | 72 hrs | Antiproliferative activity against human MCF7 cells after 72 hrs by trypan blue exclusion assay, EC50 = 0.96 μM. | 19674905 | ||
| SVCT-M12 | Antiproliferative assay | 72 hrs | Antiproliferative activity against human SVCT-M12 cells after 72 hrs by trypan blue exclusion assay, EC50 = 0.96 μM. | 19674905 | ||
| IE | Antiproliferative assay | 72 hrs | Antiproliferative activity against human IE cells after 72 hrs by trypan blue exclusion assay, EC50 = 1.46 μM. | 19674905 | ||
| MPC5 | Antiproliferative assay | 72 hrs | Antiproliferative activity against human MPC5 cells after 72 hrs by trypan blue exclusion assay, EC50 = 2.1 μM. | 19674905 | ||
| PC3 | Growth inhibition assay | 48 hrs | Growth inhibition of human PC3 cells after 48 hrs by sulforhodamine B assay, IC50 = 1.5 μM. | 19939522 | ||
| Hep2 | Growth inhibition assay | 48 hrs | Growth inhibition of human Hep2 cells after 48 hrs by sulforhodamine B assay, IC50 = 1.5 μM. | 19939522 | ||
| Daudi | Growth inhibition assay | 24 to 72 hrs | Growth inhibition of human Daudi cells after 24 to 72 hrs by MTT assay, IC50 = 0.45 μM. | 20117936 | ||
| K562 | Growth inhibition assay | 24 to 72 hrs | Growth inhibition of human K562 cells after 24 to 72 hrs by MTT assay, IC50 = 0.47 μM. | 20117936 | ||
| K562-Lucena 1 | Growth inhibition assay | 24 to 72 hrs | Growth inhibition of human K562-Lucena 1 cells after 24 to 72 hrs by MTT assay, IC50 = 2.75 μM. | 20117936 | ||
| PBMC | Growth inhibition assay | 24 to 72 hrs | Growth inhibition of phytohemagglutinin-activated human PBMC cells after 24 to 72 hrs by MTT assay, IC50 = 4.03 μM. | 20117936 | ||
| GM00637 | Cytotoxicity assay | 24 hrs | Cytotoxicity against human GM00637 cells after 24 hrs by MTT assay, IC50 = 0.9 μM. | 20122765 | ||
| DU145 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human DU145 cells after 72 hrs by MTT assay, IC50 = 0.17 μM. | 20605274 | ||
| HeLa | Cytotoxicity assay | 72 hrs | Cytotoxicity against human HeLa cells after 72 hrs by MTT assay, IC50 = 0.27 μM. | 20605274 | ||
| GM00637 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human GM00637 cells after 72 hrs by MTT assay, IC50 = 0.46 μM. | 20605274 | ||
| DU145 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human DU145 cells assessed as reduction in mean cell viability after 72 hrs by MTT assay, IC50 = 0.17 μM. | 22522008 | ||
| HeLa | Cytotoxicity assay | 72 hrs | Cytotoxicity against human HeLa cells assessed as reduction in mean cell viability after 72 hrs by MTT assay, IC50 = 0.27 μM. | 22522008 | ||
| GM00637 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human GM00637 cells assessed as reduction in mean cell viability after 72 hrs by MTT assay, IC50 = 0.46 μM. | 22522008 | ||
| HL60 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human HL60 cells after 72 hrs by WST8 assay, IC50 = 0.1 μM. | 22537363 | ||
| A549 | Cytotoxicity assay | Cytotoxicity against human A549 cells by MTT assay, IC50 = 3 μM. | 22545792 | |||
| HL60 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HL60 cells after 48 hrs by SRB assay, IC50 = 1.8 μM. | 22642381 | ||
| HeLa | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HeLa cells after 48 hrs by SRB assay, IC50 = 3.4 μM. | 22642381 | ||
| SMMC7721 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human SMMC7721 cells after 48 hrs by SRB assay, IC50 = 5.6 μM. | 22642381 | ||
| A549 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human A549 cells after 72 hrs by alamar blue assay, IC50 = 0.4 μM. | 23123017 | ||
| HCT116 | Antiproliferative assay | 48 hrs | Antiproliferative activity against human HCT116 cells after 48 hrs by sulforhodamine B assay, IC50 = 0.5 μM. | 23501113 | ||
| NCI-H23 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human NCI-H23 cells after 48 hrs by MTT assay, IC50 = 2 μM. | 23792352 | ||
| SPCA1 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human SPCA1 cells after 48 hrs by MTT assay, IC50 = 1.68 μM. | 23999045 | ||
| SGC7901 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human SGC7901 cells after 48 hrs by MTT assay, IC50 = 2.05 μM. | 23999045 | ||
| PC3 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human PC3 cells after 48 hrs by SRB assay, IC50 = 1.5 μM. | 24056146 | ||
| HeLa | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HeLa cells after 48 hrs by SRB assay, IC50 = 2 μM. | 24056146 | ||
| MDA-MB-231 | Cytotoxicity assay | 5 days | Cytotoxicity against human MDA-MB-231 cells overexpressing DT-diaphorase after 5 days, EC50 = 0.103 μM. | 24436995 | ||
| MDA-MB-231 | Cytotoxicity assay | 5 days | Cytotoxicity against wild-type human MDA-MB-231 cells after 5 days, EC50 = 1.25 μM. | 24436995 | ||
| HCT15 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HCT15 cells after 48 hrs by sulforhodamine B assay, IC50 = 0.5 μM. | 24910974 | ||
| HeLa | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HeLa cells after 48 hrs by SRB method, IC50 = 3 μM. | 24913558 | ||
| SMMC-7221 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human SMMC-7221 cells after 48 hrs by SRB method, IC50 = 3 μM. | 24913558 | ||
| HL60 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HL60 cells after 48 hrs by SRB method, IC50 = 3 μM. | 24913558 | ||
| PC3 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human PC3 cells after 48 hrs by SRB assay, IC50 = 1.5 μM. | 25176329 | ||
| HeLa | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HeLa cells after 48 hrs by SRB assay, IC50 = 2 μM. | 25176329 | ||
| A549 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human A549 cells after 48 hrs by SRB assay, IC50 = 0.04 μM. | 25259515 | ||
| THP1 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human THP1 cells after 48 hrs by SRB assay, IC50 = 0.1 μM. | 25259515 | ||
| MCF7 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human MCF7 cells after 48 hrs by SRB assay, IC50 = 0.2 μM. | 25259515 | ||
| A549 | Cytotoxicity assay | 24 hrs | Cytotoxicity against human A549 cells assessed as reduction in cell viability after 24 hrs by WST8 assay, IC50 = 0.45 μM. | 25442306 | ||
| SF539 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human SF539 cells after 72 hrs by MTS assay, IC50 = 0.038 μM. | 26335269 | ||
| M14 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human M14 cells after 72 hrs by MTS assay, IC50 = 0.47 μM. | 26335269 | ||
| MDA-MB-468 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human MDA-MB-468 cells after 72 hrs by MTS assay, IC50 = 0.5 μM. | 26335269 | ||
| SF295 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human SF295 cells after 72 hrs by MTS assay, IC50 = 0.54 μM. | 26335269 | ||
| NCI-H226 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human NCI-H226 cells after 72 hrs by MTS assay, IC50 = 0.58 μM. | 26335269 | ||
| A549 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human A549 cells assessed as decrease in cell viability at 10 to 100 uM after 48 hrs by SRB assay, EC50 = 5.2 μM. | 26508550 | ||
| HUT78 | Antiproliferative assay | 48 hrs | Antiproliferative activity against human HUT78 cells after 48 hrs by resazurin reduction assay, IC50 = 0.066 μM. | 26541587 | ||
| Jurkat T | Antiproliferative assay | 48 hrs | Antiproliferative activity against human Jurkat T cells in hypoxic condition after 48 hrs by resazurin reduction assay, IC50 = 0.303 μM. | 26541587 | ||
| HL60 | Antiproliferative assay | 48 hrs | Antiproliferative activity against human HL60 cells after 48 hrs by resazurin reduction assay, IC50 = 0.41 μM. | 26541587 | ||
| Jurkat T | Antiproliferative assay | 48 hrs | Antiproliferative activity against human Jurkat T cells after 48 hrs by resazurin reduction assay, IC50 = 0.578 μM. | 26541587 | ||
| HeLa | Antiproliferative assay | 48 hrs | Antiproliferative activity against human HeLa cells after 48 hrs by resazurin reduction assay, IC50 = 1.87 μM. | 26541587 | ||
| HepG2 | Antiproliferative assay | 48 hrs | Antiproliferative activity against human HepG2 cells after 48 hrs by resazurin reduction assay, IC50 = 2.937 μM. | 26541587 | ||
| T47D | Antiproliferative assay | 48 hrs | Antiproliferative activity against human T47D cells after 48 hrs by resazurin reduction assay, IC50 = 16.97 μM. | 26541587 | ||
| PC3 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human PC3 cells after 72 hrs by CCK-8 assay, IC50 = 1.4 μM. | 26615890 | ||
| A549 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human A549 cells after 72 hrs by CCK-8 assay, IC50 = 1.7 μM. | 26615890 | ||
| A549 | Cytotoxicity assay | Cytotoxicity against human A549 cells, IC50 = 0.5 μM. | 27089214 | |||
| PC3 | Cytotoxicity assay | Cytotoxicity against human PC3 cells, IC50 = 0.5 μM. | 27089214 | |||
| HT-29 | Antiproliferative assay | 72 hrs | Antiproliferative activity against human HT-29 cells expressing NQO1 after 72 hrs by MTT assay, IC50 = 7.099 μM. | 28395199 | ||
| NCI-H596 | Antiproliferative assay | 72 hrs | Antiproliferative activity against NQO1 deficient human NCI-H596 cells after 72 hrs by MTT assay, IC50 = 11.969 μM. | 28395199 | ||
| A549 | Antiproliferative assay | 72 hrs | Antiproliferative activity against human A549 cells expressing NQO1 after 72 hrs by MTT assay, IC50 = 15.525 μM. | 28395199 | ||
| LO2 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human LO2 cells after 72 hrs by MTT assay, IC50 = 25.023 μM. | 28395199 | ||
| CHOK1 | Cytotoxicity assay | 24 hrs | Cytotoxicity against CHOK1 cells incubated for 24 hrs by MTT asasy, IC50 = 13.2 μM. | 28615134 | ||
| A549 | Growth inhibition assay | 72 hrs | Growth inhibition of human A549 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 0.08 μM. | 28682609 | ||
| SKOV3 | Growth inhibition assay | 72 hrs | Growth inhibition of human SKOV3 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 0.1 μM. | 28682609 | ||
| HCT116 | Growth inhibition assay | 72 hrs | Growth inhibition of human HCT116 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 0.2 μM. | 28682609 | ||
| 786-O | Growth inhibition assay | 72 hrs | Growth inhibition of human 786-O cells after 72 hrs by Cell-Titer Glo assay, GI50 = 0.21 μM. | 28682609 | ||
| BxPC3 | Growth inhibition assay | 72 hrs | Growth inhibition of human BxPC3 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 0.38 μM. | 28682609 | ||
| HEC6 | Growth inhibition assay | 72 hrs | Growth inhibition of human HEC6 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 1.4 μM. | 28682609 | ||
| MKN74 | Growth inhibition assay | 72 hrs | Growth inhibition of human MKN74 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 1.7 μM. | 28682609 | ||
| U87MG | Growth inhibition assay | 72 hrs | Growth inhibition of human U87MG cells after 72 hrs by Cell-Titer Glo assay, GI50 = 1.8 μM. | 28682609 | ||
| HuH7 | Growth inhibition assay | 72 hrs | Growth inhibition of human HuH7 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 2 μM. | 28682609 | ||
| MCF7 | Growth inhibition assay | 72 hrs | Growth inhibition of human MCF7 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 2.5 μM. | 28682609 | ||
| MDA-MB-231 | Antiproliferative assay | 48 hrs | Antiproliferative activity against human MDA-MB-231 cells after 48 hrs by MTT assay, IC50 = 4.4 μM. | 29280632 | ||
| HL60 | Antiproliferative assay | 48 hrs | Antiproliferative activity against human HL60 cells after 48 hrs by CCK8 assay, IC50 = 0.19 μM. | 29475587 | ||
| HeLa | Antiproliferative assay | 48 hrs | Antiproliferative activity against human HeLa cells after 48 hrs by CCK8 assay, IC50 = 1.13 μM. | 29475587 | ||
| NTERA-S-cl-D1 | Growth inhibition assay | IC50 = 0.0221 nM | SANGER | |||
| MOLT-4 | Growth inhibition assay | IC50 = 0.0325 nM | SANGER | |||
| J82 | Growth inhibition assay | IC50 = 0.119 nM | SANGER | |||
| 697 | Growth inhibition assay | IC50 = 0.1283 nM | SANGER | |||
| KYSE-510 | Growth inhibition assay | IC50 = 0.1486 nM | SANGER | |||
| NCI-H2170 | Growth inhibition assay | IC50 = 0.1513 nM | SANGER | |||
| BE-13 | Growth inhibition assay | IC50 = 0.1673 nM | SANGER | |||
| LC-2-ad | Growth inhibition assay | IC50 = 0.2492 nM | SANGER | |||
| IMR-5 | Growth inhibition assay | IC50 = 0.3076 nM | SANGER | |||
| EW-16 | Growth inhibition assay | IC50 = 0.31 nM | SANGER | |||
| MC-IXC | Growth inhibition assay | IC50 = 0.638 nM | SANGER | |||
| SW872 | Growth inhibition assay | IC50 = 0.676 nM | SANGER | |||
| NCI-H2228 | Growth inhibition assay | IC50 = 0.7963 nM | SANGER | |||
| NALM-6 | Growth inhibition assay | IC50 = 1.066 nM | SANGER | |||
| ES4 | Growth inhibition assay | IC50 = 1.555 nM | SANGER | |||
| KE-37 | Growth inhibition assay | IC50 = 1.636 nM | SANGER | |||
| IST-MEL1 | Growth inhibition assay | IC50 = 1.684 nM | SANGER | |||
| ES8 | Growth inhibition assay | IC50 = 1.712 nM | SANGER | |||
| MV-4-11 | Growth inhibition assay | IC50 = 1.732 nM | SANGER | |||
| 639-V | Growth inhibition assay | IC50 = 1.759 nM | SANGER | |||
| OCI-AML2 | Growth inhibition assay | IC50 = 1.886 nM | SANGER | |||
| SK-LU-1 | Growth inhibition assay | IC50 = 2.217 nM | SANGER | |||
| REH | Growth inhibition assay | IC50 = 2.548 nM | SANGER | |||
| PSN1 | Growth inhibition assay | IC50 = 2.554 nM | SANGER | |||
| SBC-5 | Growth inhibition assay | IC50 = 2.589 nM | SANGER | |||
| HT-3 | Growth inhibition assay | IC50 = 2.928 nM | SANGER | |||
| SIG-M5 | Growth inhibition assay | IC50 = 3.524 nM | SANGER | |||
| ES7 | Growth inhibition assay | IC50 = 3.653 nM | SANGER | |||
| CHP-212 | Growth inhibition assay | IC50 = 4.368 nM | SANGER | |||
| P12-ICHIKAWA | Growth inhibition assay | IC50 = 4.787 nM | SANGER | |||
| HUTU-80 | Growth inhibition assay | IC50 = 4.83 nM | SANGER | |||
| P30-OHK | Growth inhibition assay | IC50 = 4.842 nM | SANGER | |||
| NCI-H1651 | Growth inhibition assay | IC50 = 4.99 nM | SANGER | |||
| COR-L279 | Growth inhibition assay | IC50 = 5.545 nM | SANGER | |||
| CMK | Growth inhibition assay | IC50 = 5.827 nM | SANGER | |||
| MHH-CALL-2 | Growth inhibition assay | IC50 = 6.06 nM | SANGER | |||
| BV-173 | Growth inhibition assay | IC50 = 6.067 nM | SANGER | |||
| NCI-H209 | Growth inhibition assay | IC50 = 6.168 nM | SANGER | |||
| NCI-H460 | Growth inhibition assay | IC50 = 6.452 nM | SANGER | |||
| DU-145 | Growth inhibition assay | IC50 = 6.519 nM | SANGER | |||
| 769-P | Growth inhibition assay | IC50 = 7.112 nM | SANGER | |||
| ES1 | Growth inhibition assay | IC50 = 7.288 nM | SANGER | |||
| COLO-668 | Growth inhibition assay | IC50 = 7.545 nM | SANGER | |||
| NKM-1 | Growth inhibition assay | IC50 = 7.831 nM | SANGER | |||
| ES3 | Growth inhibition assay | IC50 = 7.882 nM | SANGER | |||
| SCC-3 | Growth inhibition assay | IC50 = 8.519 nM | SANGER | |||
| SU-DHL-1 | Growth inhibition assay | IC50 = 8.609 nM | SANGER | |||
| ML-2 | Growth inhibition assay | IC50 = 8.781 nM | SANGER | |||
| SF295 | Growth inhibition assay | IC50 = 11.48 nM | SANGER | |||
| EW-7 | Growth inhibition assay | IC50 = 12.14 nM | SANGER | |||
| H4 | Growth inhibition assay | IC50 = 12.44 nM | SANGER | |||
| LB2241-RCC | Growth inhibition assay | IC50 = 13.19 nM | SANGER | |||
| SR | Growth inhibition assay | IC50 = 13.46 nM | SANGER | |||
| LB1047-RCC | Growth inhibition assay | IC50 = 13.6 nM | SANGER | |||
| MCF7 | Growth inhibition assay | IC50 = 13.9 nM | SANGER | |||
| ESS-1 | Growth inhibition assay | IC50 = 13.92 nM | SANGER | |||
| NCI-H2122 | Growth inhibition assay | IC50 = 13.96 nM | SANGER | |||
| 786-0 | Growth inhibition assay | IC50 = 14.01 nM | SANGER | |||
| COLO-205 | Growth inhibition assay | IC50 = 14.33 nM | SANGER | |||
| HAL-01 | Growth inhibition assay | IC50 = 15.73 nM | SANGER | |||
| MHH-ES-1 | Growth inhibition assay | IC50 = 16.26 nM | SANGER | |||
| NUGC-3 | Growth inhibition assay | IC50 = 16.95 nM | SANGER | |||
| RPMI-8402 | Growth inhibition assay | IC50 = 17.13 nM | SANGER | |||
| ATN-1 | Growth inhibition assay | IC50 = 17.39 nM | SANGER | |||
| NCI-H441 | Growth inhibition assay | IC50 = 17.6 nM | SANGER | |||
| LB996-RCC | Growth inhibition assay | IC50 = 17.68 nM | SANGER | |||
| CAL-148 | Growth inhibition assay | IC50 = 17.83 nM | SANGER | |||
| CTV-1 | Growth inhibition assay | IC50 = 18.67 nM | SANGER | |||
| HOP-62 | Growth inhibition assay | IC50 = 20.2 nM | SANGER | |||
| CAKI-1 | Growth inhibition assay | IC50 = 23.32 nM | SANGER | |||
| PA-1 | Growth inhibition assay | IC50 = 23.51 nM | SANGER | |||
| HT-144 | Growth inhibition assay | IC50 = 23.75 nM | SANGER | |||
| LOUCY | Growth inhibition assay | IC50 = 26.19 nM | SANGER | |||
| BPH-1 | Growth inhibition assay | IC50 = 29.9 nM | SANGER | |||
| LS-1034 | Growth inhibition assay | IC50 = 30.16 nM | SANGER | |||
| 23132-87 | Growth inhibition assay | IC50 = 30.53 nM | SANGER | |||
| BB30-HNC | Growth inhibition assay | IC50 = 30.61 nM | SANGER | |||
| CAL-51 | Growth inhibition assay | IC50 = 30.86 nM | SANGER | |||
| ALL-PO | Growth inhibition assay | IC50 = 30.98 nM | SANGER | |||
| 5637 | Growth inhibition assay | IC50 = 31.93 nM | SANGER | |||
| KYSE-150 | Growth inhibition assay | IC50 = 34.09 nM | SANGER | |||
| RS4-11 | Growth inhibition assay | IC50 = 34.86 nM | SANGER | |||
| A3-KAW | Growth inhibition assay | IC50 = 34.96 nM | SANGER | |||
| NCI-H719 | Growth inhibition assay | IC50 = 35.12 nM | SANGER | |||
| GI-1 | Growth inhibition assay | IC50 = 35.16 nM | SANGER | |||
| HEL | Growth inhibition assay | IC50 = 35.8 nM | SANGER | |||
| TE-8 | Growth inhibition assay | IC50 = 35.86 nM | SANGER | |||
| HT-29 | Growth inhibition assay | IC50 = 36.02 nM | SANGER | |||
| SW1783 | Growth inhibition assay | IC50 = 38.58 nM | SANGER | |||
| CGTH-W-1 | Growth inhibition assay | IC50 = 38.74 nM | SANGER | |||
| MEL-HO | Growth inhibition assay | IC50 = 39.4 nM | SANGER | |||
| SW620 | Growth inhibition assay | IC50 = 39.79 nM | SANGER | |||
| ME-180 | Growth inhibition assay | IC50 = 40.11 nM | SANGER | |||
| CAL-27 | Growth inhibition assay | IC50 = 41.18 nM | SANGER | |||
| A431 | Growth inhibition assay | IC50 = 43.77 nM | SANGER | |||
| SW954 | Growth inhibition assay | IC50 = 44.91 nM | SANGER | |||
| CAL-39 | Growth inhibition assay | IC50 = 46.49 nM | SANGER | |||
| LU-134-A | Growth inhibition assay | IC50 = 46.72 nM | SANGER | |||
| DU-4475 | Growth inhibition assay | IC50 = 47.47 nM | SANGER | |||
| DEL | Growth inhibition assay | IC50 = 48.39 nM | SANGER | |||
| HGC-27 | Growth inhibition assay | IC50 = 49.29 nM | SANGER | |||
| RH-1 | Growth inhibition assay | IC50 = 49.57 nM | SANGER | |||
| SK-MES-1 | Growth inhibition assay | IC50 = 51.12 nM | SANGER | |||
| MEL-JUSO | Growth inhibition assay | IC50 = 51.25 nM | SANGER | |||
| VA-ES-BJ | Growth inhibition assay | IC50 = 52.16 nM | SANGER | |||
| EW-13 | Growth inhibition assay | IC50 = 52.51 nM | SANGER | |||
| Ca-Ski | Growth inhibition assay | IC50 = 53.75 nM | SANGER | |||
| LXF-289 | Growth inhibition assay | IC50 = 55.37 nM | SANGER | |||
| IM-9 | Growth inhibition assay | IC50 = 56.22 nM | SANGER | |||
| HCE-4 | Growth inhibition assay | IC50 = 57.94 nM | SANGER | |||
| TYK-nu | Growth inhibition assay | IC50 = 58.73 nM | SANGER | |||
| NCI-H748 | Growth inhibition assay | IC50 = 59.54 nM | SANGER | |||
| ABC-1 | Growth inhibition assay | IC50 = 61.2 nM | SANGER | |||
| CCRF-CEM | Growth inhibition assay | IC50 = 61.68 nM | SANGER | |||
| EW-3 | Growth inhibition assay | IC50 = 61.95 nM | SANGER | |||
| NCI-H2342 | Growth inhibition assay | IC50 = 62.51 nM | SANGER | |||
| SK-PN-DW | Growth inhibition assay | IC50 = 63.76 nM | SANGER | |||
| EB2 | Growth inhibition assay | IC50 = 65.36 nM | SANGER | |||
| CAL-85-1 | Growth inhibition assay | IC50 = 65.88 nM | SANGER | |||
| NCI-H526 | Growth inhibition assay | IC50 = 67.37 nM | SANGER | |||
| MFH-ino | Growth inhibition assay | IC50 = 70.61 nM | SANGER | |||
| ACHN | Growth inhibition assay | IC50 = 72.08 nM | SANGER | |||
| MONO-MAC-6 | Growth inhibition assay | IC50 = 72.35 nM | SANGER | |||
| CHP-126 | Growth inhibition assay | IC50 = 72.44 nM | SANGER | |||
| SW1710 | Growth inhibition assay | IC50 = 72.58 nM | SANGER | |||
| TE-10 | Growth inhibition assay | IC50 = 72.6 nM | SANGER | |||
| TE-15 | Growth inhibition assay | IC50 = 73.7 nM | SANGER | |||
| PANC-10-05 | Growth inhibition assay | IC50 = 73.75 nM | SANGER | |||
| BHY | Growth inhibition assay | IC50 = 75.28 nM | SANGER | |||
| HSC-3 | Growth inhibition assay | IC50 = 75.54 nM | SANGER | |||
| COLO-800 | Growth inhibition assay | IC50 = 78.66 nM | SANGER | |||
| NB10 | Growth inhibition assay | IC50 = 81.65 nM | SANGER | |||
| SK-UT-1 | Growth inhibition assay | IC50 = 82.8 nM | SANGER | |||
| HSC-2 | Growth inhibition assay | IC50 = 83.42 nM | SANGER | |||
| GP5d | Growth inhibition assay | IC50 = 84 nM | SANGER | |||
| A204 | Growth inhibition assay | IC50 = 84.19 nM | SANGER | |||
| BFTC-909 | Growth inhibition assay | IC50 = 85.27 nM | SANGER | |||
| NCI-H2087 | Growth inhibition assay | IC50 = 85.69 nM | SANGER | |||
| G-402 | Growth inhibition assay | IC50 = 85.92 nM | SANGER | |||
| 647-V | Growth inhibition assay | IC50 = 87.39 nM | SANGER | |||
| Daoy | Growth inhibition assay | IC50 = 88.01 nM | SANGER | |||
| EW-1 | Growth inhibition assay | IC50 = 88.07 nM | SANGER | |||
| BC-1 | Growth inhibition assay | IC50 = 88.81 nM | SANGER | |||
| OAW-42 | Growth inhibition assay | IC50 = 89.42 nM | SANGER | |||
| COLO-679 | Growth inhibition assay | IC50 = 90.25 nM | SANGER | |||
| TE-11 | Growth inhibition assay | IC50 = 91.77 nM | SANGER | |||
| BFTC-905 | Growth inhibition assay | IC50 = 92.69 nM | SANGER | |||
| KP-4 | Growth inhibition assay | IC50 = 93.15 nM | SANGER | |||
| DOHH-2 | Growth inhibition assay | IC50 = 93.83 nM | SANGER | |||
| L-540 | Growth inhibition assay | IC50 = 95.14 nM | SANGER | |||
| DSH1 | Growth inhibition assay | IC50 = 96.53 nM | SANGER | |||
| M059J | Growth inhibition assay | IC50 = 100.6 nM | SANGER | |||
| UM-UC-3 | Growth inhibition assay | IC50 = 101.83 nM | SANGER | |||
| ES5 | Growth inhibition assay | IC50 = 102.42 nM | SANGER | |||
| KYSE-270 | Growth inhibition assay | IC50 = 102.84 nM | SANGER | |||
| OCUB-M | Growth inhibition assay | IC50 = 102.98 nM | SANGER | |||
| C-4-II | Growth inhibition assay | IC50 = 103.51 nM | SANGER | |||
| BOKU | Growth inhibition assay | IC50 = 103.78 nM | SANGER | |||
| 8-MG-BA | Growth inhibition assay | IC50 = 104 nM | SANGER | |||
| SW982 | Growth inhibition assay | IC50 = 104.73 nM | SANGER | |||
| AGS | Growth inhibition assay | IC50 = 105.8 nM | SANGER | |||
| IGROV-1 | Growth inhibition assay | IC50 = 105.97 nM | SANGER | |||
| HL-60 | Growth inhibition assay | IC50 = 106.06 nM | SANGER | |||
| A2780 | Growth inhibition assay | IC50 = 106.63 nM | SANGER | |||
| HOS | Growth inhibition assay | IC50 = 106.7 nM | SANGER | |||
| HuP-T4 | Growth inhibition assay | IC50 = 108.1 nM | SANGER | |||
| ETK-1 | Growth inhibition assay | IC50 = 108.24 nM | SANGER | |||
| IA-LM | Growth inhibition assay | IC50 = 108.63 nM | SANGER | |||
| MRK-nu-1 | Growth inhibition assay | IC50 = 110.25 nM | SANGER | |||
| SUP-T1 | Growth inhibition assay | IC50 = 110.4 nM | SANGER | |||
| A2058 | Growth inhibition assay | IC50 = 115.1 nM | SANGER | |||
| CAPAN-1 | Growth inhibition assay | IC50 = 116.4 nM | SANGER | |||
| NCI-H1355 | Growth inhibition assay | IC50 = 116.8 nM | SANGER | |||
| NCI-H1618 | Growth inhibition assay | IC50 = 117.76 nM | SANGER | |||
| QIMR-WIL | Growth inhibition assay | IC50 = 119.58 nM | SANGER | |||
| HCC1599 | Growth inhibition assay | IC50 = 120.17 nM | SANGER | |||
| GR-ST | Growth inhibition assay | IC50 = 121.34 nM | SANGER | |||
| G-361 | Growth inhibition assay | IC50 = 123.93 nM | SANGER | |||
| RKO | Growth inhibition assay | IC50 = 125.29 nM | SANGER | |||
| NCI-H1437 | Growth inhibition assay | IC50 = 126.26 nM | SANGER | |||
| SF539 | Growth inhibition assay | IC50 = 127.02 nM | SANGER | |||
| ACN | Growth inhibition assay | IC50 = 127.91 nM | SANGER | |||
| FADU | Growth inhibition assay | IC50 = 128.29 nM | SANGER | |||
| U251 | Growth inhibition assay | IC50 = 128.73 nM | SANGER | |||
| KALS-1 | Growth inhibition assay | IC50 = 129.14 nM | SANGER | |||
| KM-H2 | Growth inhibition assay | IC50 = 130.45 nM | SANGER | |||
| SJSA-1 | Growth inhibition assay | IC50 = 131.56 nM | SANGER | |||
| TE-5 | Growth inhibition assay | IC50 = 132.24 nM | SANGER | |||
| SNG-M | Growth inhibition assay | IC50 = 134.17 nM | SANGER | |||
| HCC1806 | Growth inhibition assay | IC50 = 134.54 nM | SANGER | |||
| NCI-H1734 | Growth inhibition assay | IC50 = 136.85 nM | SANGER | |||
| LCLC-97TM1 | Growth inhibition assay | IC50 = 138.72 nM | SANGER | |||
| NH-12 | Growth inhibition assay | IC50 = 139.13 nM | SANGER | |||
| A375 | Growth inhibition assay | IC50 = 139.42 nM | SANGER | |||
| NCI-SNU-5 | Growth inhibition assay | IC50 = 141.21 nM | SANGER | |||
| SK-OV-3 | Growth inhibition assay | IC50 = 142.64 nM | SANGER | |||
| 22RV1 | Growth inhibition assay | IC50 = 144.07 nM | SANGER | |||
| SW1573 | Growth inhibition assay | IC50 = 144.68 nM | SANGER | |||
| BB65-RCC | Growth inhibition assay | IC50 = 144.71 nM | SANGER | |||
| MES-SA | Growth inhibition assay | IC50 = 144.94 nM | SANGER | |||
| K052 | Growth inhibition assay | IC50 = 149.34 nM | SANGER | |||
| KU812 | Growth inhibition assay | IC50 = 149.96 nM | SANGER | |||
| NOMO-1 | Growth inhibition assay | IC50 = 151.41 nM | SANGER | |||
| Ca9-22 | Growth inhibition assay | IC50 = 155.57 nM | SANGER | |||
| 8305C | Growth inhibition assay | IC50 = 155.75 nM | SANGER | |||
| NCI-SNU-1 | Growth inhibition assay | IC50 = 156.24 nM | SANGER | |||
| HC-1 | Growth inhibition assay | IC50 = 156.51 nM | SANGER | |||
| SW962 | Growth inhibition assay | IC50 = 157.55 nM | SANGER | |||
| HCC2998 | Growth inhibition assay | IC50 = 160.13 nM | SANGER | |||
| DMS-273 | Growth inhibition assay | IC50 = 160.83 nM | SANGER | |||
| MC-CAR | Growth inhibition assay | IC50 = 160.91 nM | SANGER | |||
| Caov-3 | Growth inhibition assay | IC50 = 161.72 nM | SANGER | |||
| EoL-1-cell | Growth inhibition assay | IC50 = 162.39 nM | SANGER | |||
| MKN45 | Growth inhibition assay | IC50 = 165.04 nM | SANGER | |||
| TE-1 | Growth inhibition assay | IC50 = 165.38 nM | SANGER | |||
| HMV-II | Growth inhibition assay | IC50 = 166.06 nM | SANGER | |||
| SK-NEP-1 | Growth inhibition assay | IC50 = 166.53 nM | SANGER | |||
| PANC-03-27 | Growth inhibition assay | IC50 = 167.16 nM | SANGER | |||
| RPMI-7951 | Growth inhibition assay | IC50 = 167.55 nM | SANGER | |||
| NCI-H520 | Growth inhibition assay | IC50 = 168.65 nM | SANGER | |||
| NCI-H522 | Growth inhibition assay | IC50 = 169.45 nM | SANGER | |||
| Detroit562 | Growth inhibition assay | IC50 = 170.26 nM | SANGER | |||
| SF268 | Growth inhibition assay | IC50 = 170.86 nM | SANGER | |||
| T84 | Growth inhibition assay | IC50 = 173.34 nM | SANGER | |||
| NB69 | Growth inhibition assay | IC50 = 175.06 nM | SANGER | |||
| OVCAR-8 | Growth inhibition assay | IC50 = 175.54 nM | SANGER | |||
| RT-112 | Growth inhibition assay | IC50 = 177.98 nM | SANGER | |||
| DoTc2-4510 | Growth inhibition assay | IC50 = 180.37 nM | SANGER | |||
| J-RT3-T3-5 | Growth inhibition assay | IC50 = 185.8 nM | SANGER | |||
| NB1 | Growth inhibition assay | IC50 = 186.61 nM | SANGER | |||
| NEC8 | Growth inhibition assay | IC50 = 186.77 nM | SANGER | |||
| TUR | Growth inhibition assay | IC50 = 189.67 nM | SANGER | |||
| TE-12 | Growth inhibition assay | IC50 = 189.83 nM | SANGER | |||
| WSU-NHL | Growth inhibition assay | IC50 = 192.04 nM | SANGER | |||
| MHH-NB-11 | Growth inhibition assay | IC50 = 192.55 nM | SANGER | |||
| SW48 | Growth inhibition assay | IC50 = 193.36 nM | SANGER | |||
| C3A | Growth inhibition assay | IC50 = 194.31 nM | SANGER | |||
| RPMI-2650 | Growth inhibition assay | IC50 = 195.75 nM | SANGER | |||
| VMRC-RCZ | Growth inhibition assay | IC50 = 198.77 nM | SANGER | |||
| SK-CO-1 | Growth inhibition assay | IC50 = 0.20181 μM | SANGER | |||
| KYSE-180 | Growth inhibition assay | IC50 = 0.20219 μM | SANGER | |||
| KGN | Growth inhibition assay | IC50 = 0.20713 μM | SANGER | |||
| A388 | Growth inhibition assay | IC50 = 0.20722 μM | SANGER | |||
| NCI-H2030 | Growth inhibition assay | IC50 = 0.21132 μM | SANGER | |||
| NCI-H727 | Growth inhibition assay | IC50 = 0.2118 μM | SANGER | |||
| BC-3 | Growth inhibition assay | IC50 = 0.21208 μM | SANGER | |||
| CCF-STTG1 | Growth inhibition assay | IC50 = 0.21559 μM | SANGER | |||
| NMC-G1 | Growth inhibition assay | IC50 = 0.21675 μM | SANGER | |||
| NCI-H1299 | Growth inhibition assay | IC50 = 0.21841 μM | SANGER | |||
| RPMI-6666 | Growth inhibition assay | IC50 = 0.21961 μM | SANGER | |||
| D-283MED | Growth inhibition assay | IC50 = 0.22069 μM | SANGER | |||
| AM-38 | Growth inhibition assay | IC50 = 0.22116 μM | SANGER | |||
| LU-99A | Growth inhibition assay | IC50 = 0.22424 μM | SANGER | |||
| KYSE-70 | Growth inhibition assay | IC50 = 0.22431 μM | SANGER | |||
| CHL-1 | Growth inhibition assay | IC50 = 0.22516 μM | SANGER | |||
| CESS | Growth inhibition assay | IC50 = 0.2254 μM | SANGER | |||
| A4-Fuk | Growth inhibition assay | IC50 = 0.22543 μM | SANGER | |||
| MG-63 | Growth inhibition assay | IC50 = 0.22618 μM | SANGER | |||
| MKN28 | Growth inhibition assay | IC50 = 0.23009 μM | SANGER | |||
| NCI-H1417 | Growth inhibition assay | IC50 = 0.2369 μM | SANGER | |||
| BCPAP | Growth inhibition assay | IC50 = 0.2396 μM | SANGER | |||
| COR-L23 | Growth inhibition assay | IC50 = 0.24094 μM | SANGER | |||
| SIMA | Growth inhibition assay | IC50 = 0.24142 μM | SANGER | |||
| CAL-62 | Growth inhibition assay | IC50 = 0.24185 μM | SANGER | |||
| ARH-77 | Growth inhibition assay | IC50 = 0.24331 μM | SANGER | |||
| COLO-680N | Growth inhibition assay | IC50 = 0.2441 μM | SANGER | |||
| T-24 | Growth inhibition assay | IC50 = 0.24577 μM | SANGER | |||
| PF-382 | Growth inhibition assay | IC50 = 0.25063 μM | SANGER | |||
| NCI-H810 | Growth inhibition assay | IC50 = 0.25161 μM | SANGER | |||
| NCI-H1882 | Growth inhibition assay | IC50 = 0.25709 μM | SANGER | |||
| A101D | Growth inhibition assay | IC50 = 0.25745 μM | SANGER | |||
| NCI-H2126 | Growth inhibition assay | IC50 = 0.2602 μM | SANGER | |||
| VM-CUB-1 | Growth inhibition assay | IC50 = 0.26082 μM | SANGER | |||
| OS-RC-2 | Growth inhibition assay | IC50 = 0.2637 μM | SANGER | |||
| MIA-PaCa-2 | Growth inhibition assay | IC50 = 0.27545 μM | SANGER | |||
| SW837 | Growth inhibition assay | IC50 = 0.27613 μM | SANGER | |||
| NCI-H358 | Growth inhibition assay | IC50 = 0.27626 μM | SANGER | |||
| NCI-H1703 | Growth inhibition assay | IC50 = 0.27688 μM | SANGER | |||
| NCI-H1650 | Growth inhibition assay | IC50 = 0.28257 μM | SANGER | |||
| SW626 | Growth inhibition assay | IC50 = 0.28622 μM | SANGER | |||
| MFE-296 | Growth inhibition assay | IC50 = 0.28623 μM | SANGER | |||
| NCI-H2009 | Growth inhibition assay | IC50 = 0.28857 μM | SANGER | |||
| NCI-H2405 | Growth inhibition assay | IC50 = 0.29434 μM | SANGER | |||
| BL-41 | Growth inhibition assay | IC50 = 0.2949 μM | SANGER | |||
| SNU-C2B | Growth inhibition assay | IC50 = 0.29505 μM | SANGER | |||
| no-10 | Growth inhibition assay | IC50 = 0.2996 μM | SANGER | |||
| A427 | Growth inhibition assay | IC50 = 0.30133 μM | SANGER | |||
| SNB75 | Growth inhibition assay | IC50 = 0.30346 μM | SANGER | |||
| CTB-1 | Growth inhibition assay | IC50 = 0.30637 μM | SANGER | |||
| BT-20 | Growth inhibition assay | IC50 = 0.31197 μM | SANGER | |||
| GT3TKB | Growth inhibition assay | IC50 = 0.31823 μM | SANGER | |||
| COR-L88 | Growth inhibition assay | IC50 = 0.31914 μM | SANGER | |||
| Calu-6 | Growth inhibition assay | IC50 = 0.31971 μM | SANGER | |||
| Calu-3 | Growth inhibition assay | IC50 = 0.32095 μM | SANGER | |||
| IGR-1 | Growth inhibition assay | IC50 = 0.3216 μM | SANGER | |||
| LS-411N | Growth inhibition assay | IC50 = 0.32176 μM | SANGER | |||
| LAN-6 | Growth inhibition assay | IC50 = 0.32779 μM | SANGER | |||
| ONS-76 | Growth inhibition assay | IC50 = 0.32956 μM | SANGER | |||
| MZ7-mel | Growth inhibition assay | IC50 = 0.33256 μM | SANGER | |||
| LB647-SCLC | Growth inhibition assay | IC50 = 0.33608 μM | SANGER | |||
| OE33 | Growth inhibition assay | IC50 = 0.3378 μM | SANGER | |||
| NCI-H1770 | Growth inhibition assay | IC50 = 0.34265 μM | SANGER | |||
| MS-1 | Growth inhibition assay | IC50 = 0.34402 μM | SANGER | |||
| NCI-H650 | Growth inhibition assay | IC50 = 0.34407 μM | SANGER | |||
| MDA-MB-468 | Growth inhibition assay | IC50 = 0.34531 μM | SANGER | |||
| A253 | Growth inhibition assay | IC50 = 0.34564 μM | SANGER | |||
| LOXIMVI | Growth inhibition assay | IC50 = 0.3525 μM | SANGER | |||
| BB49-HNC | Growth inhibition assay | IC50 = 0.35252 μM | SANGER | |||
| HT-1080 | Growth inhibition assay | IC50 = 0.35371 μM | SANGER | |||
| NB5 | Growth inhibition assay | IC50 = 0.3579 μM | SANGER | |||
| LK-2 | Growth inhibition assay | IC50 = 0.35814 μM | SANGER | |||
| KS-1 | Growth inhibition assay | IC50 = 0.36415 μM | SANGER | |||
| OE19 | Growth inhibition assay | IC50 = 0.36496 μM | SANGER | |||
| U031 | Growth inhibition assay | IC50 = 0.3658 μM | SANGER | |||
| HCE-T | Growth inhibition assay | IC50 = 0.37153 μM | SANGER | |||
| NCI-H1304 | Growth inhibition assay | IC50 = 0.37523 μM | SANGER | |||
| SKG-IIIa | Growth inhibition assay | IC50 = 0.37738 μM | SANGER | |||
| GDM-1 | Growth inhibition assay | IC50 = 0.37746 μM | SANGER | |||
| CPC-N | Growth inhibition assay | IC50 = 0.38066 μM | SANGER | |||
| KYSE-140 | Growth inhibition assay | IC50 = 0.38134 μM | SANGER | |||
| SH-4 | Growth inhibition assay | IC50 = 0.38726 μM | SANGER | |||
| IST-SL2 | Growth inhibition assay | IC50 = 0.38762 μM | SANGER | |||
| SCC-4 | Growth inhibition assay | IC50 = 0.3877 μM | SANGER | |||
| OMC-1 | Growth inhibition assay | IC50 = 0.38955 μM | SANGER | |||
| Daudi | Growth inhibition assay | IC50 = 0.39242 μM | SANGER | |||
| JVM-2 | Growth inhibition assay | IC50 = 0.39734 μM | SANGER | |||
| NCI-H510A | Growth inhibition assay | IC50 = 0.40282 μM | SANGER | |||
| NCI-H1838 | Growth inhibition assay | IC50 = 0.40419 μM | SANGER | |||
| GCIY | Growth inhibition assay | IC50 = 0.41099 μM | SANGER | |||
| NCI-H747 | Growth inhibition assay | IC50 = 0.41159 μM | SANGER | |||
| NCI-H1694 | Growth inhibition assay | IC50 = 0.41528 μM | SANGER | |||
| UACC-893 | Growth inhibition assay | IC50 = 0.41801 μM | SANGER | |||
| DMS-153 | Growth inhibition assay | IC50 = 0.42526 μM | SANGER | |||
| GAMG | Growth inhibition assay | IC50 = 0.42821 μM | SANGER | |||
| LB373-MEL-D | Growth inhibition assay | IC50 = 0.42962 μM | SANGER | |||
| 8505C | Growth inhibition assay | IC50 = 0.42983 μM | SANGER | |||
| DB | Growth inhibition assay | IC50 = 0.42995 μM | SANGER | |||
| LoVo | Growth inhibition assay | IC50 = 0.43068 μM | SANGER | |||
| MZ2-MEL | Growth inhibition assay | IC50 = 0.43247 μM | SANGER | |||
| L-363 | Growth inhibition assay | IC50 = 0.43417 μM | SANGER | |||
| HSC-4 | Growth inhibition assay | IC50 = 0.43445 μM | SANGER | |||
| NCI-N87 | Growth inhibition assay | IC50 = 0.43812 μM | SANGER | |||
| SK-LMS-1 | Growth inhibition assay | IC50 = 0.43929 μM | SANGER | |||
| HO-1-N-1 | Growth inhibition assay | IC50 = 0.44064 μM | SANGER | |||
| OAW-28 | Growth inhibition assay | IC50 = 0.44065 μM | SANGER | |||
| SBC-1 | Growth inhibition assay | IC50 = 0.4477 μM | SANGER | |||
| LNCaP-Clone-FGC | Growth inhibition assay | IC50 = 0.45008 μM | SANGER | |||
| MZ1-PC | Growth inhibition assay | IC50 = 0.45011 μM | SANGER | |||
| GB-1 | Growth inhibition assay | IC50 = 0.45218 μM | SANGER | |||
| LCLC-103H | Growth inhibition assay | IC50 = 0.46087 μM | SANGER | |||
| YT | Growth inhibition assay | IC50 = 0.46333 μM | SANGER | |||
| HCT-15 | Growth inhibition assay | IC50 = 0.46462 μM | SANGER | |||
| CaR-1 | Growth inhibition assay | IC50 = 0.46878 μM | SANGER | |||
| SK-MEL-30 | Growth inhibition assay | IC50 = 0.47431 μM | SANGER | |||
| TCCSUP | Growth inhibition assay | IC50 = 0.4817 μM | SANGER | |||
| C-33-A | Growth inhibition assay | IC50 = 0.48687 μM | SANGER | |||
| OVCAR-5 | Growth inhibition assay | IC50 = 0.48711 μM | SANGER | |||
| CAL-12T | Growth inhibition assay | IC50 = 0.49125 μM | SANGER | |||
| PC-14 | Growth inhibition assay | IC50 = 0.49127 μM | SANGER | |||
| ST486 | Growth inhibition assay | IC50 = 0.49436 μM | SANGER | |||
| HLE | Growth inhibition assay | IC50 = 0.49832 μM | SANGER | |||
| TE-9 | Growth inhibition assay | IC50 = 0.50049 μM | SANGER | |||
| AU565 | Growth inhibition assay | IC50 = 0.50096 μM | SANGER | |||
| LU-165 | Growth inhibition assay | IC50 = 0.51311 μM | SANGER | |||
| EW-11 | Growth inhibition assay | IC50 = 0.51336 μM | SANGER | |||
| FTC-133 | Growth inhibition assay | IC50 = 0.51722 μM | SANGER | |||
| NCI-H1648 | Growth inhibition assay | IC50 = 0.52301 μM | SANGER | |||
| AN3-CA | Growth inhibition assay | IC50 = 0.52328 μM | SANGER | |||
| KURAMOCHI | Growth inhibition assay | IC50 = 0.52344 μM | SANGER | |||
| T98G | Growth inhibition assay | IC50 = 0.52375 μM | SANGER | |||
| TK10 | Growth inhibition assay | IC50 = 0.52832 μM | SANGER | |||
| LB2518-MEL | Growth inhibition assay | IC50 = 0.53456 μM | SANGER | |||
| CAL-33 | Growth inhibition assay | IC50 = 0.53653 μM | SANGER | |||
| A172 | Growth inhibition assay | IC50 = 0.53752 μM | SANGER | |||
| D-263MG | Growth inhibition assay | IC50 = 0.54004 μM | SANGER | |||
| CAMA-1 | Growth inhibition assay | IC50 = 0.54059 μM | SANGER | |||
| MKN1 | Growth inhibition assay | IC50 = 0.54081 μM | SANGER | |||
| NCI-H661 | Growth inhibition assay | IC50 = 0.54158 μM | SANGER | |||
| YKG-1 | Growth inhibition assay | IC50 = 0.545 μM | SANGER | |||
| GOTO | Growth inhibition assay | IC50 = 0.55371 μM | SANGER | |||
| KYSE-450 | Growth inhibition assay | IC50 = 0.56311 μM | SANGER | |||
| UMC-11 | Growth inhibition assay | IC50 = 0.56701 μM | SANGER | |||
| DBTRG-05MG | Growth inhibition assay | IC50 = 0.57026 μM | SANGER | |||
| KYSE-410 | Growth inhibition assay | IC50 = 0.58359 μM | SANGER | |||
| MOLT-16 | Growth inhibition assay | IC50 = 0.58519 μM | SANGER | |||
| HCC2218 | Growth inhibition assay | IC50 = 0.58882 μM | SANGER | |||
| EFO-21 | Growth inhibition assay | IC50 = 0.59114 μM | SANGER | |||
| S-117 | Growth inhibition assay | IC50 = 0.59244 μM | SANGER | |||
| HCC1937 | Growth inhibition assay | IC50 = 0.59382 μM | SANGER | |||
| THP-1 | Growth inhibition assay | IC50 = 0.5955 μM | SANGER | |||
| GAK | Growth inhibition assay | IC50 = 0.59624 μM | SANGER | |||
| SW756 | Growth inhibition assay | IC50 = 0.59691 μM | SANGER | |||
| KG-1 | Growth inhibition assay | IC50 = 0.59714 μM | SANGER | |||
| D-542MG | Growth inhibition assay | IC50 = 0.60165 μM | SANGER | |||
| HCC38 | Growth inhibition assay | IC50 = 0.60411 μM | SANGER | |||
| SAS | Growth inhibition assay | IC50 = 0.61465 μM | SANGER | |||
| RVH-421 | Growth inhibition assay | IC50 = 0.62917 μM | SANGER | |||
| JiyoyeP-2003 | Growth inhibition assay | IC50 = 0.62954 μM | SANGER | |||
| G-401 | Growth inhibition assay | IC50 = 0.63447 μM | SANGER | |||
| SW1990 | Growth inhibition assay | IC50 = 0.63705 μM | SANGER | |||
| KP-N-YS | Growth inhibition assay | IC50 = 0.64012 μM | SANGER | |||
| HD-MY-Z | Growth inhibition assay | IC50 = 0.64025 μM | SANGER | |||
| LAMA-84 | Growth inhibition assay | IC50 = 0.64166 μM | SANGER | |||
| SW13 | Growth inhibition assay | IC50 = 0.64249 μM | SANGER | |||
| HCC1569 | Growth inhibition assay | IC50 = 0.64461 μM | SANGER | |||
| CP66-MEL | Growth inhibition assay | IC50 = 0.64495 μM | SANGER | |||
| SK-HEP-1 | Growth inhibition assay | IC50 = 0.64566 μM | SANGER | |||
| NB13 | Growth inhibition assay | IC50 = 0.64603 μM | SANGER | |||
| NY | Growth inhibition assay | IC50 = 0.65739 μM | SANGER | |||
| EHEB | Growth inhibition assay | IC50 = 0.67213 μM | SANGER | |||
| MEG-01 | Growth inhibition assay | IC50 = 0.68336 μM | SANGER | |||
| HCC70 | Growth inhibition assay | IC50 = 0.69433 μM | SANGER | |||
| OVCAR-4 | Growth inhibition assay | IC50 = 0.69691 μM | SANGER | |||
| NCI-H1792 | Growth inhibition assay | IC50 = 0.69734 μM | SANGER | |||
| HEC-1 | Growth inhibition assay | IC50 = 0.69824 μM | SANGER | |||
| NCI-H187 | Growth inhibition assay | IC50 = 0.70799 μM | SANGER | |||
| TGBC24TKB | Growth inhibition assay | IC50 = 0.71 μM | SANGER | |||
| HuP-T3 | Growth inhibition assay | IC50 = 0.71055 μM | SANGER | |||
| SK-MEL-3 | Growth inhibition assay | IC50 = 0.71112 μM | SANGER | |||
| MDA-MB-415 | Growth inhibition assay | IC50 = 0.72395 μM | SANGER | |||
| HCC2157 | Growth inhibition assay | IC50 = 0.72685 μM | SANGER | |||
| NCI-H2081 | Growth inhibition assay | IC50 = 0.74057 μM | SANGER | |||
| ES6 | Growth inhibition assay | IC50 = 0.74562 μM | SANGER | |||
| KYSE-520 | Growth inhibition assay | IC50 = 0.77218 μM | SANGER | |||
| BxPC-3 | Growth inhibition assay | IC50 = 0.77478 μM | SANGER | |||
| NCI-H226 | Growth inhibition assay | IC50 = 0.77721 μM | SANGER | |||
| LB771-HNC | Growth inhibition assay | IC50 = 0.77974 μM | SANGER | |||
| CP50-MEL-B | Growth inhibition assay | IC50 = 0.78003 μM | SANGER | |||
| HN | Growth inhibition assay | IC50 = 0.78254 μM | SANGER | |||
| EW-24 | Growth inhibition assay | IC50 = 0.78297 μM | SANGER | |||
| A673 | Growth inhibition assay | IC50 = 0.7896 μM | SANGER | |||
| COLO-684 | Growth inhibition assay | IC50 = 0.7993 μM | SANGER | |||
| DMS-53 | Growth inhibition assay | IC50 = 0.80856 μM | SANGER | |||
| MDA-MB-361 | Growth inhibition assay | IC50 = 0.80898 μM | SANGER | |||
| SNU-475 | Growth inhibition assay | IC50 = 0.81314 μM | SANGER | |||
| LB831-BLC | Growth inhibition assay | IC50 = 0.81608 μM | SANGER | |||
| RCM-1 | Growth inhibition assay | IC50 = 0.84728 μM | SANGER | |||
| NCI-H2347 | Growth inhibition assay | IC50 = 0.84997 μM | SANGER | |||
| NCI-H2141 | Growth inhibition assay | IC50 = 0.85281 μM | SANGER | |||
| Becker | Growth inhibition assay | IC50 = 0.86232 μM | SANGER | |||
| LC-1F | Growth inhibition assay | IC50 = 0.86233 μM | SANGER | |||
| SCC-15 | Growth inhibition assay | IC50 = 0.86386 μM | SANGER | |||
| U-266 | Growth inhibition assay | IC50 = 0.86618 μM | SANGER | |||
| SCC-25 | Growth inhibition assay | IC50 = 0.87036 μM | SANGER | |||
| NCI-H1155 | Growth inhibition assay | IC50 = 0.87336 μM | SANGER | |||
| NCI-H292 | Growth inhibition assay | IC50 = 0.88441 μM | SANGER | |||
| NCI-H2196 | Growth inhibition assay | IC50 = 0.886 μM | SANGER | |||
| EKVX | Growth inhibition assay | IC50 = 0.893 μM | SANGER | |||
| TE-6 | Growth inhibition assay | IC50 = 0.89367 μM | SANGER | |||
| NCI-H1693 | Growth inhibition assay | IC50 = 0.89963 μM | SANGER | |||
| HuCCT1 | Growth inhibition assay | IC50 = 0.90351 μM | SANGER | |||
| NCI-H1581 | Growth inhibition assay | IC50 = 0.90674 μM | SANGER | |||
| KARPAS-422 | Growth inhibition assay | IC50 = 0.90739 μM | SANGER | |||
| C8166 | Growth inhibition assay | IC50 = 0.93232 μM | SANGER | |||
| BEN | Growth inhibition assay | IC50 = 0.93516 μM | SANGER | |||
| SCLC-21H | Growth inhibition assay | IC50 = 0.96303 μM | SANGER | |||
| HT-1376 | Growth inhibition assay | IC50 = 0.96711 μM | SANGER | |||
| NCI-H1963 | Growth inhibition assay | IC50 = 0.97437 μM | SANGER | |||
| MPP-89 | Growth inhibition assay | IC50 = 0.99122 μM | SANGER | |||
| SW1417 | Growth inhibition assay | IC50 = 1.00545 μM | SANGER | |||
| NCCIT | Growth inhibition assay | IC50 = 1.01024 μM | SANGER | |||
| MMAC-SF | Growth inhibition assay | IC50 = 1.01163 μM | SANGER | |||
| LU-65 | Growth inhibition assay | IC50 = 1.01247 μM | SANGER | |||
| NCI-H1623 | Growth inhibition assay | IC50 = 1.01428 μM | SANGER | |||
| HCT-116 | Growth inhibition assay | IC50 = 1.01502 μM | SANGER | |||
| CA46 | Growth inhibition assay | IC50 = 1.0198 μM | SANGER | |||
| RERF-LC-MS | Growth inhibition assay | IC50 = 1.03157 μM | SANGER | |||
| DJM-1 | Growth inhibition assay | IC50 = 1.03304 μM | SANGER | |||
| EM-2 | Growth inhibition assay | IC50 = 1.03374 μM | SANGER | |||
| HCC1395 | Growth inhibition assay | IC50 = 1.05754 μM | SANGER | |||
| HCC1143 | Growth inhibition assay | IC50 = 1.0664 μM | SANGER | |||
| HH | Growth inhibition assay | IC50 = 1.0738 μM | SANGER | |||
| MDA-MB-453 | Growth inhibition assay | IC50 = 1.07917 μM | SANGER | |||
| COLO-320-HSR | Growth inhibition assay | IC50 = 1.0792 μM | SANGER | |||
| KM12 | Growth inhibition assay | IC50 = 1.08364 μM | SANGER | |||
| KNS-42 | Growth inhibition assay | IC50 = 1.09239 μM | SANGER | |||
| HPAF-II | Growth inhibition assay | IC50 = 1.09715 μM | SANGER | |||
| OVCAR-3 | Growth inhibition assay | IC50 = 1.12787 μM | SANGER | |||
| EFO-27 | Growth inhibition assay | IC50 = 1.13122 μM | SANGER | |||
| L-428 | Growth inhibition assay | IC50 = 1.15778 μM | SANGER | |||
| LS-513 | Growth inhibition assay | IC50 = 1.17808 μM | SANGER | |||
| NB12 | Growth inhibition assay | IC50 = 1.20371 μM | SANGER | |||
| NCI-H23 | Growth inhibition assay | IC50 = 1.20661 μM | SANGER | |||
| TGBC1TKB | Growth inhibition assay | IC50 = 1.21141 μM | SANGER | |||
| LU-139 | Growth inhibition assay | IC50 = 1.21841 μM | SANGER | |||
| Raji | Growth inhibition assay | IC50 = 1.22094 μM | SANGER | |||
| IPC-298 | Growth inhibition assay | IC50 = 1.22841 μM | SANGER | |||
| NCI-H838 | Growth inhibition assay | IC50 = 1.23291 μM | SANGER | |||
| RPMI-8226 | Growth inhibition assay | IC50 = 1.23847 μM | SANGER | |||
| LC4-1 | Growth inhibition assay | IC50 = 1.23959 μM | SANGER | |||
| MN-60 | Growth inhibition assay | IC50 = 1.26332 μM | SANGER | |||
| U-87-MG | Growth inhibition assay | IC50 = 1.27372 μM | SANGER | |||
| BL-70 | Growth inhibition assay | IC50 = 1.27667 μM | SANGER | |||
| MLMA | Growth inhibition assay | IC50 = 1.30978 μM | SANGER | |||
| RPMI-8866 | Growth inhibition assay | IC50 = 1.31777 μM | SANGER | |||
| M14 | Growth inhibition assay | IC50 = 1.3376 μM | SANGER | |||
| RCC10RGB | Growth inhibition assay | IC50 = 1.34936 μM | SANGER | |||
| SK-MEL-24 | Growth inhibition assay | IC50 = 1.37423 μM | SANGER | |||
| SHP-77 | Growth inhibition assay | IC50 = 1.3783 μM | SANGER | |||
| EFE-184 | Growth inhibition assay | IC50 = 1.38125 μM | SANGER | |||
| GI-ME-N | Growth inhibition assay | IC50 = 1.39089 μM | SANGER | |||
| SF126 | Growth inhibition assay | IC50 = 1.40565 μM | SANGER | |||
| Saos-2 | Growth inhibition assay | IC50 = 1.40649 μM | SANGER | |||
| KARPAS-299 | Growth inhibition assay | IC50 = 1.41651 μM | SANGER | |||
| MC116 | Growth inhibition assay | IC50 = 1.41664 μM | SANGER | |||
| NCI-H1563 | Growth inhibition assay | IC50 = 1.42784 μM | SANGER | |||
| COLO-824 | Growth inhibition assay | IC50 = 1.44461 μM | SANGER | |||
| IST-SL1 | Growth inhibition assay | IC50 = 1.4462 μM | SANGER | |||
| HDLM-2 | Growth inhibition assay | IC50 = 1.4601 μM | SANGER | |||
| NCI-H1573 | Growth inhibition assay | IC50 = 1.46085 μM | SANGER | |||
| NCI-H2171 | Growth inhibition assay | IC50 = 1.49785 μM | SANGER | |||
| NOS-1 | Growth inhibition assay | IC50 = 1.50227 μM | SANGER | |||
| COLO-792 | Growth inhibition assay | IC50 = 1.50264 μM | SANGER | |||
| SNU-423 | Growth inhibition assay | IC50 = 1.52181 μM | SANGER | |||
| C32 | Growth inhibition assay | IC50 = 1.52834 μM | SANGER | |||
| KOSC-2 | Growth inhibition assay | IC50 = 1.53103 μM | SANGER | |||
| NCI-H64 | Growth inhibition assay | IC50 = 1.53444 μM | SANGER | |||
| HT | Growth inhibition assay | IC50 = 1.53659 μM | SANGER | |||
| NCI-H596 | Growth inhibition assay | IC50 = 1.5377 μM | SANGER | |||
| NCI-H720 | Growth inhibition assay | IC50 = 1.54425 μM | SANGER | |||
| UACC-257 | Growth inhibition assay | IC50 = 1.56566 μM | SANGER | |||
| EVSA-T | Growth inhibition assay | IC50 = 1.57368 μM | SANGER | |||
| KNS-81-FD | Growth inhibition assay | IC50 = 1.59446 μM | SANGER | |||
| TE-441-T | Growth inhibition assay | IC50 = 1.60276 μM | SANGER | |||
| U-698-M | Growth inhibition assay | IC50 = 1.60291 μM | SANGER | |||
| COR-L105 | Growth inhibition assay | IC50 = 1.61317 μM | SANGER | |||
| KMOE-2 | Growth inhibition assay | IC50 = 1.62413 μM | SANGER | |||
| KY821 | Growth inhibition assay | IC50 = 1.65078 μM | SANGER | |||
| SJRH30 | Growth inhibition assay | IC50 = 1.6742 μM | SANGER | |||
| NCI-H69 | Growth inhibition assay | IC50 = 1.67882 μM | SANGER | |||
| RT4 | Growth inhibition assay | IC50 = 1.69923 μM | SANGER | |||
| LS-123 | Growth inhibition assay | IC50 = 1.72001 μM | SANGER | |||
| BHT-101 | Growth inhibition assay | IC50 = 1.74029 μM | SANGER | |||
| K5 | Growth inhibition assay | IC50 = 1.78398 μM | SANGER | |||
| SK-N-AS | Growth inhibition assay | IC50 = 1.79073 μM | SANGER | |||
| NCI-H322M | Growth inhibition assay | IC50 = 1.80152 μM | SANGER | |||
| NCI-H1793 | Growth inhibition assay | IC50 = 1.81482 μM | SANGER | |||
| CAL-54 | Growth inhibition assay | IC50 = 1.84148 μM | SANGER | |||
| SK-MEL-1 | Growth inhibition assay | IC50 = 1.88815 μM | SANGER | |||
| SiHa | Growth inhibition assay | IC50 = 1.8934 μM | SANGER | |||
| RD | Growth inhibition assay | IC50 = 1.89846 μM | SANGER | |||
| ChaGo-K-1 | Growth inhibition assay | IC50 = 1.91033 μM | SANGER | |||
| SNU-C1 | Growth inhibition assay | IC50 = 1.914 μM | SANGER | |||
| NCI-H1436 | Growth inhibition assay | IC50 = 1.92742 μM | SANGER | |||
| HOP-92 | Growth inhibition assay | IC50 = 1.93658 μM | SANGER | |||
| HT55 | Growth inhibition assay | IC50 = 1.95457 μM | SANGER | |||
| K-562 | Growth inhibition assay | IC50 = 1.97869 μM | SANGER | |||
| NCI-H2052 | Growth inhibition assay | IC50 = 1.98812 μM | SANGER | |||
| HT-1197 | Growth inhibition assay | IC50 = 2.02174 μM | SANGER | |||
| SW1463 | Growth inhibition assay | IC50 = 2.08169 μM | SANGER | |||
| COLO-829 | Growth inhibition assay | IC50 = 2.08684 μM | SANGER | |||
| DMS-114 | Growth inhibition assay | IC50 = 2.08692 μM | SANGER | |||
| EFM-19 | Growth inhibition assay | IC50 = 2.08896 μM | SANGER | |||
| LN-405 | Growth inhibition assay | IC50 = 2.15428 μM | SANGER | |||
| UACC-62 | Growth inhibition assay | IC50 = 2.15533 μM | SANGER | |||
| MDA-MB-134-VI | Growth inhibition assay | IC50 = 2.1586 μM | SANGER | |||
| MDA-MB-157 | Growth inhibition assay | IC50 = 2.19254 μM | SANGER | |||
| COLO-741 | Growth inhibition assay | IC50 = 2.19928 μM | SANGER | |||
| JEG-3 | Growth inhibition assay | IC50 = 2.23191 μM | SANGER | |||
| NB6 | Growth inhibition assay | IC50 = 2.23352 μM | SANGER | |||
| NCI-H1395 | Growth inhibition assay | IC50 = 2.23483 μM | SANGER | |||
| KARPAS-45 | Growth inhibition assay | IC50 = 2.27184 μM | SANGER | |||
| HCC1954 | Growth inhibition assay | IC50 = 2.28119 μM | SANGER | |||
| A704 | Growth inhibition assay | IC50 = 2.38311 μM | SANGER | |||
| SK-N-DZ | Growth inhibition assay | IC50 = 2.38958 μM | SANGER | |||
| EGI-1 | Growth inhibition assay | IC50 = 2.39059 μM | SANGER | |||
| TALL-1 | Growth inhibition assay | IC50 = 2.3955 μM | SANGER | |||
| PANC-08-13 | Growth inhibition assay | IC50 = 2.39777 μM | SANGER | |||
| NCI-H28 | Growth inhibition assay | IC50 = 2.43524 μM | SANGER | |||
| DMS-79 | Growth inhibition assay | IC50 = 2.47163 μM | SANGER | |||
| NCI-H889 | Growth inhibition assay | IC50 = 2.48342 μM | SANGER | |||
| Ramos-2G6-4C10 | Growth inhibition assay | IC50 = 2.54572 μM | SANGER | |||
| BT-474 | Growth inhibition assay | IC50 = 2.62326 μM | SANGER | |||
| JVM-3 | Growth inhibition assay | IC50 = 2.64752 μM | SANGER | |||
| NCI-H524 | Growth inhibition assay | IC50 = 2.7032 μM | SANGER | |||
| SK-MM-2 | Growth inhibition assay | IC50 = 2.71695 μM | SANGER | |||
| TGW | Growth inhibition assay | IC50 = 2.75803 μM | SANGER | |||
| Capan-2 | Growth inhibition assay | IC50 = 2.78528 μM | SANGER | |||
| NCI-H82 | Growth inhibition assay | IC50 = 2.80193 μM | SANGER | |||
| NCI-H716 | Growth inhibition assay | IC50 = 2.82042 μM | SANGER | |||
| MSTO-211H | Growth inhibition assay | IC50 = 2.82369 μM | SANGER | |||
| COLO-678 | Growth inhibition assay | IC50 = 2.88691 μM | SANGER | |||
| AsPC-1 | Growth inhibition assay | IC50 = 2.89855 μM | SANGER | |||
| DV-90 | Growth inhibition assay | IC50 = 2.92143 μM | SANGER | |||
| SNU-387 | Growth inhibition assay | IC50 = 2.93467 μM | SANGER | |||
| KLE | Growth inhibition assay | IC50 = 2.98224 μM | SANGER | |||
| U-118-MG | Growth inhibition assay | IC50 = 3.14284 μM | SANGER | |||
| MHH-PREB-1 | Growth inhibition assay | IC50 = 3.14735 μM | SANGER | |||
| MDA-MB-175-VII | Growth inhibition assay | IC50 = 3.15819 μM | SANGER | |||
| EB-3 | Growth inhibition assay | IC50 = 3.19768 μM | SANGER | |||
| HuH-7 | Growth inhibition assay | IC50 = 3.22286 μM | SANGER | |||
| NCI-H1522 | Growth inhibition assay | IC50 = 3.23546 μM | SANGER | |||
| MDA-MB-231 | Growth inhibition assay | IC50 = 3.23964 μM | SANGER | |||
| NCI-H1092 | Growth inhibition assay | IC50 = 3.2799 μM | SANGER | |||
| KU-19-19 | Growth inhibition assay | IC50 = 3.35835 μM | SANGER | |||
| SNU-449 | Growth inhibition assay | IC50 = 3.36209 μM | SANGER | |||
| CAS-1 | Growth inhibition assay | IC50 = 3.38185 μM | SANGER | |||
| KP-N-YN | Growth inhibition assay | IC50 = 3.41535 μM | SANGER | |||
| P31-FUJ | Growth inhibition assay | IC50 = 3.45775 μM | SANGER | |||
| RMG-I | Growth inhibition assay | IC50 = 3.46127 μM | SANGER | |||
| SN12C | Growth inhibition assay | IC50 = 3.46177 μM | SANGER | |||
| HCC1419 | Growth inhibition assay | IC50 = 3.48402 μM | SANGER | |||
| TT | Growth inhibition assay | IC50 = 3.67775 μM | SANGER | |||
| SW948 | Growth inhibition assay | IC50 = 3.75281 μM | SANGER | |||
| SCC-9 | Growth inhibition assay | IC50 = 3.78753 μM | SANGER | |||
| KMS-12-PE | Growth inhibition assay | IC50 = 3.82788 μM | SANGER | |||
| GMS-10 | Growth inhibition assay | IC50 = 3.83807 μM | SANGER | |||
| EW-18 | Growth inhibition assay | IC50 = 3.9388 μM | SANGER | |||
| SK-MEL-2 | Growth inhibition assay | IC50 = 3.97464 μM | SANGER | |||
| PC-3 | Growth inhibition assay | IC50 = 4.07159 μM | SANGER | |||
| IST-MES1 | Growth inhibition assay | IC50 = 4.14621 μM | SANGER | |||
| PLC-PRF-5 | Growth inhibition assay | IC50 = 4.19446 μM | SANGER | |||
| YAPC | Growth inhibition assay | IC50 = 4.36751 μM | SANGER | |||
| RXF393 | Growth inhibition assay | IC50 = 4.38975 μM | SANGER | |||
| LP-1 | Growth inhibition assay | IC50 = 4.55967 μM | SANGER | |||
| JAR | Growth inhibition assay | IC50 = 4.56384 μM | SANGER | |||
| GCT | Growth inhibition assay | IC50 = 4.6047 μM | SANGER | |||
| SW1088 | Growth inhibition assay | IC50 = 4.66827 μM | SANGER | |||
| NCI-H345 | Growth inhibition assay | IC50 = 4.73193 μM | SANGER | |||
| Calu-1 | Growth inhibition assay | IC50 = 4.8072 μM | SANGER | |||
| ECC4 | Growth inhibition assay | IC50 = 5.07036 μM | SANGER | |||
| DOK | Growth inhibition assay | IC50 = 5.1551 μM | SANGER | |||
| RL | Growth inhibition assay | IC50 = 5.43657 μM | SANGER | |||
| NCI-H1755 | Growth inhibition assay | IC50 = 5.43694 μM | SANGER | |||
| HTC-C3 | Growth inhibition assay | IC50 = 5.78944 μM | SANGER | |||
| PFSK-1 | Growth inhibition assay | IC50 = 5.88351 μM | SANGER | |||
| CAL-120 | Growth inhibition assay | IC50 = 5.96351 μM | SANGER | |||
| Hs-578-T | Growth inhibition assay | IC50 = 6.20302 μM | SANGER | |||
| DG-75 | Growth inhibition assay | IC50 = 6.2494 μM | SANGER | |||
| NCI-H2227 | Growth inhibition assay | IC50 = 6.32364 μM | SANGER | |||
| OPM-2 | Growth inhibition assay | IC50 = 6.34857 μM | SANGER | |||
| T47D | Growth inhibition assay | IC50 = 6.37191 μM | SANGER | |||
| HuO-3N1 | Growth inhibition assay | IC50 = 6.45452 μM | SANGER | |||
| D-392MG | Growth inhibition assay | IC50 = 6.68451 μM | SANGER | |||
| NCI-SNU-16 | Growth inhibition assay | IC50 = 6.74309 μM | SANGER | |||
| CW-2 | Growth inhibition assay | IC50 = 7.72758 μM | SANGER | |||
| no-11 | Growth inhibition assay | IC50 = 7.74202 μM | SANGER | |||
| MFE-280 | Growth inhibition assay | IC50 = 8.34873 μM | SANGER | |||
| KINGS-1 | Growth inhibition assay | IC50 = 8.61164 μM | SANGER | |||
| HCC1187 | Growth inhibition assay | IC50 = 8.9213 μM | SANGER | |||
| NCI-H2452 | Growth inhibition assay | IC50 = 8.93628 μM | SANGER | |||
| C2BBe1 | Growth inhibition assay | IC50 = 9.284 μM | SANGER | |||
| Mewo | Growth inhibition assay | IC50 = 9.55233 μM | SANGER | |||
| MFM-223 | Growth inhibition assay | IC50 = 10.3807 μM | SANGER | |||
| NCI-H446 | Growth inhibition assay | IC50 = 12.4227 μM | SANGER | |||
| RO82-W-1 | Growth inhibition assay | IC50 = 13.3274 μM | SANGER | |||
| EC-GI-10 | Growth inhibition assay | IC50 = 14.9132 μM | SANGER | |||
| UACC-812 | Growth inhibition assay | IC50 = 16.8306 μM | SANGER | |||
| SK-MEL-28 | Growth inhibition assay | IC50 = 18.9731 μM | SANGER | |||
| DK-MG | Growth inhibition assay | IC50 = 21.667 μM | SANGER | |||
| NCI-H1993 | Growth inhibition assay | IC50 = 22.984 μM | SANGER | |||
| U-2-OS | Growth inhibition assay | IC50 = 23.6987 μM | SANGER | |||
| MKN7 | Growth inhibition assay | IC50 = 27.8562 μM | SANGER | |||
| SK-N-FI | Growth inhibition assay | IC50 = 39.7075 μM | SANGER | |||
| CAL-72 | Growth inhibition assay | IC50 = 46.7339 μM | SANGER | |||
| 클릭하여 더 많은 세포주 실험 데이터 보기 | ||||||
화학 정보, 보관 및 안정성
| 분자량 | 334.37 | 화학식 | C15H18N4O5 |
보관 (수령일로부터) | 3 years -20°C(in the dark) powder |
|---|---|---|---|---|---|
| CAS 번호 | 50-07-7 | SDF 다운로드 | 원액 보관 |
|
|
| 동의어 | Ametycine | Smiles | CC1=C(C(=O)C2=C(C1=O)N3CC4C(C3(C2COC(=O)N)OC)N4)N | ||
용해도
|
In vitro |
DMSO
: 66 mg/mL
(197.38 mM)
Water : Insoluble Ethanol : Insoluble |
몰농도 계산기
희석 계산기
분자량 계산기
|
In vivo |
|||||
생체 내 제형 계산기 (투명한 용액)
1단계: 아래 정보 입력 (권장: 실험 중 손실을 고려하여 추가 동물 포함)
mg/kg
g
μL
2단계: 생체 내 제형 입력 (이것은 계산기일 뿐 제형이 아닙니다. 용해도 섹션에 생체 내 제형이 없는 경우 먼저 당사에 문의하십시오.)
% DMSO
%
% Tween 80
% ddH2O
%DMSO
%
계산 결과:
작업 농도: mg/ml;
DMSO 원액 준비 방법: mg 약물 사전 용해 μL DMSO ( 원액 농도 mg/mL, 농도가 해당 약물 배치의 DMSO 용해도를 초과하는 경우 먼저 당사에 문의하십시오. )
생체 내 제형 준비 방법: 취하다 μL DMSO 원액, 다음 추가μL PEG300, 혼합하고 투명하게 한 다음 추가μL Tween 80, 혼합하고 투명하게 한 다음 추가 μL ddH2O, 혼합하고 투명하게 합니다.
생체 내 제형 준비 방법: 취하다 μL DMSO 원액, 다음 추가 μL 옥수수 기름, 혼합하고 투명하게 합니다.
참고: 1. 다음 용매를 추가하기 전에 액체가 투명한지 확인하십시오.
2. 용매를 순서대로 추가해야 합니다. 다음 용매를 추가하기 전에 이전 추가에서 얻은 용액이 투명한 용액인지 확인해야 합니다. 와동, 초음파 또는 뜨거운 물 중탕과 같은 물리적 방법을 사용하여 용해를 도울 수 있습니다.
작용 메커니즘
| Targets/IC50/Ki |
DNA synthesis
|
|---|---|
| 시험관 내(In vitro) |
Mitomycin C는 DNA 가닥간 교차 결합을 유도하여 DNA 복제, 재조합 및 RNA 전사를 물리적으로 차단합니다. 이 화합물은 HCT116 (p53-/-) 대장암 세포에서 TRAIL 유도 세포자멸사를 증강시키고 JNK 비의존적인 사망 수용체 상향 조절을 통해 TRAIL 내성 대장암 세포 HT-29를 사이토카인에 민감하게 만듭니다. OVCAR-5 (난소), HT-29 (대장), SK-N-MC (신경모세포종), HEP-2 (간), COLO-205 (대장), NIH-OVCAR-3 (난소) 및 A-549 (폐) 세포와 같은 다양한 인간 암세포주에서 이 화학물질은 세포독성 활성을 보입니다. |
| 생체 내(In vivo) |
표재성 방광 종양의 임상적 첫 번째 선택으로, 쥐 방광 종양 모델에서 Mitomycin C (400 μM)는 방광 내 종양 성장을 유의하게 예방합니다. |
참조 |
|
적용 분야
| 방법 | 바이오마커 | 이미지 | PMID |
|---|---|---|---|
| Western blot | PARP / Caspase 8 / Caspase 9 / Cleaved caspase-9 / Caspase 3 / Cleaved caspase-3 p-Akt / Akt / p-S6K / S6K / p-Jun / JNK Beclin 1 / p62 / ATG5 GRP78 / CHOP / Caspase-4 / Cleaved caspase-4 |
|
24901052 |
임상시험 정보
(데이터 출처 https://clinicaltrials.gov, 업데이트 날짜 2024-05-22)
| NCT 번호 | 모집 | 조건 | 스폰서/협력자 | 시작일 | 단계 |
|---|---|---|---|---|---|
| NCT04934540 | Recruiting | Bladder Cancer |
Chinese University of Hong Kong |
January 1 2020 | -- |
| NCT02199327 | Completed | Conjunctival Intraepithelial Neoplasia|Corneal Intraepithelial Neoplasia |
Coordinación de Investigación en Salud Mexico|Instituto Mexicano del Seguro Social|University of Guadalajara |
May 2014 | Phase 4 |
기술 지원
제품은 연구용으로만 사용됩니다. 인체에는 사용하지 마십시오. 환자에게 판매하지 않습니다.
©Copyright 2013 Selleck Chemicals. All Rights Reserved.