Home Cytoskeletal Signaling Antineoplastic and Immunosuppressive Antibiotics 억제제 Paclitaxel

연구용

Paclitaxel Microtubule 중합체 안정제

제품 번호S1150

Paclitaxel은 인간 내피 세포에서 0.1 pM의 IC50을 갖는 microtubule 중합체 안정제입니다. Paclitaxel은 유사 분열 정지 및 세포 사멸을 유발할 수 있습니다. Paclitaxel은 또한 Autophagy를 유도합니다.
Paclitaxel Antineoplastic and Immunosuppressive Antibiotics 억제제 Chemical Structure

화학 구조

분자량: 853.91

바로가기

품질 관리

배치: 순도: 99.99%
99.99

세포 배양, 처리 및 작업 농도

세포주 분석 유형 농도 배양 시간 제형 활성 설명 PMID
TE-15 Growth Inhibition Assay IC50 = 0.0002869 μM SANGER
LC-2-ad Growth Inhibition Assay IC50 = 0.0003167 μM SANGER
RL95-2 Growth Inhibition Assay IC50 = 0.0006681 μM SANGER
MZ1-PC Growth Inhibition Assay IC50 = 0.0007294 μM SANGER
TE-8 Growth Inhibition Assay IC50 = 0.001174 μM SANGER
SW954 Growth Inhibition Assay IC50 = 0.001187 μM SANGER
TE-11 Growth Inhibition Assay IC50 = 0.001231 μM SANGER
PSN1 Growth Inhibition Assay IC50 = 0.001301 μM SANGER
MOLT-4 Growth Inhibition Assay IC50 = 0.001493 μM SANGER
697 Growth Inhibition Assay IC50 = 0.001495 μM SANGER
ETK-1 Growth Inhibition Assay IC50 = 0.001521 μM SANGER
TE-10 Growth Inhibition Assay IC50 = 0.001543 μM SANGER
HUTU-80 Growth Inhibition Assay IC50 = 0.001682 μM SANGER
NTERA-S-cl-D1 Growth Inhibition Assay IC50 = 0.002088 μM SANGER
MFH-ino Growth Inhibition Assay IC50 = 0.00268 μM SANGER
IA-LM Growth Inhibition Assay IC50 = 0.002802 μM SANGER
MC116 Growth Inhibition Assay IC50 = 0.002888 μM SANGER
RKO Growth Inhibition Assay IC50 = 0.002977 μM SANGER
MRK-nu-1 Growth Inhibition Assay IC50 = 0.00299 μM SANGER
VA-ES-BJ Growth Inhibition Assay IC50 = 0.002996 μM SANGER
KALS-1 Growth Inhibition Assay IC50 = 0.00308 μM SANGER
BB30-HNC Growth Inhibition Assay IC50 = 0.003138 μM SANGER
ACN Growth Inhibition Assay IC50 = 0.003157 μM SANGER
TE-9 Growth Inhibition Assay IC50 = 0.003255 μM SANGER
SIG-M5 Growth Inhibition Assay IC50 = 0.003272 μM SANGER
no-10 Growth Inhibition Assay IC50 = 0.003618 μM SANGER
EW-1 Growth Inhibition Assay IC50 = 0.003714 μM SANGER
SK-LMS-1 Growth Inhibition Assay IC50 = 0.004006 μM SANGER
GT3TKB Growth Inhibition Assay IC50 = 0.004339 μM SANGER
ES4 Growth Inhibition Assay IC50 = 0.004494 μM SANGER
IMR-5 Growth Inhibition Assay IC50 = 0.004496 μM SANGER
NCI-H1648 Growth Inhibition Assay IC50 = 0.004687 μM SANGER
MV-4-11 Growth Inhibition Assay IC50 = 0.004747 μM SANGER
SK-UT-1 Growth Inhibition Assay IC50 = 0.004803 μM SANGER
NB13 Growth Inhibition Assay IC50 = 0.004912 μM SANGER
DJM-1 Growth Inhibition Assay IC50 = 0.005301 μM SANGER
ES8 Growth Inhibition Assay IC50 = 0.00538 μM SANGER
TE-6 Growth Inhibition Assay IC50 = 0.005703 μM SANGER
KS-1 Growth Inhibition Assay IC50 = 0.005816 μM SANGER
TE-1 Growth Inhibition Assay IC50 = 0.006059 μM SANGER
ATN-1 Growth Inhibition Assay IC50 = 0.00609 μM SANGER
A4-Fuk Growth Inhibition Assay IC50 = 0.006109 μM SANGER
ALL-PO Growth Inhibition Assay IC50 = 0.006298 μM SANGER
BE-13 Growth Inhibition Assay IC50 = 0.006363 μM SANGER
KM12 Growth Inhibition Assay IC50 = 0.006373 μM SANGER
NOS-1 Growth Inhibition Assay IC50 = 0.006496 μM SANGER
OCUB-M Growth Inhibition Assay IC50 = 0.006617 μM SANGER
SW962 Growth Inhibition Assay IC50 = 0.006623 μM SANGER
NCI-H510A Growth Inhibition Assay IC50 = 0.006652 μM SANGER
EW-16 Growth Inhibition Assay IC50 = 0.006937 μM SANGER
KGN Growth Inhibition Assay IC50 = 0.007124 μM SANGER
LS-411N Growth Inhibition Assay IC50 = 0.007166 μM SANGER
Becker Growth Inhibition Assay IC50 = 0.0072 μM SANGER
HC-1 Growth Inhibition Assay IC50 = 0.007213 μM SANGER
CESS Growth Inhibition Assay IC50 = 0.007374 μM SANGER
KURAMOCHI Growth Inhibition Assay IC50 = 0.007478 μM SANGER
TGBC24TKB Growth Inhibition Assay IC50 = 0.007523 μM SANGER
SW982 Growth Inhibition Assay IC50 = 0.00766 μM SANGER
HCE-4 Growth Inhibition Assay IC50 = 0.007671 μM SANGER
LOUCY Growth Inhibition Assay IC50 = 0.00775 μM SANGER
8-MG-BA Growth Inhibition Assay IC50 = 0.007958 μM SANGER
HT-144 Growth Inhibition Assay IC50 = 0.008003 μM SANGER
LXF-289 Growth Inhibition Assay IC50 = 0.008184 μM SANGER
RS4-11 Growth Inhibition Assay IC50 = 0.008357 μM SANGER
DEL Growth Inhibition Assay IC50 = 0.008449 μM SANGER
OCI-AML2 Growth Inhibition Assay IC50 = 0.008521 μM SANGER
CCRF-CEM Growth Inhibition Assay IC50 = 0.008708 μM SANGER
A388 Growth Inhibition Assay IC50 = 0.008738 μM SANGER
KNS-42 Growth Inhibition Assay IC50 = 0.008907 μM SANGER
OVCAR-4 Growth Inhibition Assay IC50 = 0.009041 μM SANGER
NCI-H1355 Growth Inhibition Assay IC50 = 0.009138 μM SANGER
BL-70 Growth Inhibition Assay IC50 = 0.009303 μM SANGER
BL-41 Growth Inhibition Assay IC50 = 0.009345 μM SANGER
A101D Growth Inhibition Assay IC50 = 0.009598 μM SANGER
HL-60 Growth Inhibition Assay IC50 = 0.009656 μM SANGER
COR-L279 Growth Inhibition Assay IC50 = 0.00999 μM SANGER
NCI-SNU-16 Growth Inhibition Assay IC50 = 0.01008 μM SANGER
Calu-6 Growth Inhibition Assay IC50 = 0.01012 μM SANGER
SR Growth Inhibition Assay IC50 = 0.01026 μM SANGER
QIMR-WIL Growth Inhibition Assay IC50 = 0.01033 μM SANGER
LB647-SCLC Growth Inhibition Assay IC50 = 0.01051 μM SANGER
RPMI-8226 Growth Inhibition Assay IC50 = 0.01102 μM SANGER
SK-PN-DW Growth Inhibition Assay IC50 = 0.01112 μM SANGER
SF268 Growth Inhibition Assay IC50 = 0.01151 μM SANGER
HD-MY-Z Growth Inhibition Assay IC50 = 0.01163 μM SANGER
DOHH-2 Growth Inhibition Assay IC50 = 0.01203 μM SANGER
SCC-3 Growth Inhibition Assay IC50 = 0.01204 μM SANGER
ST486 Growth Inhibition Assay IC50 = 0.01204 μM SANGER
NALM-6 Growth Inhibition Assay IC50 = 0.01214 μM SANGER
NCI-H1436 Growth Inhibition Assay IC50 = 0.01231 μM SANGER
KE-37 Growth Inhibition Assay IC50 = 0.01234 μM SANGER
RPMI-8402 Growth Inhibition Assay IC50 = 0.01256 μM SANGER
RXF393 Growth Inhibition Assay IC50 = 0.01257 μM SANGER
KARPAS-45 Growth Inhibition Assay IC50 = 0.0127 μM SANGER
HOP-62 Growth Inhibition Assay IC50 = 0.01276 μM SANGER
ES1 Growth Inhibition Assay IC50 = 0.01288 μM SANGER
L-363 Growth Inhibition Assay IC50 = 0.01351 μM SANGER
GI-1 Growth Inhibition Assay IC50 = 0.01373 μM SANGER
CTV-1 Growth Inhibition Assay IC50 = 0.01478 μM SANGER
SNU-C2B Growth Inhibition Assay IC50 = 0.01496 μM SANGER
TE-5 Growth Inhibition Assay IC50 = 0.01496 μM SANGER
K-562 Growth Inhibition Assay IC50 = 0.01516 μM SANGER
SNB75 Growth Inhibition Assay IC50 = 0.0154 μM SANGER
MOLT-13 Growth Inhibition Assay IC50 = 0.01637 μM SANGER
LS-123 Growth Inhibition Assay IC50 = 0.01664 μM SANGER
NCI-SNU-5 Growth Inhibition Assay IC50 = 0.01701 μM SANGER
Daudi Growth Inhibition Assay IC50 = 0.01708 μM SANGER
A253 Growth Inhibition Assay IC50 = 0.01738 μM SANGER
TGBC1TKB Growth Inhibition Assay IC50 = 0.01752 μM SANGER
SJSA-1 Growth Inhibition Assay IC50 = 0.01767 μM SANGER
NCCIT Growth Inhibition Assay IC50 = 0.01769 μM SANGER
NCI-H69 Growth Inhibition Assay IC50 = 0.01778 μM SANGER
SH-4 Growth Inhibition Assay IC50 = 0.01895 μM SANGER
HCC1187 Growth Inhibition Assay IC50 = 0.01924 μM SANGER
HCC1599 Growth Inhibition Assay IC50 = 0.0202 μM SANGER
ONS-76 Growth Inhibition Assay IC50 = 0.02036 μM SANGER
KU812 Growth Inhibition Assay IC50 = 0.02039 μM SANGER
ML-2 Growth Inhibition Assay IC50 = 0.02047 μM SANGER
HCE-T Growth Inhibition Assay IC50 = 0.02092 μM SANGER
NCI-H446 Growth Inhibition Assay IC50 = 0.02112 μM SANGER
RPMI-6666 Growth Inhibition Assay IC50 = 0.02149 μM SANGER
MOLT-16 Growth Inhibition Assay IC50 = 0.02153 μM SANGER
JiyoyeP-2003 Growth Inhibition Assay IC50 = 0.02176 μM SANGER
MHH-PREB-1 Growth Inhibition Assay IC50 = 0.02191 μM SANGER
MC-CAR Growth Inhibition Assay IC50 = 0.02326 μM SANGER
BC-3 Growth Inhibition Assay IC50 = 0.02344 μM SANGER
KINGS-1 Growth Inhibition Assay IC50 = 0.02355 μM SANGER
PF-382 Growth Inhibition Assay IC50 = 0.02378 μM SANGER
J-RT3-T3-5 Growth Inhibition Assay IC50 = 0.02383 μM SANGER
SF539 Growth Inhibition Assay IC50 = 0.02401 μM SANGER
LB831-BLC Growth Inhibition Assay IC50 = 0.02485 μM SANGER
DMS-114 Growth Inhibition Assay IC50 = 0.02502 μM SANGER
LB1047-RCC Growth Inhibition Assay IC50 = 0.0251 μM SANGER
BB65-RCC Growth Inhibition Assay IC50 = 0.02534 μM SANGER
LB771-HNC Growth Inhibition Assay IC50 = 0.02534 μM SANGER
BV-173 Growth Inhibition Assay IC50 = 0.02554 μM SANGER
ARH-77 Growth Inhibition Assay IC50 = 0.02601 μM SANGER
IST-MEL1 Growth Inhibition Assay IC50 = 0.02623 μM SANGER
NB1 Growth Inhibition Assay IC50 = 0.02687 μM SANGER
EoL-1-cell Growth Inhibition Assay IC50 = 0.02688 μM SANGER
KY821 Growth Inhibition Assay IC50 = 0.02697 μM SANGER
CMK Growth Inhibition Assay IC50 = 0.02734 μM SANGER
NCI-H2126 Growth Inhibition Assay IC50 = 0.02768 μM SANGER
NCI-H526 Growth Inhibition Assay IC50 = 0.02891 μM SANGER
COLO-684 Growth Inhibition Assay IC50 = 0.02908 μM SANGER
NCI-H747 Growth Inhibition Assay IC50 = 0.02933 μM SANGER
JAR Growth Inhibition Assay IC50 = 0.02946 μM SANGER
MEG-01 Growth Inhibition Assay IC50 = 0.02978 μM SANGER
MONO-MAC-6 Growth Inhibition Assay IC50 = 0.03023 μM SANGER
IST-SL1 Growth Inhibition Assay IC50 = 0.03042 μM SANGER
CPC-N Growth Inhibition Assay IC50 = 0.03079 μM SANGER
NCI-H1963 Growth Inhibition Assay IC50 = 0.03131 μM SANGER
K052 Growth Inhibition Assay IC50 = 0.03247 μM SANGER
KM-H2 Growth Inhibition Assay IC50 = 0.03307 μM SANGER
TE-12 Growth Inhibition Assay IC50 = 0.03309 μM SANGER
TK10 Growth Inhibition Assay IC50 = 0.03356 μM SANGER
NMC-G1 Growth Inhibition Assay IC50 = 0.03452 μM SANGER
no-11 Growth Inhibition Assay IC50 = 0.03478 μM SANGER
NCI-H524 Growth Inhibition Assay IC50 = 0.03529 μM SANGER
MHH-CALL-2 Growth Inhibition Assay IC50 = 0.03562 μM SANGER
GB-1 Growth Inhibition Assay IC50 = 0.036 μM SANGER
OPM-2 Growth Inhibition Assay IC50 = 0.03673 μM SANGER
RH-1 Growth Inhibition Assay IC50 = 0.03819 μM SANGER
NCI-H64 Growth Inhibition Assay IC50 = 0.03857 μM SANGER
EVSA-T Growth Inhibition Assay IC50 = 0.03923 μM SANGER
KARPAS-299 Growth Inhibition Assay IC50 = 0.0398 μM SANGER
MZ7-mel Growth Inhibition Assay IC50 = 0.0404 μM SANGER
LB373-MEL-D Growth Inhibition Assay IC50 = 0.04105 μM SANGER
HEL Growth Inhibition Assay IC50 = 0.0414 μM SANGER
SW872 Growth Inhibition Assay IC50 = 0.0421 μM SANGER
DU-4475 Growth Inhibition Assay IC50 = 0.04244 μM SANGER
IST-SL2 Growth Inhibition Assay IC50 = 0.04275 μM SANGER
NCI-H82 Growth Inhibition Assay IC50 = 0.04307 μM SANGER
LC4-1 Growth Inhibition Assay IC50 = 0.04351 μM SANGER
HDLM-2 Growth Inhibition Assay IC50 = 0.04392 μM SANGER
MMAC-SF Growth Inhibition Assay IC50 = 0.04534 μM SANGER
L-540 Growth Inhibition Assay IC50 = 0.04639 μM SANGER
MZ2-MEL Growth Inhibition Assay IC50 = 0.04742 μM SANGER
LU-134-A Growth Inhibition Assay IC50 = 0.04773 μM SANGER
UACC-257 Growth Inhibition Assay IC50 = 0.04849 μM SANGER
NCI-H1581 Growth Inhibition Assay IC50 = 0.04953 μM SANGER
NB17 Growth Inhibition Assay IC50 = 0.04979 μM SANGER
SBC-1 Growth Inhibition Assay IC50 = 0.05042 μM SANGER
TALL-1 Growth Inhibition Assay IC50 = 0.05045 μM SANGER
NCI-H1304 Growth Inhibition Assay IC50 = 0.05208 μM SANGER
NEC8 Growth Inhibition Assay IC50 = 0.05286 μM SANGER
CAL-148 Growth Inhibition Assay IC50 = 0.05439 μM SANGER
CGTH-W-1 Growth Inhibition Assay IC50 = 0.05449 μM SANGER
NCI-H889 Growth Inhibition Assay IC50 = 0.05592 μM SANGER
GR-ST Growth Inhibition Assay IC50 = 0.05621 μM SANGER
KARPAS-422 Growth Inhibition Assay IC50 = 0.0565 μM SANGER
RPMI-8866 Growth Inhibition Assay IC50 = 0.05712 μM SANGER
SCLC-21H Growth Inhibition Assay IC50 = 0.05884 μM SANGER
COR-L88 Growth Inhibition Assay IC50 = 0.05927 μM SANGER
LU-139 Growth Inhibition Assay IC50 = 0.05986 μM SANGER
SF126 Growth Inhibition Assay IC50 = 0.06133 μM SANGER
NCI-H1882 Growth Inhibition Assay IC50 = 0.06424 μM SANGER
EW-24 Growth Inhibition Assay IC50 = 0.06483 μM SANGER
CP67-MEL Growth Inhibition Assay IC50 = 0.0681 μM SANGER
DG-75 Growth Inhibition Assay IC50 = 0.06899 μM SANGER
LOXIMVI Growth Inhibition Assay IC50 = 0.07028 μM SANGER
HH Growth Inhibition Assay IC50 = 0.07157 μM SANGER
K5 Growth Inhibition Assay IC50 = 0.07226 μM SANGER
EC-GI-10 Growth Inhibition Assay IC50 = 0.07257 μM SANGER
SK-N-DZ Growth Inhibition Assay IC50 = 0.07307 μM SANGER
A3-KAW Growth Inhibition Assay IC50 = 0.07351 μM SANGER
MLMA Growth Inhibition Assay IC50 = 0.07465 μM SANGER
LB996-RCC Growth Inhibition Assay IC50 = 0.07707 μM SANGER
OS-RC-2 Growth Inhibition Assay IC50 = 0.07748 μM SANGER
CTB-1 Growth Inhibition Assay IC50 = 0.0781 μM SANGER
IST-MES1 Growth Inhibition Assay IC50 = 0.07912 μM SANGER
LS-1034 Growth Inhibition Assay IC50 = 0.08035 μM SANGER
HT Growth Inhibition Assay IC50 = 0.08086 μM SANGER
NCI-H2141 Growth Inhibition Assay IC50 = 0.081 μM SANGER
LB2518-MEL Growth Inhibition Assay IC50 = 0.08141 μM SANGER
GI-ME-N Growth Inhibition Assay IC50 = 0.08452 μM SANGER
TGW Growth Inhibition Assay IC50 = 0.08607 μM SANGER
SK-NEP-1 Growth Inhibition Assay IC50 = 0.08641 μM SANGER
NOMO-1 Growth Inhibition Assay IC50 = 0.09275 μM SANGER
ES6 Growth Inhibition Assay IC50 = 0.09589 μM SANGER
NCI-H209 Growth Inhibition Assay IC50 = 0.09786 μM SANGER
GAK Growth Inhibition Assay IC50 = 0.1016 μM SANGER
BC-1 Growth Inhibition Assay IC50 = 0.10361 μM SANGER
KLE Growth Inhibition Assay IC50 = 0.10443 μM SANGER
EW-3 Growth Inhibition Assay IC50 = 0.1098 μM SANGER
NKM-1 Growth Inhibition Assay IC50 = 0.111 μM SANGER
D-336MG Growth Inhibition Assay IC50 = 0.11244 μM SANGER
NB69 Growth Inhibition Assay IC50 = 0.11301 μM SANGER
D-263MG Growth Inhibition Assay IC50 = 0.11712 μM SANGER
KP-N-YS Growth Inhibition Assay IC50 = 0.12291 μM SANGER
NCI-H1155 Growth Inhibition Assay IC50 = 0.12558 μM SANGER
BOKU Growth Inhibition Assay IC50 = 0.12579 μM SANGER
LAMA-84 Growth Inhibition Assay IC50 = 0.1299 μM SANGER
Raji Growth Inhibition Assay IC50 = 0.13117 μM SANGER
LU-65 Growth Inhibition Assay IC50 = 0.13307 μM SANGER
NCI-H187 Growth Inhibition Assay IC50 = 0.13924 μM SANGER
GCIY Growth Inhibition Assay IC50 = 0.14901 μM SANGER
NCI-H2107 Growth Inhibition Assay IC50 = 0.1508 μM SANGER
NCI-H1522 Growth Inhibition Assay IC50 = 0.15266 μM SANGER
NB6 Growth Inhibition Assay IC50 = 0.15623 μM SANGER
EM-2 Growth Inhibition Assay IC50 = 0.15706 μM SANGER
HCC2218 Growth Inhibition Assay IC50 = 0.1598 μM SANGER
NCI-H748 Growth Inhibition Assay IC50 = 0.16376 μM SANGER
MS-1 Growth Inhibition Assay IC50 = 0.16537 μM SANGER
NB5 Growth Inhibition Assay IC50 = 0.16597 μM SANGER
OMC-1 Growth Inhibition Assay IC50 = 0.16688 μM SANGER
NCI-H345 Growth Inhibition Assay IC50 = 0.16928 μM SANGER
L-428 Growth Inhibition Assay IC50 = 0.16945 μM SANGER
SCH Growth Inhibition Assay IC50 = 0.18685 μM SANGER
NCI-H1417 Growth Inhibition Assay IC50 = 0.19227 μM SANGER
COLO-320-HSR Growth Inhibition Assay IC50 = 0.19532 μM SANGER
BT-474 Growth Inhibition Assay IC50 = 0.20892 μM SANGER
GDM-1 Growth Inhibition Assay IC50 = 0.21971 μM SANGER
NCI-H2196 Growth Inhibition Assay IC50 = 0.22235 μM SANGER
KP-N-RT-BM-1 Growth Inhibition Assay IC50 = 0.22349 μM SANGER
KNS-81-FD Growth Inhibition Assay IC50 = 0.22958 μM SANGER
COLO-668 Growth Inhibition Assay IC50 = 0.23675 μM SANGER
C2BBe1 Growth Inhibition Assay IC50 = 0.26747 μM SANGER
Ramos-2G6-4C10 Growth Inhibition Assay IC50 = 0.26954 μM SANGER
CAS-1 Growth Inhibition Assay IC50 = 0.27096 μM SANGER
GOTO Growth Inhibition Assay IC50 = 0.27894 μM SANGER
LP-1 Growth Inhibition Assay IC50 = 0.28057 μM SANGER
NCI-SNU-1 Growth Inhibition Assay IC50 = 0.29422 μM SANGER
EB-3 Growth Inhibition Assay IC50 = 0.29979 μM SANGER
MHH-NB-11 Growth Inhibition Assay IC50 = 0.30402 μM SANGER
SK-N-FI Growth Inhibition Assay IC50 = 0.31692 μM SANGER
HCC2157 Growth Inhibition Assay IC50 = 0.33913 μM SANGER
SIMA Growth Inhibition Assay IC50 = 0.34581 μM SANGER
MDA-MB-134-VI Growth Inhibition Assay IC50 = 0.36928 μM SANGER
NCI-H1694 Growth Inhibition Assay IC50 = 0.37 μM SANGER
EHEB Growth Inhibition Assay IC50 = 0.39085 μM SANGER
U-266 Growth Inhibition Assay IC50 = 0.39846 μM SANGER
LC-1F Growth Inhibition Assay IC50 = 0.43765 μM SANGER
SHP-77 Growth Inhibition Assay IC50 = 0.47855 μM SANGER
LS-513 Growth Inhibition Assay IC50 = 0.49307 μM SANGER
TE-441-T Growth Inhibition Assay IC50 = 0.52479 μM SANGER
D-247MG Growth Inhibition Assay IC50 = 0.59924 μM SANGER
SNU-C1 Growth Inhibition Assay IC50 = 0.61887 μM SANGER
SU-DHL-1 Growth Inhibition Assay IC50 = 0.6289 μM SANGER
DB Growth Inhibition Assay IC50 = 0.82872 μM SANGER
CP66-MEL Growth Inhibition Assay IC50 = 0.95198 μM SANGER
NCI-H1650 Growth Inhibition Assay IC50 = 1.04651 μM SANGER
DMS-153 Growth Inhibition Assay IC50 = 1.10124 μM SANGER
A498 Growth Inhibition Assay IC50 = 1.21534 μM SANGER
U-698-M Growth Inhibition Assay IC50 = 1.22557 μM SANGER
NCI-H1092 Growth Inhibition Assay IC50 = 1.30719 μM SANGER
NCI-H23 Growth Inhibition Assay IC50 = 1.3319 μM SANGER
JVM-2 Growth Inhibition Assay IC50 = 1.42177 μM SANGER
MSTO-211H Growth Inhibition Assay IC50 = 1.43905 μM SANGER
A704 Growth Inhibition Assay IC50 = 1.51191 μM SANGER
ECC4 Growth Inhibition Assay IC50 = 1.54949 μM SANGER
NCI-H226 Growth Inhibition Assay IC50 = 1.71489 μM SANGER
CA46 Growth Inhibition Assay IC50 = 1.73216 μM SANGER
NCI-H719 Growth Inhibition Assay IC50 = 1.73651 μM SANGER
KMS-12-PE Growth Inhibition Assay IC50 = 1.90481 μM SANGER
MPP-89 Growth Inhibition Assay IC50 = 1.94182 μM SANGER
NCI-H2171 Growth Inhibition Assay IC50 = 2.20593 μM SANGER
CHP-126 Growth Inhibition Assay IC50 = 2.24737 μM SANGER
DMS-79 Growth Inhibition Assay IC50 = 2.27644 μM SANGER
SCC-15 Growth Inhibition Assay IC50 = 2.30678 μM SANGER
REH Growth Inhibition Assay IC50 = 2.31165 μM SANGER
NCI-H2081 Growth Inhibition Assay IC50 = 2.32315 μM SANGER
NCI-H720 Growth Inhibition Assay IC50 = 2.55972 μM SANGER
KMOE-2 Growth Inhibition Assay IC50 = 2.75712 μM SANGER
D-502MG Growth Inhibition Assay IC50 = 2.86805 μM SANGER
MN-60 Growth Inhibition Assay IC50 = 2.95245 μM SANGER
LU-165 Growth Inhibition Assay IC50 = 3.01956 μM SANGER
DSH1 Growth Inhibition Assay IC50 = 3.23442 μM SANGER
SK-MM-2 Growth Inhibition Assay IC50 = 3.54385 μM SANGER
LAN-6 Growth Inhibition Assay IC50 = 3.54788 μM SANGER
NCI-H1838 Growth Inhibition Assay IC50 = 4.18573 μM SANGER
U-87-MG Growth Inhibition Assay IC50 = 4.18673 μM SANGER
NB7 Growth Inhibition Assay IC50 = 4.40376 μM SANGER
BB49-HNC Growth Inhibition Assay IC50 = 4.94617 μM SANGER
NCI-H1395 Growth Inhibition Assay IC50 = 5.00345 μM SANGER
RCC10RGB Growth Inhibition Assay IC50 = 5.06271 μM SANGER
COLO-824 Growth Inhibition Assay IC50 = 5.08313 μM SANGER
NCI-H322M Growth Inhibition Assay IC50 = 5.186 μM SANGER
SW684 Growth Inhibition Assay IC50 = 5.23288 μM SANGER
P30-OHK Growth Inhibition Assay IC50 = 5.35052 μM SANGER
COLO-829 Growth Inhibition Assay IC50 = 5.49884 μM SANGER
HAL-01 Growth Inhibition Assay IC50 = 5.73185 μM SANGER
LNCaP-Clone-FGC Growth Inhibition Assay IC50 = 6.34489 μM SANGER
SK-MEL-1 Growth Inhibition Assay IC50 = 6.70896 μM SANGER
THP-1 Growth Inhibition Assay IC50 = 6.72583 μM SANGER
EW-18 Growth Inhibition Assay IC50 = 7.03675 μM SANGER
EKVX Growth Inhibition Assay IC50 = 7.16865 μM SANGER
NB14 Growth Inhibition Assay IC50 = 7.8139 μM SANGER
ES5 Growth Inhibition Assay IC50 = 7.86662 μM SANGER
SK-MEL-2 Growth Inhibition Assay IC50 = 8.45976 μM SANGER
COLO-800 Growth Inhibition Assay IC50 = 8.4787 μM SANGER
EB2 Growth Inhibition Assay IC50 = 9.19835 μM SANGER
ES3 Growth Inhibition Assay IC50 = 9.30665 μM SANGER
SKM-1 Growth Inhibition Assay IC50 = 9.39459 μM SANGER
MFM-223 Growth Inhibition Assay IC50 = 9.50127 μM SANGER
LB2241-RCC Growth Inhibition Assay IC50 = 10.0386 μM SANGER
EW-13 Growth Inhibition Assay IC50 = 10.3333 μM SANGER
D-283MED Growth Inhibition Assay IC50 = 10.4959 μM SANGER
EW-11 Growth Inhibition Assay IC50 = 11.6694 μM SANGER
NCI-H128 Growth Inhibition Assay IC50 = 12.1334 μM SANGER
ES7 Growth Inhibition Assay IC50 = 15.2494 μM SANGER
AM-38 Growth Inhibition Assay IC50 = 15.4166 μM SANGER
NCI-H716 Growth Inhibition Assay IC50 = 17.9299 μM SANGER
NCI-H1770 Growth Inhibition Assay IC50 = 18.3851 μM SANGER
JVM-3 Growth Inhibition Assay IC50 = 20.8985 μM SANGER
CW-2 Growth Inhibition Assay IC50 = 21.1349 μM SANGER
YT Growth Inhibition Assay IC50 = 21.4691 μM SANGER
C8166 Growth Inhibition Assay IC50 = 22.2746 μM SANGER
SUP-T1 Growth Inhibition Assay IC50 = 23.2512 μM SANGER
KASUMI-1 Growth Inhibition Assay IC50 = 23.5119 μM SANGER
IM-9 Growth Inhibition Assay IC50 = 23.6979 μM SANGER
NH-12 Growth Inhibition Assay IC50 = 24.1654 μM SANGER
WSU-NHL Growth Inhibition Assay IC50 = 25.7261 μM SANGER
TUR Growth Inhibition Assay IC50 = 26.6533 μM SANGER
RL Growth Inhibition Assay IC50 = 27.2242 μM SANGER
EW-12 Growth Inhibition Assay IC50 = 28.0702 μM SANGER
KG-1 Growth Inhibition Assay IC50 = 28.2865 μM SANGER
P31-FUJ Growth Inhibition Assay IC50 = 29.0489 μM SANGER
NB10 Growth Inhibition Assay IC50 = 31.509 μM SANGER
COLO205 Cytotoxicity assay GI50 = 0.00176 μM 7908950
SF539 Cytotoxicity assay GI50 = 0.00366 μM 7908950
SNB75 Cytotoxicity assay GI50 = 0.00808 μM 7908950
DMS114 Cytotoxicity assay GI50 = 0.0123 μM 7908950
OVCAR-3 Cytotoxicity assay GI50 = 0.0197 μM 7908950
NCI-H460 Cytotoxicity assay GI50 = 0.0219 μM 7908950
HOP62 Cytotoxicity assay GI50 = 0.0671 μM 7908950
mammary carcinoma Cytotoxicity assay IC50 = 0.299 μM 8182698
NCI60 Cytotoxicity assay GI50 = 0.00065 μM 9461653
MCF-7 Growth inhibition assay GI50 = 0.0011 μM 9873597
murine leukemic P388 Growth inhibition assay GI50 = 0.016 μM 9873597
KB Cytotoxicity assay IC50 = 0.006 μM 10978200
MCF7 Antiproliferative activity assay 72 h IC50 = 0.002 μM 11325226
MCF-7 Cytotoxicity assay ED50 = 0.004 μM 11334567
uterine sarcoma (MES-SA) Cytotoxicity assay IC50 = 0.00004 μM 11728191
nonsmall cell lung carcinoma (NCI-H460) Cytotoxicity assay IC50 = 0.00014 μM 11728191
colon adenocarcinoma (HT-29) Cytotoxicity assay IC50 = 0.00016 μM 11728191
prostate carcinoma (DU-145) Cytotoxicity assay IC50 = 0.00489 μM 11728191
SW626 Cytotoxicity assay 72 h IC50 = 0.00001 μM 12088425
Lu1 Cytotoxicity assay 72 h IC50 = 0.01 μM 12088425
MCF7 Cytotoxicity assay 72 h IC50 = 0.02 μM 12088425
P388 Cytotoxicity assay 72 h IC50 = 0.02 μM 12088425
LNCAP Cytotoxicity assay 72 h IC50 = 0.02 μM 12088425
KB Cytotoxicity assay 72 h IC50 = 0.02 μM 12088425
Col2 Cytotoxicity assay 72 h IC50 = 0.02 μM 12088425
BC1 Cytotoxicity assay 72 h IC50 = 0.02 μM 12088425
SK-MEL-2 Cytotoxicity assay 72 h IC50 = 0.07 μM 12088425
L2987 Cytotoxicity assay IC50 = 0.2 μM 12443783
colon adenocarcinoma RKO Cytotoxicity assay IC50 = 0.01 μM 12852768
NCI-H460 Cytotoxicity assay 48 h IC50 = 0.0095 μM 14695798
MCF7 Cytotoxicity assay 48 h IC50 = 0.0112 μM 14695798
SF268 Cytotoxicity assay 48 h IC50 = 0.0217 μM 14695798
MDA-MB-231 Cytotoxicity assay 48 h IC50 = 0.0045 μM 14987051
MCF7 Cytotoxicity assay 48 h IC50 = 0.0049 μM 14987051
A2780 Cytotoxicity assay 48 h IC50 = 0.025 μM 14987051
PC3 Cytotoxicity assay 48 h IC50 = 0.077 μM 14987051
MCF7 Cytotoxicity assay 72 h IC50 = 0.0014 μM 14987056
multidrug-resistant MCF7 Cytotoxicity assay 72 h IC50 = 0.354 μM 14987056
PC3 Cytotoxicity assay 48 h IC50 = 0.016 μM 15043402
Hep3B Cytotoxicity assay 48 h IC50 = 0.031 μM 15043402
NCI-H460 Cytotoxicity assay 48 h IC50 = 0.0095 μM 15043404
MCF7 Cytotoxicity assay 48 h IC50 = 0.0112 μM 15043404
SF268 Cytotoxicity assay 48 h IC50 = 0.0217 μM 15043404
KB Cytotoxicity assay ED50 = 0.0004 μM 15043407
Lu1 Cytotoxicity assay ED50 = 0.002 μM 15043407
LNCAP Cytotoxicity assay ED50 = 0.005 μM 15043407
RPE1 Cytotoxicity assay ED50 = 0.023 μM 15043407
Col2 Cytotoxicity assay ED50 = 0.046 μM 15043407
T47D Apoptosis assay 24 h EC50 = 0.03 μM 15566300
DLD1 Apoptosis assay 24 h EC50 = 0.075 μM 15566300
H1299 Apoptosis assay 24 h EC50 = 0.163 μM 15566300
VA13 Cytotoxicity assay 48 h IC50 = 0.005 μM 15730243
WI 38 Cytotoxicity assay 48 h IC50 = 0.04 μM 15730243
Hep G2 Cytotoxicity assay 48 h IC50 = 8.1 μM 15730243
A549 Cytotoxicity assay 48 h IC50 = 1.25 μM 15787460
SKOV3 Cytotoxicity assay 48 h IC50 = 1.35 μM 15787460
KB Cytotoxicity assay 3 days IC50 = 0.001 μM 16038545
1A9 Cytotoxicity assay 3 days IC50 = 0.002 μM 16038545
HCT8 Cytotoxicity assay 3 days IC50 = 0.013 μM 16038545
A431 Cell cycle arrest assay EC50 = 0.009 μM 16377187
VA13 Growth inhibition assay 48 h IC50 = 0.0043 μM 16499322
WI38 Growth inhibition assay 48 h IC50 = 0.034 μM 16499322
HepG2 Growth inhibition assay 48 h IC50 = 6.9 μM 16499322
Aro Cytotoxicity assay IC50 = 0.0002 μM 16539377
PT45 Cytotoxicity assay IC50 = 0.005 μM 16539377
A549 Cytotoxicity assay IC50 = 0.006 μM 16539377
MCF7 Cytotoxicity assay IC50 = 0.007 μM 16539377
HeLa Cytotoxicity assay IC50 = 0.008 μM 16539377
Ovcar3 Cytotoxicity assay IC50 = 0.01 μM 16539377
HT29 Cytotoxicity assay IC50 = 0.05 μM 16539377
H295R Cytotoxicity assay IC50 = 0.08 μM 16539377
BNL Cytotoxicity assay IC50 = 0.2 μM 16539377
4T1 Cytotoxicity assay IC50 = 0.2 μM 16539377
HepG2 Cytotoxicity assay IC50 = 0.3 μM 16539377
U937 GTB Cytotoxicity assay 72 h IC50 = 0.0059 μM 16562840
RPMI 8226/s Cytotoxicity assay 72 h IC50 = 0.007 μM 16562840
CEM/s Cytotoxicity assay 72 h IC50 = 0.007 μM 16562840
VA13 Cytotoxicity assay IC50 = 0.0059 μM 16724842
WI38 Cytotoxicity assay IC50 = 0.0468 μM 16724842
HepG2 Cytotoxicity assay IC50 = 9.49 μM 16724842
HT29 Cytotoxicity assay EC50 = 0.006 μM 16870428
K562 Cytotoxicity assay EC50 = 0.014 μM 16870428
MCF7 Cytotoxicity assay EC50 = 0.036 μM 16870428
VA-13 Cytotoxicity assay IC50 = 0.005 μM 16933868
WI38 Cytotoxicity assay IC50 = 0.04 μM 16933868
VA13 Cytotoxicity assay IC50 = 0.005 μM 17067155
WI38 Cytotoxicity assay IC50 = 0.04 μM 17067155
Hep G2 Cytotoxicity assay IC50 = 8.1 μM 17067155
TW01 Cytotoxicity assay IC50 = 0.0003 μM 17113288
MCF7 Cytotoxicity assay IC50 = 0.0005 μM 17113288
MKN45 Cytotoxicity assay IC50 = 0.0005 μM 17113288
MES-SA Cytotoxicity assay IC50 = 0.0005 μM 17113288
HCT116 Cytotoxicity assay IC50 = 0.0006 μM 17113288
RPTEC Cytotoxicity assay IC50 = 0.0009 μM 17113288
Hep3B Cytotoxicity assay IC50 = 0.0054 μM 17113288
NCI-H226 Cytotoxicity assay IC50 = 0.0068 μM 17113288
A498 Cytotoxicity assay IC50 = 0.061 μM 17113288
MDA435/LCC6 Antiproliferative activity assay IC50 = 0.0029 μM 17154505
multidrug resistant MDA435/LCC6 Antiproliferative activity assay IC50 = 0.0048 μM 17154505
P388 Antiproliferative activity assay IC50 = 0.022 μM 17154505
adriamycin resistant P388 Antiproliferative activity assay IC50 = 0.03 μM 17154505
LT12 Antiproliferative activity assay 48 h IC50 = 0.006 μM 17181164
SKOV3 Antiproliferative activity assay 48 h IC50 = 0.01 μM 17181164
NCI-H460 Antiproliferative activity assay 48 h IC50 = 0.01 μM 17181164
SF268 Antiproliferative activity assay 48 h IC50 = 0.01 μM 17181164
RKO Antiproliferative activity assay 48 h IC50 = 0.01 μM 17181164
KB/HeLa Antiproliferative activity assay 48 h IC50 = 0.01 μM 17181164
P388 Antiproliferative activity assay 48 h IC50 = 0.04 μM 17181164
L1210 Antiproliferative activity assay 48 h IC50 = 0.06 μM 17181164
LT12 MDR Antiproliferative activity assay 48 h IC50 = 0.4 μM 17181164
A2780 Cytotoxicity assay IC50 = 0.001 μM 17206139
A2780-1A9 Cytotoxicity assay IC50 = 0.0011 μM 17206139
A549 Cytotoxicity assay IC50 = 0.0036 μM 17206139
1A9PTX22 Cytotoxicity assay IC50 = 0.019 μM 17206139
1A9PTX10 Cytotoxicity assay IC50 = 0.03 μM 17206139
A2780AD Cytotoxicity assay IC50 = 0.9 μM 17206139
KB Antiproliferative activity assay IC50 = 0.00245 μM 17228873
COLO205 Cytotoxicity assay IC50 = 0.0033 μM 17228873
KB8.5 Antiproliferative activity assay IC50 = 0.026 μM 17228873
KBV1 Antiproliferative activity assay IC50 = 2.013 μM 17228873
A2780 Cytotoxicity assay IC50 = 0.0007 μM 17239597
2780AD Cytotoxicity assay IC50 = 0.535 μM 17239597
1A9 Cytotoxicity assay ED50 = 0.001 μM 17350834
MCF7 Cytotoxicity assay ED50 = 0.0011 μM 17350834
DU145 Cytotoxicity assay ED50 = 0.0013 μM 17350834
KB Cytotoxicity assay ED50 = 0.0018 μM 17350834
A549 Cytotoxicity assay ED50 = 0.0023 μM 17350834
LNCAP Cytotoxicity assay ED50 = 0.0026 μM 17350834
PC3 Cytotoxicity assay ED50 = 0.0555 μM 17350834
KBVIN Cytotoxicity assay ED50 = 0.311 μM 17350834
A2780 Cytotoxicity assay IC50 = 0.0016 μM 17395465
A2780/AD Cytotoxicity assay IC50 = 0.92 μM 17395465
KB Antiproliferative activity assay IC50 = 0.00245 μM 17416524
COLO205 Cytotoxicity assay IC50 = 0.0033 μM 17416524
KB8.5 Antiproliferative activity assay IC50 = 0.026 μM 17416524
KBV1 Antiproliferative activity assay IC50 = 2.013 μM 17416524
neural precursor Antiproliferative activity assay EC50 = 0.01 μM 17417631
OVCAR-3 Cytotoxicity assay IC50 = 0.0002 μM 17419065
MDA-MB-231 Cytotoxicity assay IC50 = 0.0045 μM 17419065
MCF7 Cytotoxicity assay IC50 = 0.0049 μM 17419065
NCI-H1299 Cytotoxicity assay 96 h IC50 = 0.015 μM 17419065
A2780 Cytotoxicity assay IC50 = 0.025 μM 17419065
PC3 Cytotoxicity assay IC50 = 0.077 μM 17419065
LoVo Cytotoxicity assay IC50 = 0.09 μM 17419065
L2987 Cytotoxicity assay IC50 = 0.2 μM 17419065
cells Cytotoxicity assay IC50 = 0.0059 μM 17442577
cells Cytotoxicity assay IC50 = 0.01 μM 17485207
A2780 Growth inhibition assay IC50 = 0.0028 μM 17490878
VA13 Growth inhibition assay IC50 = 0.005 μM 17490878
WI38 Growth inhibition assay IC50 = 0.04 μM 17490878
2780AD Growth inhibition assay IC50 = 0.183 μM 17490878
HepG2 Growth inhibition assay IC50 = 8.1 μM 17490878
HT29 Growth inhibition assay 48 h GI50 = 0.015 μM 17498960
M21 Growth inhibition assay 48 h GI50 = 0.037 μM 17498960
MCF7 Growth inhibition assay 48 h GI50 = 0.054 μM 17498960
1A9 Growth inhibition assay 72 h GI50 = 0.00071 μM 17542572
1A9/Ptx22 Growth inhibition assay 72 h GI50 = 0.051 μM 17542572
1A9/Ptx10 Growth inhibition assay 72 h GI50 = 0.064 μM 17542572
cells expressing MRP1 Growth inhibition assay IC50 = 0.0025 μM 17567121
cells expressing Pgp/MRP1 Growth inhibition assay IC50 = 2.7 μM 17567121
VA13 Growth inhibition assay IC50 = 5 μM 17595134
MCF7 Function assay IC50 = 0.0018 μM 17601739
adriamycin-resistant MCF7 Function assay IC50 = 8.2 μM 17601739
RPMI8226 Cytotoxicity assay GI50 = 0.002 μM 17696332
HT29 Cytotoxicity assay GI50 = 0.002 μM 17696332
COLO205 Cytotoxicity assay GI50 = 0.003 μM 17696332
HCC2998 Cytotoxicity assay GI50 = 0.003 μM 17696332
HS578T Cytotoxicity assay GI50 = 0.003 μM 17696332
PC3 Cytotoxicity assay GI50 = 0.004 μM 17696332
SNB75 Cytotoxicity assay GI50 = 0.004 μM 17696332
A549 Cytotoxicity assay GI50 = 0.004 μM 17696332
KM12 Cytotoxicity assay GI50 = 0.004 μM 17696332
DU145 Cytotoxicity assay GI50 = 0.005 μM 17696332
SK-OV3 Cytotoxicity assay GI50 = 0.008 μM 17696332
NCI-H322M Cytotoxicity assay GI50 = 0.013 μM 17696332
UACC257 Cytotoxicity assay GI50 = 0.04 μM 17696332
HCT15 Cytotoxicity assay GI50 = 0.158 μM 17696332
ACHN Cytotoxicity assay GI50 = 0.398 μM 17696332
HeLa Cytotoxicity assay IC50 = 0.0056 μM 17764148
MCF7 Cytotoxicity assay IC50 = 0.0124 μM 17764148
A549 Cytotoxicity assay IC50 = 0.0126 μM 17764148
HGC27 Cytotoxicity assay IC50 = 0.7778 μM 17764148
HL60 Cytotoxicity assay 72 h IC50 = 0.93 μM 17896816
P388 Cytotoxicity assay 72 h IC50 = 0.93 μM 17896816
BEL-7402 Cytotoxicity assay 24 h IC50 = 0.93 μM 17896816
A459 Cytotoxicity assay 24 h IC50 = 0.93 μM 17896816
HeLa Cytotoxicity assay IC50 = 0.02 μM 17911017
HepG2 Cytotoxicity assay IC50 = 0.82 μM 17911017
BGC823 Cytotoxicity assay IC50 = 1.15 μM 17911017
Aro Cytotoxicity assay 72 h IC50 = 0.0002 μM 17915851
PT45 Cytotoxicity assay 72 h IC50 = 0.005 μM 17915851
A549 Cytotoxicity assay 72 h IC50 = 0.006 μM 17915851
MCF7 Cytotoxicity assay 72 h IC50 = 0.007 μM 17915851
HeLa Cytotoxicity assay 72 h IC50 = 0.008 μM 17915851
Ovcar3 Cytotoxicity assay 72 h IC50 = 0.01 μM 17915851
HT29 Cytotoxicity assay 72 h IC50 = 0.05 μM 17915851
A549T12 Cytotoxicity assay 72 h IC50 = 0.06 μM 17915851
H295R Cytotoxicity assay 72 h IC50 = 0.08 μM 17915851
A549T24 Cytotoxicity assay 72 h IC50 = 0.102 μM 17915851
OE33 Cytotoxicity assay 72 h IC50 = 0.2 μM 17915851
HepG2 Cytotoxicity assay 72 h IC50 = 0.3 μM 17915851
OE19 Cytotoxicity assay 72 h IC50 = 0.4 μM 17915851
L12 Antiproliferative activity assay 48 h IC50 = 0.006 μM 17973361
NCI-H460 Cytotoxicity assay 48 h IC50 = 0.01 μM 17973361
SKOV3 Cytotoxicity assay 48 h IC50 = 0.01 μM 17973361
SF268 Cytotoxicity assay 48 h IC50 = 0.01 μM 17973361
RKO Cytotoxicity assay 48 h IC50 = 0.01 μM 17973361
KB/HeLa Cytotoxicity assay 48 h IC50 = 0.01 μM 17973361
P388 Antiproliferative activity assay 48 h IC50 = 0.04 μM 17973361
cells assessed as accumulation at G2/M phase after 24 hrs by flow cytometric analysis Cell cycle arrest assay EC50 = 0.049 μM 17973361
L1210 Antiproliferative activity assay 48 h IC50 = 0.06 μM 17973361
cells after 48 hrs by XTT assay Antiproliferative activity assay IC50 = 0.4 μM 17973361
A2780 Cytotoxicity assay IC50 = 0.0063 μM 18001087
BGC823 Cytotoxicity assay IC50 = 0.007 μM 18001087
A549 Cytotoxicity assay IC50 = 0.019 μM 18001087
HCT8 Cytotoxicity assay IC50 = 0.037 μM 18001087
Bel7402 Cytotoxicity assay IC50 = 0.1 μM 18001087
cells by alamar blue assay Function assay IC50 = 0.04 μM 18070965
PANC1 Cytotoxicity assay 72 h IC50 = 0.007 μM 18081257
DLD1 Cytotoxicity assay 72 h IC50 = 0.011 μM 18081257
AsPC1 Cytotoxicity assay 72 h IC50 = 0.02 μM 18081257
NCI/ADR Cytotoxicity assay 72 h IC50 = 1 μM 18081257
SK-BR3 Antiproliferative activity assay 96 h GI50 = 6.1 μM 18164205
A2780 Antiproliferative activity assay 96 h IC50 = 0.0234 μM 18177014
SNU398 Apoptosis assay 24 h EC50 = 0.011 μM 18197614
HCT116 Apoptosis assay 24 h EC50 = 0.024 μM 18197614
T47D Apoptosis assay 24 h EC50 = 0.036 μM 18197614
SJSA1 Cytotoxicity assay 6 h IC50 = 0.0032 μM 18243696
P388 Cytotoxicity assay 72 h IC50 = 0.93 μM 18281952
HL60 Cytotoxicity assay 72 h IC50 = 0.93 μM 18281952
Bel7402 Cytotoxicity assay 24 h IC50 = 0.93 μM 18281952
A549 Cytotoxicity assay 24 h IC50 = 0.93 μM 18281952
KB Cytotoxicity assay 48 h IC50 = 0.0042 μM 18295490
KBV20C Cytotoxicity assay 48 h IC50 = 1.44 μM 18295490
DU145 Cytotoxicity assay 72 h IC50 = 0.005 μM 18308566
HL60 Cytotoxicity assay 72 h IC50 = 0.005 μM 18308566
MDA435 Cytotoxicity assay 72 h IC50 = 0.005 μM 18308566
MESSA Cytotoxicity assay 72 h IC50 = 0.005 μM 18308566
P388 Cytotoxicity assay 72 h IC50 = 0.01 μM 18308566
HL60/TX1000 Cytotoxicity assay 72 h IC50 = 5 μM 18308566
MESSA/DX5 Cytotoxicity assay 72 h IC50 = 5 μM 18308566
K562 Growth inhibition assay 72 h IC50 = 0.0006 μM 18313307
KB3-1 Growth inhibition assay 72 h IC50 = 0.002 μM 18313307
HepG2 Growth inhibition assay 72 h IC50 = 0.007 μM 18313307
KB V1 Growth inhibition assay 72 h IC50 = 8 μM 18313307
A549 Cytotoxicity assay 3 days IC50 = 0.007 μM 18419154
MCF7 Cytotoxicity assay 3 days IC50 = 0.0117 μM 18419154
HepG2 Cytotoxicity assay 3 days IC50 = 0.0468 μM 18419154
MDA-MB-231 Cytotoxicity assay 3 days IC50 = 0.0703 μM 18419154
Hep3B Cytotoxicity assay 3 days IC50 = 0.13 μM 18419154
CCRF-CEM Cytotoxicity assay 72 h IC50 = 0.001274 μM 18450456
HCT116 Cytotoxicity assay 72 h IC50 = 0.0013 μM 18450456
MX1 Cytotoxicity assay 72 h IC50 = 0.035 μM 18450456
HeLa Antiproliferative activity assay 48 h IC50 = 0.0015 μM 18461997
HT29 Antiproliferative activity assay 48 h IC50 = 0.0019 μM 18461997
U2OS Antiproliferative activity assay 48 h IC50 = 0.024 μM 18461997
A2780 Cytotoxicity assay 72 h IC50 = 0.00138 μM 18465846
MCF7 Cytotoxicity assay 72 h IC50 = 0.0017 μM 18465846
LCC6 Cytotoxicity assay 72 h IC50 = 0.0031 μM 18465846
1A9PTX22 Cytotoxicity assay 72 h IC50 = 0.1607 μM 18465846
NCI/ADR Cytotoxicity assay 72 h IC50 = 0.3 μM 18465846
1A9PTX10 Cytotoxicity assay 72 h IC50 = 0.53295 μM 18465846
HT29 Antiproliferative activity assay GI50 = 0.015 μM 18502639
M21 Antiproliferative activity assay GI50 = 0.037 μM 18502639
MCF7 Antiproliferative activity assay GI50 = 0.054 μM 18502639
HepG2 Growth inhibition assay 72 h IC50 = 0.0059 μM 18512984
HepG2/Dox Growth inhibition assay 72 h IC50 = 1.4 μM 18512984
HT29 Growth inhibition assay 48 h GI50 = 0.015 μM 18579387
M21 Growth inhibition assay 48 h GI50 = 0.037 μM 18579387
MCF7 Growth inhibition assay 48 h GI50 = 0.054 μM 18579387
KB403 Cytotoxicity assay 24 h IC50 = 0.001 μM 18586491
WRL68 Cytotoxicity assay 24 h IC50 = 0.004 μM 18586491
MCF7 Cytotoxicity assay 24 h IC50 = 0.006 μM 18586491
CaCO2 Cytotoxicity assay 24 h IC50 = 0.008 μM 18586491
HEPG2 Cytotoxicity assay 24 h IC50 = 0.009 μM 18586491
HCT116 Cytotoxicity assay IC50 = 0.0136 μM 18606540
SF268 Cytotoxicity assay IC50 = 0.0153 μM 18606540
A549 Cytotoxicity assay IC50 = 0.0231 μM 18606540
MDA-MB-231 Cytotoxicity assay IC50 = 0.0405 μM 18606540
SF295 Cytotoxicity assay IC50 = 0.29 μM 18606540
MDA-MB-435 Antiproliferative activity assay 72 h GI50 = 0.004 μM 18610995
HT29 Antiproliferative activity assay 48 h GI50 = 0.015 μM 18617414
M21 Antiproliferative activity assay 48 h GI50 = 0.037 μM 18617414
MCF7 Antiproliferative activity assay 48 h GI50 = 0.054 μM 18617414
SKOV3 Cytotoxicity assay IC50 = 2.43 μM 18701281
KB Cytotoxicity assay IC50 = 2.54 μM 18701281
Eca109 Cytotoxicity assay IC50 = 2.73 μM 18701281
PC3 Cytotoxicity assay IC50 = 2.85 μM 18701281
SMMC7721 Cytotoxicity assay IC50 = 2.86 μM 18701281
MCF7 Cytotoxicity assay IC50 = 2.98 μM 18701281
HeLa Cytotoxicity assay IC50 = 3.11 μM 18701281
HCT8 Cytotoxicity assay IC50 = 3.29 μM 18701281
K562 Cytotoxicity assay IC50 = 3.65 μM 18701281
HepG2 Antiproliferative activity assay 48 h IC50 = 0.62 μM 18701301
PC3 Antiproliferative activity assay 48 h IC50 = 2.73 μM 18701301
HCT116 Antiproliferative activity assay 48 h IC50 = 6.18 μM 18701301
A549 Cytotoxicity assay IC50 = 0.002 μM 18715782
CCRF-CEM Cytotoxicity assay 72 h IC50 = 0.0011 μM 18752869
SKOV3 Anticancer assay 72 h IC50 = 0.00134 μM 18762358
MCF7 Cytotoxicity assay ED50 = 0.0032 μM 18926701
NCI/ADR-RES Cytotoxicity assay ED50 = 1.5 μM 18926701
PANC1 Cytotoxicity assay 72 h IC50 = 0.0099 μM 18951787
DLD1 Cytotoxicity assay 72 h IC50 = 0.022 μM 18951787
AsPC1 Cytotoxicity assay 72 h IC50 = 0.089 μM 18951787
NCI/ADR-RES Cytotoxicity assay 72 h IC50 = 1.3 μM 18951787
MCF7 Cytotoxicity assay ED50 = 0.0021 μM 18977659
NCI/ADR-RES Cytotoxicity assay ED50 = 2 μM 18977659
A431 Cytotoxicity assay 72 h IC50 = 0.0251 μM 18990574
MCF7 Cytotoxicity assay 72 h IC50 = 0.039 μM 18990574
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 0.0471 μM 18990574
SKOV3 Cytotoxicity assay 72 h IC50 = 0.0658 μM 18990574
PANC1 Growth inhibition assay 72 h IC50 = 0.0099 μM 19022679
DLD1 Growth inhibition assay 72 h IC50 = 0.022 μM 19022679
AsPC1 Growth inhibition assay 72 h IC50 = 0.089 μM 19022679
NCI/ADR Growth inhibition assay 72 h IC50 = 1.3 μM 19022679
A2780 Antiproliferative activity assay 2 days IC50 = 0.0234 μM 19028102
KB Antiproliferative activity assay 3 days IC50 = 0.0025 μM 19041247
COLO205 Antiproliferative activity assay 24 h IC50 = 0.0033 μM 19041247
KB 8.5 Antiproliferative activity assay 3 days IC50 = 0.026 μM 19041247
KBV1 Antiproliferative activity assay 3 days IC50 = 2.013 μM 19041247
KB Growth inhibition assay 72 h IC50 = 0.0033 μM 19053773
KB-7D Growth inhibition assay 72 h IC50 = 0.0079 μM 19053773
Pgp170 overexpressing multidrug resistant-KB-TAX50 Growth inhibition assay 72 h IC50 = 0.273 μM 19053773
NPC-TW01 Cytotoxicity assay 72 h IC50 = 0.006 μM 19053781
MES-SA Cytotoxicity assay 72 h IC50 = 0.008 μM 19053781
NCI-H838 Cytotoxicity assay 72 h IC50 = 0.026 μM 19053781
HCT116 Cytotoxicity assay 72 h IC50 = 0.061 μM 19053781
cells after 72 hrs by MTT assay Cytotoxicity assay IC50 = 5.14 μM 19053781
Hep3B Cytotoxicity assay 72 h IC50 = 7.26 μM 19053781
A498 Cytotoxicity assay 72 h IC50 = 8.81 μM 19053781
NB4 Cytotoxicity assay 48 h IC50 = 0.1 μM 19072209
A549 Cytotoxicity assay 48 h IC50 = 0.1 μM 19072209
MCF7 Cytotoxicity assay 48 h IC50 = 0.1 μM 19072209
SH-SY5Y Cytotoxicity assay 48 h IC50 = 0.2 μM 19072209
PC3 Cytotoxicity assay 48 h IC50 = 0.2 μM 19072209
DLD1 Cytotoxicity assay 72 h GI50 = 0.01 μM 19081249
B16 Cytotoxicity assay 72 h GI50 = 0.01 μM 19081249
A172 Cytotoxicity assay 72 h GI50 = 0.01 μM 19081249
HeLa Cytotoxicity assay 72 h GI50 = 0.02 μM 19081249
U87 Cytotoxicity assay 72 h GI50 = 0.02 μM 19081249
SiHa Cytotoxicity assay 72 h GI50 = 0.03 μM 19081249
HeLa Antiproliferative activity assay 96 h IC50 = 0.001 μM 19091579
SKOV3 Antiproliferative activity assay 96 h IC50 = 0.016 μM 19091579
BGC823 Antiproliferative activity assay 96 h IC50 = 0.0189 μM 19091579
HCT116 Cytotoxicity assay 72 h IC50 = 0.0011 μM 19124250
CCRF-CEM Cytotoxicity assay 72 h IC50 = 0.0031 μM 19124250
MX1 Cytotoxicity assay 72 h IC50 = 0.046 μM 19124250
HCT116 Cytotoxicity assay 4 days IC50 = 0.0011 μM 19128156
HT-29 Cytotoxicity assay 4 days IC50 = 0.0036 μM 19128156
A2780 Cytotoxicity assay 48 h IC50 = 0.0013 μM 19128972
KB Growth inhibition assay ED50 = 0.023 μM 19161316
HepG2 Cytotoxicity assay GI50 = 0.001 μM 19195901
WI38 Cytotoxicity assay GI50 = 0.0137 μM 19195901
RKO Antiproliferative activity assay IC50 = 0.02 μM 19220018
KB/HeLa Antiproliferative activity assay IC50 = 0.03 μM 19220018
SKOV3 Antiproliferative activity assay IC50 = 0.05 μM 19220018
SF268 Antiproliferative activity assay IC50 = 0.05 μM 19220018
P388 Antiproliferative activity assay 48 h IC50 = 0.05 μM 19220018
cells ectopic expression of human Antiproliferative activity assay 48 h IC50 = 0.05 μM 19220018
L1210 Antiproliferative activity assay 48 h IC50 = 0.06 μM 19220018
NCI-H460 Antiproliferative activity assay IC50 = 0.07 μM 19220018
Antiproliferative activity assay 48 h IC50 = 0.3 μM 19220018
MCF7 Cytotoxicity assay 72 h IC50 = 0.0012 μM 19239240
A2780 Cytotoxicity assay 72 h IC50 = 0.00138 μM 19239240
wild type A2780 Cytotoxicity assay 72 h IC50 = 0.0017 μM 19239240
cisplatin-resistant A2780 Cytotoxicity assay 72 h IC50 = 0.0022 μM 19239240
LCC-6 Cytotoxicity assay 72 h IC50 = 0.00245 μM 19239240
HT-29 Cytotoxicity assay 72 h IC50 = 0.0036 μM 19239240
H460 Cytotoxicity assay 72 h IC50 = 0.0049 μM 19239240
topotecan-resistant A2780 Cytotoxicity assay 72 h IC50 = 0.0072 μM 19239240
PANC1 Cytotoxicity assay 72 h IC50 = 0.0257 μM 19239240
1A9PTX22 Cytotoxicity assay 72 h IC50 = 0.1607 μM 19239240
NCI/ADR Cytotoxicity assay 72 h IC50 = 0.3 μM 19239240
A2780 Function assay IC50 = 0.386 μM 19239240
1A9PTX10 Cytotoxicity assay 72 h IC50 = 0.53295 μM 19239240
A2780/ADR Cytotoxicity assay 72 h IC50 = 1.239 μM 19239240
A549 Cytotoxicity assay 24 h IC50 = 0.0052 μM 19245261
PC3M Cytotoxicity assay 24 h IC50 = 0.027 μM 19245261
HCT8 Cytotoxicity assay 24 h IC50 = 0.037 μM 19245261
Bel7402 Cytotoxicity assay 24 h IC50 = 0.095 μM 19245261
A2780 Cytotoxicity assay IC50 = 0.014 μM 19282186
SNU398 Apoptosis assay 48 h GI50 = 0.01 μM 19282188
HCT116 Apoptosis assay 48 h EC50 = 0.023 μM 19282188
T47D Apoptosis assay 48 h EC50 = 0.035 μM 19282188
PC3 Cytotoxicity assay 4 days IC50 = 0.0014 μM 19359169
A2780 Cytotoxicity assay 4 days IC50 = 0.0149 μM 19359169
K562 Cytotoxicity assay 48 h IC50 = 1.16 μM 19359185
MCF7 Cytotoxicity assay 48 h IC50 = 2.11 μM 19359185
A549 Cytotoxicity assay 48 h IC50 = 2.46 μM 19359185
SGC Cytotoxicity assay 48 h IC50 = 3.34 μM 19359185
HCT116 Cytotoxicity assay 48 h IC50 = 4.37 μM 19359185
A431 Antiproliferative activity assay GI50 = 0.00001 μM 19394218
MESSA Antiproliferative activity assay GI50 = 0.00001 μM 19394218
HCT15 Antiproliferative activity assay GI50 = 0.011 μM 19394218
MES-SA/Dx5 Antiproliferative activity assay GI50 = 0.16 μM 19394218
HCT15/CLO2 Antiproliferative activity assay GI50 = 0.83 μM 19394218
wild type A2780 Growth inhibition assay 72 h IC50 = 0.0017 μM 19423340
cisplatin-resistant A2780 Growth inhibition assay 72 h IC50 = 0.0022 μM 19423340
topotecan-resistant A2780 Growth inhibition assay 72 h IC50 = 0.0072 μM 19423340
adriamycin and doxorubicin-resistant A2780 Growth inhibition assay 72 h IC50 = 1.239 μM 19423340
paclitaxel-resistant A2780TC1 Function assay IC50 = 5.898 μM 19423340
NB4 Cytotoxicity assay 48 h IC50 = 0.1 μM 19425589
A549 Cytotoxicity assay 48 h IC50 = 0.1 μM 19425589
MCF7 Cytotoxicity assay 48 h IC50 = 0.1 μM 19425589
SH-SY5Y Cytotoxicity assay 48 h IC50 = 0.2 μM 19425589
PC3 Cytotoxicity assay 48 h IC50 = 0.2 μM 19425589
SNU398 Apoptosis assay 48 h EC50 = 0.009 μM 19467598
HCT116 Apoptosis assay 48 h EC50 = 0.018 μM 19467598
T47D Growth inhibition assay 48 h GI50 = 0.026 μM 19467598
MCF7 Cytotoxicity assay 48 h IC50 = 0.08 μM 19467877
HepG2 Cytotoxicity assay GI50 = 0.059 μM 19476336
H1299 Growth inhibition assay 48 h GI50 = 0.023 μM 19500976
T47D Growth inhibition assay 48 h GI50 = 0.026 μM 19500976
DLD1 Apoptosis assay 48 h EC50 = 0.054 μM 19500976
HCT116 Cytotoxicity assay 72 h IC50 = 0.0011 μM 19576785
CCRF-CEM Cytotoxicity assay 72 h IC50 = 0.0012 μM 19576785
MX1 Cytotoxicity assay 72 h IC50 = 0.046 μM 19576785
vinblastine-resistant CCRF-CEM Cytotoxicity assay 72 h IC50 = 0.4 μM 19576785
taxol-resistant CCRF-CEM Cytotoxicity assay 72 h IC50 = 1.2 μM 19576785
MCF7 Growth inhibition assay 48 h IC50 = 0.003 μM 19601594
PtK2 Growth inhibition assay IC50 = 0.021 μM 19601594
rat A10 Growth inhibition assay IC50 = 0.038 μM 19601594
HCT116 Antiproliferative activity assay 72 h IC50 = 0.0008 μM 19665384
PC3 Antiproliferative activity assay 72 h IC50 = 0.0008 μM 19665384
NCI/ADR Antiproliferative activity assay 72 h IC50 = 0.004 μM 19665384
HuH7 Antiproliferative activity assay 72 h IC50 = 0.008 μM 19665384
Caco-2 Antiproliferative activity assay 72 h IC50 = 0.02 μM 19665384
MES-SA/Dx5 Cytotoxicity assay IC50 = 7.538 μM 19679475
A549 Cytotoxicity assay IC50 = 0.0023 μM 19708679
BGC823 Cytotoxicity assay IC50 = 0.0033 μM 19708679
HCT8 Cytotoxicity assay IC50 = 0.0036 μM 19708679
A2780 Cytotoxicity assay IC50 = 0.0079 μM 19708679
Bel7404 Cytotoxicity assay IC50 = 0.0123 μM 19708679
DG75 Antiproliferative activity assay 24 to 72 h IC50 = 0.01 μM 19717215
MUTU-I Antiproliferative activity assay 24 h IC50 = 0.01 μM 19717215
HCT116 Antiproliferative activity assay 72 h IC50 = 0.001 μM 19743863
SW48 Antiproliferative activity assay 72 h IC50 = 0.001 μM 19743863
MES-SA Antiproliferative activity assay 72 h IC50 = 0.001 μM 19743863
CEM Antiproliferative activity assay 72 h IC50 = 0.002 μM 19743863
SW480 Antiproliferative activity assay 72 h IC50 = 0.002 μM 19743863
MCF7 Cytotoxicity assay 72 h IC50 = 0.003 μM 19743863
RL Antiproliferative activity assay 72 h IC50 = 0.003 μM 19743863
T47D Antiproliferative activity assay 72 h IC50 = 0.004 μM 19743863
UACC-812 Antiproliferative activity assay 72 h IC50 = 0.7 μM 19743863
DU145 Cytotoxicity assay 72 h IC50 = 4.84 μM 19754130
LNCAP Cytotoxicity assay 72 h IC50 = 6.32 μM 19754130
HT-29 Cytotoxicity assay 1 h IC50 = 0.0034 μM 19778067
HCT116 Cytotoxicity assay 1 h IC50 = 0.0035 μM 19778067
K562 Antiproliferative activity assay 48 h IC50 = 1.16 μM 19815316
A549 Antiproliferative activity assay 48 h IC50 = 2.28 μM 19815316
SGC7901 Antiproliferative activity assay 48 h IC50 = 3.34 μM 19815316
HCT116 Antiproliferative activity assay 48 h IC50 = 4.37 μM 19815316
IGROV1 Antiproliferative activity assay 72 h IC50 = 0.06 μM 19833515
MCF7 Cytotoxicity assay 72 h IC50 = 0.002 μM 19860383
A2780 Cytotoxicity assay IC50 = 0.0028 μM 19877653
A2780AD Cytotoxicity assay IC50 = 0.415 μM 19877653
KB Cytotoxicity assay 48 h IC50 = 0.02 μM 19879765
BT549 Cytotoxicity assay 48 h IC50 = 0.02 μM 19879765
SKOV3 Cytotoxicity assay 48 h IC50 = 0.53 μM 19879765
african green monkey Vero Toxicity assay 48 h TC50 = 0.53 μM 19879765
SK-MEL Cytotoxicity assay 48 h IC50 = 4.1 μM 19879765
pig LLC-PK11 Toxicity assay 48 h TC50 = 4.39 μM 19879765
OVCAR-3 Growth inhibition assay 48 h IC50 = 2.7 μM 19939522
A549 Growth inhibition assay 48 h IC50 = 2.7 μM 19939522
SNU398 Apoptosis assay 48 h EC50 = 0.009 μM 20034792
HCT116 Apoptosis assay 48 h EC50 = 0.018 μM 20034792
T47D Growth inhibition assay 48 h GI50 = 0.026 μM 20034792
KBVIN Cytotoxicity assay IC50 = 0.00109 μM 20036537
KB Cytotoxicity assay IC50 = 0.00155 μM 20036537
A549 Cytotoxicity assay IC50 = 0.00193 μM 20036537
DU145 Cytotoxicity assay IC50 = 0.00235 μM 20036537
HCT116 Cytotoxicity assay 72 h IC50 = 0.002399 μM 20116905
KB Cytotoxicity assay IC50 = 0.08 μM 20122764
786-0 Cytotoxicity assay IC50 = 0.08 μM 20122764
A375 Cytotoxicity assay IC50 = 0.81 μM 20122764
BGC Cytotoxicity assay IC50 = 1.5 μM 20122764
769-P Cytotoxicity assay IC50 = 7.1 μM 20122764
MCF7 Antiproliferative activity assay 20 h IC50 = 0.021 μM 20149494
HeLa Cytotoxicity assay 48 h IC50 = 0.03 μM 20180542
HCT116 Cytotoxicity assay 72 h IC50 = 0.0013 μM 20181487
CCRF-CEM Cytotoxicity assay 72 h IC50 = 0.0031 μM 20181487
MX1 Cytotoxicity assay 72 h IC50 = 0.035 μM 20181487
KB3-1 Cytotoxicity assay 72 h IC50 = 0.0012 μM 20302303
HT-29 Cytotoxicity assay 3 days ED50 = 0.0001 μM 20384315
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 20521771
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 20521771
PANC1 Growth inhibition assay 48 h IC50 = 0.008 μM 20521771
SK-BR-3 Cytotoxicity assay 48 h IC50 = 0.11 μM 20521771
A549 Cytotoxicity assay 48 h IC50 = 1.4 μM 20521771
LT12 Antiproliferative activity assay 48 h IC50 = 0.006 μM 20537765
SKOV3 Antiproliferative activity assay 48 h IC50 = 0.01 μM 20537765
SF268 Antiproliferative activity assay 48 h IC50 = 0.01 μM 20537765
NCI-H460 Antiproliferative activity assay 48 h IC50 = 0.01 μM 20537765
RKO Antiproliferative activity assay 48 h IC50 = 0.01 μM 20537765
KB/HeLa Antiproliferative activity assay 48 h IC50 = 0.01 μM 20537765
P388 Antiproliferative activity assay 48 h IC50 = 0.04 μM 20537765
L1210 Antiproliferative activity assay 48 h IC50 = 0.06 μM 20537765
DLD1 Cytotoxicity assay 72 h GI50 = 0.01 μM 20538462
B16 Cytotoxicity assay 72 h GI50 = 0.01 μM 20538462
A172 Cytotoxicity assay 72 h GI50 = 0.01 μM 20538462
HeLa Cytotoxicity assay 72 h GI50 = 0.02 μM 20538462
U87 Cytotoxicity assay 72 h GI50 = 0.02 μM 20538462
SiHa Cytotoxicity assay 72 h GI50 = 0.03 μM 20538462
HT-29 Cytotoxicity assay IC50 = 0.0014 μM 20553003
HCT116 Cytotoxicity assay IC50 = 0.00321 μM 20553003
A549 Cytotoxicity assay 96 h IC50 = 0.001 μM 20560647
BGC823 Cytotoxicity assay 96 h IC50 = 0.04 μM 20560647
A2780 Cytotoxicity assay 96 h IC50 = 0.9 μM 20560647
HCT8 Cytotoxicity assay 96 h IC50 = 3.6 μM 20560647
Bel7402 Cytotoxicity assay 96 h IC50 = 6.3 μM 20560647
A2780 Cytotoxicity assay 3 days IC50 = 0.65 μM 20593839
HCT8 Cytotoxicity assay 3 days IC50 = 0.67 μM 20593839
Bel7402 Cytotoxicity assay 3 days IC50 = 1.8 μM 20593839
KB Cytotoxicity assay IC50 = 0.08 μM 20627721
786-0 Cytotoxicity assay IC50 = 0.08 μM 20627721
HepG2 Cytotoxicity assay IC50 = 0.08 μM 20627721
OS-RC2 Cytotoxicity assay IC50 = 0.08 μM 20627721
22Rv1 Cytotoxicity assay IC50 = 0.08 μM 20627721
HT-29 Cytotoxicity assay IC50 = 0.38 μM 20627721
A375 Cytotoxicity assay IC50 = 0.81 μM 20627721
MCF7 Cytotoxicity assay IC50 = 1.3 μM 20627721
BCG823 Cytotoxicity assay IC50 = 1.5 μM 20627721
769-P Cytotoxicity assay IC50 = 7.1 μM 20627721
KB Cytotoxicity assay IC50 = 0.08 μM 20716468
786-0 Cytotoxicity assay IC50 = 0.08 μM 20716468
OS-RC2 Cytotoxicity assay IC50 = 0.08 μM 20716468
22Rv1 Cytotoxicity assay IC50 = 0.08 μM 20716468
HepG2 Cytotoxicity assay IC50 = 0.08 μM 20716468
HT-29 Cytotoxicity assay IC50 = 0.38 μM 20716468
A375 Cytotoxicity assay IC50 = 0.81 μM 20716468
MCF7 Cytotoxicity assay IC50 = 1.3 μM 20716468
BGC823 Cytotoxicity assay IC50 = 1.5 μM 20716468
769-P Cytotoxicity assay IC50 = 7.1 μM 20716468
BGC823 Cytotoxicity assay 72 h IC50 = 0.001 μM 20719510
A2780 Cytotoxicity assay 72 h IC50 = 0.001 μM 20719510
A549 Cytotoxicity assay 72 h IC50 = 0.016 μM 20719510
HCT8 Cytotoxicity assay 72 h IC50 = 0.051 μM 20719510
Bel7402 Cytotoxicity assay 72 h IC50 = 0.06 μM 20719510
A549 Cytotoxicity assay 72 h IC50 = 0.0038 μM 20732809
HEK Cytotoxicity assay 72 h IC50 = 0.0039 μM 20732809
MCF7 Cytotoxicity assay 72 h IC50 = 0.0044 μM 20732809
HeLa Cytotoxicity assay 72 h IC50 = 0.0089 μM 20732809
Hep3B Anticancer assay 3 days GI50 = 0.0004 μM 20735140
DU145 Cytotoxicity assay ED50 = 0.003 μM 20738103
KB Cytotoxicity assay ED50 = 0.007 μM 20738103
A549 Cytotoxicity assay ED50 = 0.008 μM 20738103
MCF7 Cytotoxicity assay 72 h IC50 = 0.002 μM 20800500
wild type LCC-6 Cytotoxicity assay 72 h IC50 = 0.003 μM 20800500
A2780 Cytotoxicity assay 72 h IC50 = 0.02 μM 20800500
CFPAC-1 Cytotoxicity assay 72 h IC50 = 0.047 μM 20800500
multidrug-resistant LCC-6 Cytotoxicity assay 72 h IC50 = 0.379 μM 20800500
NCI/ADR Cytotoxicity assay 72 h IC50 = 0.41 μM 20800500
multidrug-resistant MDA-MB-435/LCCMDR1 Cytotoxicity assay 48 h IC50 = 0.004 μM 20919720
multidrug-resistant MDA-MB-435/LCCMDR1 Function assay IC50 = 0.0693 μM 20919720
MDA-MB-435 Cytotoxicity assay 48 h IC50 = 0.277 μM 20919720
LNCAP Cytotoxicity assay IC50 = 0.0223 μM 20936874
HT-29 Cytotoxicity assay 3 days ED50 = 0.0006 μM 20939540
HCT116 Growth inhibition assay 96 h IC50 = 0.002 μM 20943401
HCT15 Growth inhibition assay 96 h IC50 = 0.14 μM 20943401
HeLa Antiproliferative activity assay IC50 = 0.0016 μM 20973488
SKOV3 Antiproliferative activity assay IC50 = 0.003 μM 20973488
A549 Antiproliferative activity assay 96 h IC50 = 0.0049 μM 20974505
MCF7 Antiproliferative activity assay 96 h IC50 = 0.021 μM 20974505
HT-29 Anticancer assay ED50 = 0.0001 μM 21067206
K562 Cytotoxicity assay 48 h IC50 = 1.16 μM 21067933
MCF7 Cytotoxicity assay 48 h IC50 = 2.11 μM 21067933
A549 Cytotoxicity assay 48 h IC50 = 2.46 μM 21067933
SGC Cytotoxicity assay 48 h IC50 = 3.34 μM 21067933
HCT116 Cytotoxicity assay 48 h IC50 = 4.37 μM 21067933
CCRF-CEM Cytotoxicity assay 72 h IC50 = 0.003 μM 21106377
MCF7 Cytotoxicity assay 72 h GI50 = 0.003 μM 21115210
HT-29 Cytotoxicity assay 72 h GI50 = 0.003 μM 21115210
K562 Cytotoxicity assay 72 h GI50 = 0.004 μM 21115210
PC3 Cytotoxicity assay 72 h GI50 = 0.004 μM 21115210
MCF7 Cytotoxicity assay 24 h IC50 = 0.63 μM 21115212
SMMC7721 Cytotoxicity assay 24 h IC50 = 1.42 μM 21115212
A2780 Cytotoxicity assay 48 to 72 h IC50 = 0.01 μM 21126027
Jurkat Cell cycle arrest assay 24 h IC50 = 0.01 μM 21126027
HeLa Cytotoxicity assay 48 to 72 h IC50 = 0.02 μM 21126027
SW620 Cytotoxicity assay 48 to 72 h IC50 = 0.03 μM 21126027
HCT116 Cytotoxicity assay 72 h IC50 = 0.0013 μM 21144756
CCRF-CEM Cytotoxicity assay 72 h IC50 = 0.003 μM 21144756
MX1 Cytotoxicity assay 72 h IC50 = 0.035 μM 21144756
chemoresistant DG75 Cytotoxicity assay 72 h IC50 = 0.01 μM 21227702
chemosensitive MUTU-I Cytotoxicity assay 24 h IC50 = 0.01 μM 21227702
HT1080 Antiproliferative activity assay 96 h IC50 = 0.0012 μM 21296467
A549 Antiproliferative activity assay 96 h IC50 = 0.0044 μM 21296467
A375 Antiproliferative activity assay 96 h IC50 = 0.0046 μM 21296467
NCI-N87 Antiproliferative activity assay 96 h IC50 = 0.0059 μM 21296467
MCF7 Antiproliferative activity assay 96 h IC50 = 0.0205 μM 21296467
HeLa Antiproliferative activity assay 96 h IC50 = 0.1 μM 21296467
PANC1 Antiproliferative activity assay 96 h IC50 = 0.3841 μM 21296467
Bel7402 Antiproliferative activity assay 96 h IC50 = 0.5782 μM 21296467
1A9 Antiproliferative activity assay 3 days ED50 = 0.00209 μM 21296579
A549 Antiproliferative activity assay 3 days ED50 = 0.00256 μM 21296579
KB Antiproliferative activity assay 3 days ED50 = 0.00287 μM 21296579
PC3 Antiproliferative activity assay 3 days ED50 = 0.00887 μM 21296579
KB Cytotoxicity assay 72 h GI50 = 0.00487 μM 21316977
DU145 Cytotoxicity assay 72 h GI50 = 0.00555 μM 21316977
A549 Cytotoxicity assay 72 h GI50 = 0.00558 μM 21316977
MES-SA Antiproliferative activity assay IC50 = 0.00296 μM 21324686
MES-SA Antiproliferative activity assay IC50 = 0.00296 μM 21324687
SF295 Antiproliferative activity assay IC50 = 0.02455 μM 21324687
MES-SA Cytotoxicity assay IC50 = 0.00296 μM 21324692
MCF7 Cytotoxicity assay 48 h IC50 = 0.006 μM 21341718
HT-29 Cytotoxicity assay 48 h IC50 = 0.007 μM 21341718
K562 Cytotoxicity assay 48 h IC50 = 1.16 μM 21342735
MCF7 Cytotoxicity assay 48 h IC50 = 2.11 μM 21342735
A549 Cytotoxicity assay 48 h IC50 = 2.46 μM 21342735
SGC Cytotoxicity assay 48 h IC50 = 3.34 μM 21342735
HCT116 Cytotoxicity assay 48 h IC50 = 4.37 μM 21342735
multidrug-resistant K562 Cytotoxicity assay 48 h IC50 = 5.63 μM 21342735
CCRF-CEM Cytotoxicity assay 72 h IC50 = 0.003 μM 21356592
taxol-resistant CCRF-CEM Cytotoxicity assay 72 h IC50 = 0.43 μM 21356592
vinblastine-resistant CCRF-CEM Cytotoxicity assay 72 h IC50 = 1.27 μM 21356592
KB Cytotoxicity assay 3 days GI50 = 0.00516 μM 21377368
DU145 Cytotoxicity assay 3 days GI50 = 0.00523 μM 21377368
A549 Cytotoxicity assay 3 days GI50 = 0.0076 μM 21377368
A2780 Cytotoxicity assay 24 h IC50 = 0.00082 μM 21396747
A2780AD Cytotoxicity assay 24 h IC50 = 0.949 μM 21396747
HT-29 Cytotoxicity assay 3 days ED50 = 0.0001 μM 21428375
MCF7 Antiproliferative activity assay 72 h IC50 = 0.002 μM 21440449
HeLa Cytotoxicity assay 48 h IC50 = 0.0026 μM 21446699
HT-29 Cytotoxicity assay 48 h IC50 = 0.003 μM 21446699
KB Cell cycle arrest assay EC50 = 0.002 μM 21480626
A549 Antiproliferative activity assay 72 h IC50 = 0.0023 μM 21480626
HT-29 Antiproliferative activity assay 72 h IC50 = 0.0061 μM 21480626
A431 Antiproliferative activity assay 72 h IC50 = 0.0092 μM 21480626
SKOV3 Antiproliferative activity assay 72 h IC50 = 0.0145 μM 21480626
NCI-H460 Antiproliferative activity assay 72 h IC50 = 0.0146 μM 21480626
MCF7 Cytotoxicity assay 48 h GI50 = 0.012 μM 21513294
HT-29 Cytotoxicity assay 48 h GI50 = 0.012 μM 21513294
SF268 Cytotoxicity assay 48 h GI50 = 0.012 μM 21513294
H460 Cytotoxicity assay 48 h GI50 = 0.024 μM 21513294
CHOK1 Cytotoxicity assay 48 h GI50 = 5.9 μM 21513294
HeLa Cytotoxicity assay 24 h IC50 = 6.62 μM 21514015
HELF Cytotoxicity assay 24 h IC50 = 7.17 μM 21514015
SH-SY5Y Cytotoxicity assay 24 h IC50 = 8.56 μM 21514015
BGC823 Cytotoxicity assay 24 h IC50 = 9.24 μM 21514015
A2780 Cytotoxicity assay 72 h IC50 = 0.001 μM 21530251
BGC823 Cytotoxicity assay 72 h IC50 = 0.001 μM 21530251
Bel7402 Cytotoxicity assay 72 h IC50 = 0.006 μM 21530251
A549 Cytotoxicity assay 72 h IC50 = 0.016 μM 21530251
HCT8 Cytotoxicity assay 72 h IC50 = 0.051 μM 21530251
SW480 Cytotoxicity assay 48 h IC50 = 0.008 μM 21534539
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 21534539
A549 Cytotoxicity assay 48 h IC50 = 0.008 μM 21534539
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 21534539
HL60 Cytotoxicity assay 48 h IC50 = 0.01 μM 21534539
OVCAR8 Anticancer assay 96 h IC50 = 0.0047 μM 21557538
NCI/ADR-RES Anticancer assay 96 h IC50 = 6.263 μM 21557538
NCI-H460 Antiproliferative activity assay 48 h IC50 = 0.004 μM 21563750
COLO205 Antiproliferative activity assay 48 h IC50 = 0.005 μM 21563750
SKOV3 Antiproliferative activity assay 48 h IC50 = 0.006 μM 21563750
BT549 Antiproliferative activity assay 48 h IC50 = 0.006 μM 21563750
451LU Antiproliferative activity assay 48 h IC50 = 0.006 μM 21563750
SW480 Antiproliferative activity assay 48 h IC50 = 0.011 μM 21563750
DLD1 Antiproliferative activity assay 48 h IC50 = 0.05 μM 21563750
HT1080 Antiproliferative activity assay 48 h IC50 = 0.00015 μM 21604746
CEM Antiproliferative activity assay 48 h IC50 = 0.00027 μM 21604746
L1210 Antiproliferative activity assay 48 h IC50 = 0.0004 μM 21604746
K562 Antiproliferative activity assay 48 h IC50 = 0.00071 μM 21604746
DU145 Antiproliferative activity assay 48 h IC50 = 0.0013 μM 21604746
SKOV3 Antiproliferative activity assay 48 h IC50 = 0.0026 μM 21604746
MDA-MB-231 Antiproliferative activity assay 48 h IC50 = 0.0091 μM 21604746
B16F0 Antiproliferative activity assay 48 h IC50 = 0.028 μM 21604746
P388D1 Antiproliferative activity assay 48 h IC50 = 0.035 μM 21604746
CHO-VV 3-2 Antiproliferative activity assay 48 h IC50 = 0.14 μM 21604746
CHO Antiproliferative activity assay 48 h IC50 = 0.17 μM 21604746
CHO-TAX 5-6 Antiproliferative activity assay 48 h IC50 = 0.52 μM 21604746
CEM/VLB Antiproliferative activity assay 48 h IC50 = 3.34 μM 21604746
A549 Antiproliferative activity assay 72 h IC50 = 0.0072 μM 21663319
taxol-resistant A549-T12 Antiproliferative activity assay 72 h IC50 = 0.0752 μM 21663319
MCF7 Cytotoxicity assay 48 h IC50 = 0.0025 μM 21680190
MCF7/VP Cytotoxicity assay 48 h IC50 = 0.0028 μM 21680190
NCI/ADR Cytotoxicity assay 48 h IC50 = 2.7 μM 21680190
LT12 Antiproliferative activity assay 48 h IC50 = 0.006 μM 21705223
NCI-H460 Cytotoxicity assay 48 h IC50 = 0.01 μM 21705223
SF268 Cytotoxicity assay 48 h IC50 = 0.01 μM 21705223
KB/HeLa Cytotoxicity assay 48 h IC50 = 0.01 μM 21705223
SKOV3 Cytotoxicity assay 48 h IC50 = 0.01 μM 21705223
RKOp27 Cytotoxicity assay 48 h IC50 = 0.01 μM 21705223
P388 Antiproliferative activity assay 48 h IC50 = 0.04 μM 21705223
L1210 Antiproliferative activity assay 48 h IC50 = 0.06 μM 21705223
NCI-H460 Anticancer assay 72 h IC30 = 3.6 μM 21707046
A2780 Cytotoxicity assay 48 h IC50 = 0.00062 μM 21764308
A2780AD Cytotoxicity assay 48 h IC50 = 1.9 μM 21764308
786-0 Antiproliferative activity assay IC50 = 0.004 μM 21774499
PC3 Antiproliferative activity assay IC50 = 0.00043 μM 21775150
DU145 Antiproliferative activity assay IC50 = 0.0023 μM 21775150
MDA-MB-435 Antiproliferative activity assay IC50 = 0.016 μM 21775150
MCF7 Cytotoxicity assay 48 h IC50 = 0.00162 μM 21779519
COLO205 Cytotoxicity assay 48 h IC50 = 0.00331 μM 21779519
KB Cytotoxicity assay IC50 = 6.684 μM 21784631
DU145 Cytotoxicity assay IC50 = 8.626 μM 21784631
A549 Cytotoxicity assay IC50 = 9.265 μM 21784631
HeLa Antiproliferative activity assay IC50 = 0.00138 μM 21786793
SKOV3 Antiproliferative activity assay IC50 = 0.00295 μM 21786793
HeLa Antiproliferative activity assay 48 h IC50 = 0.0012 μM 21800839
A2780 Cytotoxicity assay 2 days IC50 = 0.014 μM 21802957
Hep3B2 Cytotoxicity assay 72 h IC50 = 0.000016 μM 21812410
PANC1 Cytotoxicity assay 72 h IC50 = 0.0011 μM 21812410
CNE1-LMP1 Cytotoxicity assay 72 h IC50 = 0.0042 μM 21812410
MGC Cytotoxicity assay 72 h IC50 = 0.0064 μM 21812410
A375 Cytotoxicity assay 72 h IC50 = 0.0089 μM 21812410
MCF7 Cytotoxicity assay 72 h IC50 = 0.014 μM 21812410
HaCaT Cytotoxicity assay 72 h IC50 = 0.024 μM 21812410
A549 Cytotoxicity assay 72 h IC50 = 0.03 μM 21812410
EC109 Cytotoxicity assay 72 h IC50 = 0.14 μM 21812410
MES-SA Cytotoxicity assay 96 h IC50 = 0.004 μM 21812421
MES-SA/Dx5 Cytotoxicity assay 96 h IC50 = 0.75 μM 21812421
HT-29 Cytotoxicity assay GI50 = 0.002 μM 21839640
RPMI8226 Cytotoxicity assay GI50 = 0.002 μM 21839640
HCC2998 Cytotoxicity assay GI50 = 0.003 μM 21839640
Hs578T Cytotoxicity assay GI50 = 0.003 μM 21839640
COLO205 Cytotoxicity assay GI50 = 0.003 μM 21839640
PC3 Cytotoxicity assay GI50 = 0.004 μM 21839640
A549 Cytotoxicity assay GI50 = 0.004 μM 21839640
SNB75 Cytotoxicity assay GI50 = 0.004 μM 21839640
KM12 Cytotoxicity assay GI50 = 0.004 μM 21839640
DU145 Cytotoxicity assay GI50 = 0.005 μM 21839640
SKOV3 Cytotoxicity assay GI50 = 0.008 μM 21839640
NCI-H322M Cytotoxicity assay GI50 = 0.013 μM 21839640
UACC257 Cytotoxicity assay GI50 = 0.04 μM 21839640
HCT15 Cytotoxicity assay GI50 = 0.158 μM 21839640
ACHN Cytotoxicity assay GI50 = 0.398 μM 21839640
HL60 Cytotoxicity assay 72 h IC50 = 0.0034 μM 21848268
MCF7 Antiproliferative activity assay 96 h IC50 = 0.00091 μM 21870795
A549 Antiproliferative activity assay 72 h IC50 = 0.00314 μM 21870795
A549 Cytotoxicity assay 24 h EC50 = 0.0046 μM 21873068
KB Cytotoxicity assay IC50 = 0.08 μM 21875764
786-0 Cytotoxicity assay IC50 = 0.08 μM 21875764
OS-RC2 Cytotoxicity assay IC50 = 0.08 μM 21875764
22Rv1 Cytotoxicity assay IC50 = 0.08 μM 21875764
HepG2 Cytotoxicity assay IC50 = 0.08 μM 21875764
HT-29 Cytotoxicity assay IC50 = 0.38 μM 21875764
A375 Cytotoxicity assay IC50 = 0.81 μM 21875764
MCF7 Cytotoxicity assay IC50 = 1.3 μM 21875764
BGC823 Cytotoxicity assay IC50 = 1.5 μM 21875764
769-P Cytotoxicity assay IC50 = 7.1 μM 21875764
MCF7 Cytotoxicity assay 3 days GI50 = 1.07 μM 21889341
PC3 Cytotoxicity assay 3 days GI50 = 1.46 μM 21889341
SK-N-SH Cytotoxicity assay 3 days GI50 = 2.19 μM 21889341
HeLa Cytotoxicity assay 3 days GI50 = 2.82 μM 21889341
CHO-VV 3-2 Antiproliferative activity assay 48 h IC50 = 0.14 μM 21920638
CHO-TAX 5-6 Antiproliferative activity assay 48 h IC50 = 0.52 μM 21920638
multidrug-resistant CEM/VLB Antiproliferative activity assay 48 h IC50 = 3.34 μM 21920638
BGC823 Cytotoxicity assay IC50 = 0.00329 μM 21928797
HT-29 Cytotoxicity assay IC50 = 0.00394 μM 21928797
HepG2 Cytotoxicity assay IC50 = 0.0044 μM 21928797
A375 Cytotoxicity assay IC50 = 0.0049 μM 21928797
A549 Cytotoxicity assay IC50 = 0.0449 μM 21928797
NCI-H460 Cytotoxicity assay IC50 = 8 μM 21942765
A549 Cytotoxicity assay 48 h IC50 = 0.01 μM 21973054
HeLa Cytotoxicity assay 48 h IC50 = 0.6 μM 21973054
HT-29 Cytotoxicity assay 3 days ED50 = 0.006 μM 21973101
HBL100 Growth inhibition assay GI50 = 0.000017 μM 21986585
HeLa Growth inhibition assay GI50 = 0.000033 μM 21986585
T47D Growth inhibition assay GI50 = 0.00015 μM 21986585
WiDr Growth inhibition assay GI50 = 0.00022 μM 21986585
A2780 Growth inhibition assay GI50 = 0.00027 μM 21986585
SW1573 Growth inhibition assay GI50 = 0.005 μM 21986585
A2780 Antiproliferative activity assay IC50 = 0.017 μM 21995542
A549 Antiproliferative activity assay 72 h IC50 = 0.0072 μM 22027100
taxol-resistant A549-T12 Antiproliferative activity assay 72 h IC50 = 0.075 μM 22027100
OVCAR8 Growth inhibition assay 96 h IC50 = 0.002 μM 22044164
NCI-ADR-RES Growth inhibition assay 96 h IC50 = 1.5 μM 22044164
KB Growth inhibition assay 72 h IC50 = 0.0033 μM 22060033
KB-7d Growth inhibition assay 72 h IC50 = 0.0079 μM 22060033
KB-S15 Growth inhibition assay 72 h IC50 = 0.273 μM 22060033
A2780 Antiproliferative activity assay 2 days IC50 = 0.015 μM 22071526
KB Cytotoxicity assay 48 h IC50 = 0.0045 μM 22074257
L1210 Cytotoxicity assay 48 h IC50 = 0.12 μM 22074257
A2780 Antiproliferative activity assay 2 days IC50 = 0.02 μM 22136523
DU145 Cytotoxicity assay EC50 = 0.0059 μM 22142543
KB Cytotoxicity assay EC50 = 0.006 μM 22142543
A549 Cytotoxicity assay EC50 = 0.0064 μM 22142543
QGY7701 Cytotoxicity assay 72 h IC50 = 0.04 μM 22153338
HepG2 Cytotoxicity assay 72 h IC50 = 0.05 μM 22153338
Bel7404 Cytotoxicity assay 72 h IC50 = 0.82 μM 22153338
SMMC7721 Cytotoxicity assay 72 h IC50 = 0.88 μM 22153338
Bel7402 Cytotoxicity assay 72 h IC50 = 1.25 μM 22153338
MCF7 Cytotoxicity assay 24 to 48 h IC50 = 0.003 μM 22222040
SH-SY5Y Cytotoxicity assay 24 to 48 h IC50 = 0.004 μM 22222040
HepG2 Cytotoxicity assay 24 to 48 h IC50 = 0.007 μM 22222040
H460 Cytotoxicity assay 24 to 48 h IC50 = 0.008 μM 22222040
HT-29 Cytotoxicity assay 3 days IC50 = 0.006 μM 22239601
DU145 Antiproliferative activity assay 72 h GI50 = 0.00386 μM 22265685
KB Antiproliferative activity assay 72 h GI50 = 0.00412 μM 22265685
A549 Antiproliferative activity assay 72 h GI50 = 0.00546 μM 22265685
MCF7 Cytotoxicity assay 96 h IC50 = 0.1 μM 22360613
A549 Cytotoxicity assay 72 h IC50 = 0.19 μM 22472043
MCF7 Cytotoxicity assay 48 h IC50 = 0.006 μM 22472045
K562 Cytotoxicity assay 72 h IC50 = 0.41 μM 22483090
CaEs17 Cytotoxicity assay 72 h IC50 = 0.43 μM 22483090
MGC803 Cytotoxicity assay 72 h IC50 = 0.85 μM 22483090
HeLa Cytotoxicity assay 72 h IC50 = 0.89 μM 22483090
Bel7402 Cytotoxicity assay 72 h IC50 = 1.89 μM 22483090
A549 Cytotoxicity assay 72 h IC50 = 3.46 μM 22483090
MCF7 Cytotoxicity assay 72 h IC50 = 4.77 μM 22483090
SKOV3 Cytotoxicity assay IC50 = 0.0001 μM 22506620
BGC823 Cytotoxicity assay IC50 = 0.0033 μM 22506620
HepG2 Cytotoxicity assay IC50 = 0.0044 μM 22506620
A549 Cytotoxicity assay IC50 = 0.016 μM 22506620
HCT8 Cytotoxicity assay IC50 = 0.051 μM 22506620
CCRF-CEM Cytotoxicity assay 72 h IC50 = 0.0012 μM 22507893
taxol-resistant CCRF-CEM Cytotoxicity assay 72 h IC50 = 0.43 μM 22507893
vinblastine-resistant CCRF-CEM Cytotoxicity assay 72 h IC50 = 1.27 μM 22507893
BGC823 Cytotoxicity assay 72 h IC50 = 0.001 μM 22583079
A2780 Cytotoxicity assay 72 h IC50 = 0.001 μM 22583079
Bel7402 Cytotoxicity assay 72 h IC50 = 0.006 μM 22583079
A549 Cytotoxicity assay 72 h IC50 = 0.016 μM 22583079
HCT8 Cytotoxicity assay 72 h IC50 = 0.051 μM 22583079
MES-SA Cytotoxicity assay 96 h IC50 = 0.004 μM 22587519
MESSA/DX5 Cytotoxicity assay 96 h IC50 = 0.75 μM 22587519
HCT116 Cytotoxicity assay IC50 = 0.05 μM 22691179
SKBR3 Cytotoxicity assay IC50 = 0.11 μM 22691179
SK-MEL-5 Cytotoxicity assay IC50 = 0.15 μM 22691179
SKOV3 Cytotoxicity assay IC50 = 0.4 μM 22691179
MCF7 Cytotoxicity assay IC50 = 0.9 μM 22691179
PC3 Antiproliferative activity assay 48 h IC50 = 0.0004 μM 22783954
paclitaxel-resistant PC3-TxR Antiproliferative activity assay 48 h IC50 = 0.188 μM 22783954
MCF7 Cytotoxicity assay 24 h IC50 = 0.015 μM 22818081
SKBR3 Growth inhibition assay 48 h IC50 = 0.0019 μM 22850214
HepG2 Cytotoxicity assay 72 h IC50 = 0.00044 μM 22871217
MCF7 Cytotoxicity assay 72 h IC50 = 0.003 μM 22871217
A375 Cytotoxicity assay 72 h IC50 = 0.0092 μM 22871217
BxPC3 Cytotoxicity assay 72 h IC50 = 0.09 μM 22871217
SMMC7721 Cytotoxicity assay 72 h IC50 = 0.15 μM 22871217
PANC1 Cytotoxicity assay 72 h IC50 = 0.26 μM 22871217
A549 Cytotoxicity assay 72 h IC50 = 0.72 μM 22871217
AGS Cytotoxicity assay 72 h IC50 = 1.6 μM 22871217
NCI-H2126 Cytotoxicity assay 72 h IC50 = 2.5 μM 22871217
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 5 μM 22871217
U87 Cytotoxicity assay 72 h IC50 = 8.1 μM 22871217
HELF Cytotoxicity assay 24 h IC50 = 7.14 μM 22901410
BGC Cytotoxicity assay 24 h IC50 = 9.26 μM 22901410
HELF Cytotoxicity assay 24 h IC50 = 7.14 μM 22921966
BGC Cytotoxicity assay 24 h IC50 = 9.26 μM 22921966
DU145 Cytotoxicity assay 72 h GI50 = 0.00255 μM 22932313
KB Cytotoxicity assay 72 h GI50 = 0.00265 μM 22932313
A549 Cytotoxicity assay 72 h GI50 = 0.00489 μM 22932313
KBVIN Cytotoxicity assay 72 h GI50 = 0.948 μM 22932313
HL60 Cytotoxicity assay 72 h IC50 = 0.00282 μM 22959518
HeLa Cytotoxicity assay 72 h IC50 = 0.00293 μM 22959518
U937 Cytotoxicity assay 72 h IC50 = 0.00337 μM 22959518
HeLa Cytotoxicity assay IC50 = 1 μM 23103097
A2780 Cytotoxicity assay IC50 = 1.1 μM 23103097
A549 Antiproliferative activity assay 72 h IC50 = 0.0072 μM 23117171
taxol-resistant A549-T12 Antiproliferative activity assay 72 h IC50 = 0.0752 μM 23117171
IGROV1/Pt1 Cytotoxicity assay 72 h IC50 = 0.0022 μM 23140358
SKOV3 Cytotoxicity assay 72 h IC50 = 0.0027 μM 23140358
U2OS Cytotoxicity assay 72 h IC50 = 0.0034 μM 23140358
PANC1 Cytotoxicity assay 72 h IC50 = 0.0052 μM 23140358
MIAPaCa2 Cytotoxicity assay 72 h IC50 = 0.0072 μM 23140358
IGROV1 Cytotoxicity assay 72 h IC50 = 0.023 μM 23140358
MES-SA Cytotoxicity assay IC50 = 0.003 μM 23141916
A2780 Antiproliferative activity assay 2 days IC50 = 0.028 μM 23149304
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 0.052 μM 23153397
HepG2 Cytotoxicity assay 72 h IC50 = 0.054 μM 23153397
A549 Cytotoxicity assay 72 h IC50 = 0.056 μM 23153397
NUGC3 Growth inhibition assay GI50 = 0.02 μM 23167614
HONE1 Growth inhibition assay GI50 = 0.02 μM 23167614
NCI-H460 Growth inhibition assay GI50 = 0.03 μM 23167614
MCF7 Growth inhibition assay GI50 = 0.03 μM 23167614
A549 Growth inhibition assay GI50 = 0.06 μM 23167614
HepG2 Growth inhibition assay GI50 = 0.18 μM 23167614
HeLa Cytotoxicity assay 96 h IC50 = 0.001 μM 23176628
SW780 Cytotoxicity assay 96 h IC50 = 0.0011 μM 23176628
MESSA Cytotoxicity assay 72 h IC50 = 0.004 μM 23214452
OVCAR8 Cytotoxicity assay IC50 = 0.005 μM 23214452
HeLa Cytotoxicity assay 48 h IC50 = 0.005 μM 23214452
A549 Cytotoxicity assay 48 h IC50 = 0.007 μM 23214452
HT-29 Cytotoxicity assay 48 h IC50 = 0.008 μM 23214452
HCT15 Cytotoxicity assay 72 h IC50 = 0.09 μM 23214452
MESSA/DX5 Cytotoxicity assay 72 h IC50 = 1.764 μM 23214452
NCI/ADR-RES Cytotoxicity assay IC50 = 3.3 μM 23214452
DU145 Growth inhibition assay GI50 = 0.0065 μM 23274123
KB Growth inhibition assay GI50 = 0.00777 μM 23274123
A549 Growth inhibition assay GI50 = 0.00818 μM 23274123
KBVIN Growth inhibition assay GI50 = 1.803 μM 23274123
K562 Antiproliferative activity assay IC50 = 0.41 μM 23274570
CaEs17 Antiproliferative activity assay IC50 = 0.43 μM 23274570
MGC803 Antiproliferative activity assay IC50 = 0.85 μM 23274570
Bel7402 Antiproliferative activity assay IC50 = 1.89 μM 23274570
U937 Cytotoxicity assay 72 h IC50 = 0.0023 μM 23301703
MOLT4 Cytotoxicity assay 72 h IC50 = 0.0027 μM 23301703
K562 Cytotoxicity assay 72 h IC50 = 0.0051 μM 23301703
KU812 Cytotoxicity assay 72 h IC50 = 0.0053 μM 23301703
HL60 Cytotoxicity assay 72 h IC50 = 0.0058 μM 23301703
SUP-B15 Cytotoxicity assay 72 h IC50 = 0.008 μM 23301703
HT-29 Cytotoxicity assay ED50 = 0.001 μM 23301897
A549 Cytotoxicity assay 48 h IC50 = 0.008 μM 23327668
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 23327668
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 23327668
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 23327668
SW480 Cytotoxicity assay 48 h IC50 = 0.15 μM 23327668
HT-29 Cytotoxicity assay 3 days IC50 = 0.001 μM 23327794
HeLa Cytotoxicity assay 48 h IC50 = 0.0016 μM 23332369
SKOV3 Cytotoxicity assay 48 h IC50 = 0.0044 μM 23332369
JC Cytotoxicity assay 48 h IC50 = 0.15 μM 23352482
HeLa Cytotoxicity assay 48 h IC50 = 0.0063 μM 23356786
A549 Cytotoxicity assay 48 h IC50 = 0.0082 μM 23356786
QGY Cytotoxicity assay 48 h IC50 = 0.0113 μM 23356786
SW480 Cytotoxicity assay 48 h IC50 = 0.0121 μM 23356786
K562 Cytotoxicity assay 48 h IC50 = 0.0157 μM 23356786
NCI-H358 Cytotoxicity assay IC50 = 0.01 μM 23425970
A2780S Cytotoxicity assay IC50 = 0.02 μM 23425970
DU145 Cytotoxicity assay IC50 = 0.03 μM 23425970
SKOV3 Cytotoxicity assay IC50 = 0.1 μM 23425970
ES2 Cytotoxicity assay IC50 = 0.1 μM 23425970
HCT15 Cytotoxicity assay IC50 = 0.12 μM 23425970
PC3 Cytotoxicity assay IC50 = 0.14 μM 23425970
SKHEP1 Cytotoxicity assay IC50 = 0.24 μM 23425970
HT-29 Cytotoxicity assay IC50 = 0.45 μM 23425970
MCF7 Cytotoxicity assay IC50 = 0.66 μM 23425970
C26 Cytotoxicity assay IC50 = 1.05 μM 23425970
SPC-A1 Cytotoxicity assay IC50 = 5.3 μM 23425970
A2780 Cytotoxicity assay IC50 = 8.25 μM 23425970
A549 Cytotoxicity assay 72 h IC50 = 0.0035 μM 23445496
A549-T12 Cytotoxicity assay 72 h IC50 = 0.0923 μM 23445496
MDA-MB-435 Cytotoxicity assay 48 h IC50 = 0.004 μM 23547728
MDA-MB-435/LCC6MDR1 Cytotoxicity assay 48 h IC50 = 0.277 μM 23547728
A2780 Cytotoxicity assay IC50 = 0.001 μM 23547884
BGC823 Cytotoxicity assay IC50 = 0.001 μM 23547884
Bel7402 Cytotoxicity assay IC50 = 0.006 μM 23547884
A549 Cytotoxicity assay IC50 = 0.016 μM 23547884
HCT8 Cytotoxicity assay IC50 = 0.051 μM 23547884
KB403 Cytotoxicity assay 6 h IC50 = 0.001 μM 23584542
WRL68 Cytotoxicity assay 6 h IC50 = 0.004 μM 23584542
MCF7 Cytotoxicity assay 6 h IC50 = 0.005 μM 23584542
Caco2 Cytotoxicity assay 6 h IC50 = 0.008 μM 23584542
PA1 Cytotoxicity assay 6 h IC50 = 0.008 μM 23584542
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 23586920
A2058 Cytotoxicity assay 96 h IC50 = 0.0047 μM 23623678
H522-T1 Cytotoxicity assay 96 h IC50 = 0.0081 μM 23623678
A2780 Cytotoxicity assay 2 days IC50 = 0.012 μM 23623678
K562 Cytotoxicity assay 72 h IC50 = 0.41 μM 23644204
CaEs17 Cytotoxicity assay 72 h IC50 = 0.43 μM 23644204
MGC803 Cytotoxicity assay 72 h IC50 = 0.85 μM 23644204
Bel7402 Cytotoxicity assay 72 h IC50 = 1.89 μM 23644204
HT1080 Cytotoxicity assay 24 h IC50 = 6 μM 23647462
A2780 Cytotoxicity assay IC50 = 0.028 μM 23659371
SNU387 Cytotoxicity assay 48 h IC50 = 0.27 μM 23701597
HepG2 Cytotoxicity assay 72 h IC50 = 0.006 μM 23708235
SKOV3 Cytotoxicity assay 72 h IC50 = 0.012 μM 23708235
HCT116 Cytotoxicity assay GI50 = 0.01 μM 23725535
T47D Cytotoxicity assay GI50 = 0.01 μM 23725535
LOXIMVI Cytotoxicity assay GI50 = 0.016 μM 23725535
OVCAR3 Cytotoxicity assay GI50 = 0.02 μM 23725535
DU145 Cytotoxicity assay GI50 = 0.032 μM 23725535
MOLT4 Cytotoxicity assay GI50 = 0.032 μM 23725535
SNB19 Cytotoxicity assay GI50 = 0.04 μM 23725535
NCI-H322M Cytotoxicity assay GI50 = 0.05 μM 23725535
RXF393 Cytotoxicity assay GI50 = 0.05 μM 23725535
A549 Cytotoxicity assay 3 days IC50 = 0.02 μM 23738539
NB4 Cytotoxicity assay 3 days IC50 = 0.03 μM 23738539
MCF7 Cytotoxicity assay 3 days IC50 = 0.1 μM 23738539
PC3 Cytotoxicity assay 3 days IC50 = 0.2 μM 23738539
SH-SY5Y Cytotoxicity assay 3 days IC50 = 0.2 μM 23738539
HT-29 Cytotoxicity assay 96 h IC50 = 0.00198 μM 23746477
HCT116 Cytotoxicity assay 96 h IC50 = 0.00613 μM 23746477
2008 Growth inhibition assay GI50 = 0.003 μM 23750455
MES-SA Growth inhibition assay GI50 = 0.004 μM 23750455
MES-SA/Dx5 Growth inhibition assay GI50 = 0.75 μM 23750455
2008/17/4 Growth inhibition assay GI50 = 2 μM 23750455
MOLT4 Cytotoxicity assay IC50 = 0.0018 μM 23806112
U937 Cytotoxicity assay IC50 = 0.0019 μM 23806112
BGC823 Cytotoxicity assay IC50 = 0.0035 μM 23806112
A549 Cytotoxicity assay IC50 = 0.0036 μM 23806112
K562 Cytotoxicity assay IC50 = 0.0049 μM 23806112
MCF7 Cytotoxicity assay IC50 = 0.005 μM 23806112
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 23819871
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 23819871
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 23819871
SW480 Cytotoxicity assay 48 h IC50 = 0.04 μM 23819871
A549 Cytotoxicity assay 48 h IC50 = 1.4 μM 23819871
MCF7 Cytotoxicity assay 72 h GI50 = 0.003 μM 23831811
HT-29 Cytotoxicity assay 72 h GI50 = 0.003 μM 23831811
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 1 μM 23848163
PANC1 Cytotoxicity assay 72 h IC50 = 1 μM 23848163
HeLa Antiproliferative activity assay 48 h IC50 = 0.0017 μM 23855338
rat lymphatic endothelial Antiproliferative activity assay 48 h IC50 = 0.018 μM 23855338
HeLa Antiproliferative activity assay 48 h IC50 = 0.0012 μM 23855953
DU145 Cytotoxicity assay GI50 = 0.006 μM 23867604
KB Cytotoxicity assay GI50 = 0.0064 μM 23867604
A549 Cytotoxicity assay GI50 = 0.0076 μM 23867604
KBVIN Cytotoxicity assay GI50 = 1.21 μM 23867604
A549 Cytotoxicity assay 72 h IC50 = 0.014 μM 23886686
HT-29 Cytotoxicity assay 72 h IC50 = 0.0006 μM 23895019
HeLa Antiproliferative activity assay 48 h IC50 = 0.0016 μM 23895532
SKOV3 Antiproliferative activity assay 48 h IC50 = 0.003 μM 23895532
SKOV3/M6-6 isogenic Function assay 48 h IC50 = 2.6 μM 23895532
MES-SA Growth inhibition assay 48 h GI50 = 0.007 μM 23927793
MES-SA/Dx5 Growth inhibition assay 48 h GI50 = 9.8 μM 23927793
HL60 Cytotoxicity assay IC50 = 0.002 μM 23937981
DU145 Cytotoxicity assay IC50 = 0.005 μM 23937981
MES-SA Cytotoxicity assay IC50 = 0.005 μM 23937981
MDA435 Cytotoxicity assay IC50 = 0.005 μM 23937981
Bowes Cytotoxicity assay IC50 = 0.005 μM 23937981
A549 Cytotoxicity assay IC50 = 0.01 μM 23937981
Clone A Cytotoxicity assay IC50 = 0.5 μM 23937981
MIP101 Cytotoxicity assay IC50 = 1.1 μM 23937981
PBMC Cytotoxicity assay IC50 = 5 μM 23937981
39SK Cytotoxicity assay IC50 = 5 μM 23937981
HL60 Antimicrobial assay 48 h IC50 = 0.008 μM 23957453
SMMC7721 Antimicrobial assay 48 h IC50 = 0.008 μM 23957453
MCF7 Antimicrobial assay 48 h IC50 = 0.008 μM 23957453
SW480 Antimicrobial assay 48 h IC50 = 0.04 μM 23957453
A549 Antimicrobial assay 48 h IC50 = 0.1 μM 23957453
MCF7 Antiproliferative activity assay 72 h IC50 = 0.003 μM 24012378
PC3 Cytotoxicity assay 72 h IC50 = 0.02 μM 24033131
DU145 Cytotoxicity assay 72 h IC50 = 0.04 μM 24033131
WI38 Cytotoxicity assay 72 h IC50 = 0.05 μM 24033131
MCF7 Cytotoxicity assay 48 h IC50 = 0.5 μM 24056146
PC3 Cytotoxicity assay 48 h IC50 = 1.5 μM 24056146
A549 Cytotoxicity assay 72 h IC50 = 0.02 μM 24063567
NB4 Cytotoxicity assay 72 h IC50 = 0.03 μM 24063567
MCF7 Cytotoxicity assay 72 h IC50 = 0.1 μM 24063567
SH-SY5Y Cytotoxicity assay 72 h IC50 = 0.2 μM 24063567
PC3 Cytotoxicity assay 72 h IC50 = 0.2 μM 24063567
A549 Cytotoxicity assay 48 h IC50 = 0.02 μM 24063582
NB4 Cytotoxicity assay 48 h IC50 = 0.03 μM 24063582
MCF7 Cytotoxicity assay 48 h IC50 = 0.1 μM 24063582
PC3 Cytotoxicity assay 48 h IC50 = 0.2 μM 24063582
SH-SY5Y Cytotoxicity assay 48 h IC50 = 0.2 μM 24063582
HeLa Cytotoxicity assay 72 h IC50 = 0.0014 μM 24087857
SKOV3 Cytotoxicity assay 72 h IC50 = 0.003 μM 24087857
KB Cytotoxicity assay 72 h IC50 = 0.0041 μM 24106982
KB-7d Cytotoxicity assay 72 h IC50 = 0.0079 μM 24106982
KB-S15 Cytotoxicity assay 72 h IC50 = 0.273 μM 24106982
MCF7 Cytotoxicity assay IC50 = 3.1 μM 24195466
A549 Antiproliferative activity assay 96 h IC50 = 0.0044 μM 24211639
MCF7 Antiproliferative activity assay 96 h IC50 = 0.0205 μM 24211639
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 24219809
SW480 Cytotoxicity assay 48 h IC50 = 0.008 μM 24219809
A549 Cytotoxicity assay 48 h IC50 = 0.008 μM 24219809
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 24219809
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 24219809
A2780 Antiproliferative activity assay 2 days IC50 = 0.024 μM 24239390
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 24256484
A549 Cytotoxicity assay 48 h IC50 = 0.008 μM 24256484
SW480 Cytotoxicity assay 48 h IC50 = 0.008 μM 24256484
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 24256484
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 24256484
BEAS2B Cytotoxicity assay 48 h IC50 = 0.58 μM 24256484
SKOV3 Cytotoxicity assay 48 h IC50 = 0.035 μM 24269481
A549 Cytotoxicity assay 48 h IC50 = 0.93 μM 24269481
DU145 Cytotoxicity assay GI50 = 0.006 μM 24315191
A549 Cytotoxicity assay GI50 = 0.0076 μM 24315191
KB Cytotoxicity assay GI50 = 0.008 μM 24315191
KBVIN Cytotoxicity assay GI50 = 1.8 μM 24315191
MCF7 Cytotoxicity assay 72 h IC50 = 0.00705 μM 24332858
MCF7 Growth inhibition assay GI50 = 0.00129 μM 24405702
Bel7402 Growth inhibition assay GI50 = 0.001792 μM 24405702
MOLT4 Growth inhibition assay GI50 = 0.002232 μM 24405702
A431 Growth inhibition assay GI50 = 0.002355 μM 24405702
U937 Growth inhibition assay GI50 = 0.002392 μM 24405702
PANC1 Growth inhibition assay GI50 = 0.002409 μM 24405702
SGC7901 Growth inhibition assay GI50 = 0.003088 μM 24405702
HeLa Growth inhibition assay GI50 = 0.003206 μM 24405702
BGC823 Growth inhibition assay GI50 = 0.003605 μM 24405702
HT1080 Growth inhibition assay GI50 = 0.003889 μM 24405702
DU145 Growth inhibition assay GI50 = 0.005568 μM 24405702
K562 Growth inhibition assay GI50 = 0.007014 μM 24405702
A549 Growth inhibition assay GI50 = 0.01873 μM 24405702
HuH7 Growth inhibition assay GI50 = 0.2067 μM 24405702
SW480 Cytotoxicity assay 48 h IC50 = 0.008 μM 24417634
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 24417634
A549 Cytotoxicity assay 48 h IC50 = 0.008 μM 24417634
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 24417634
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 24417634
HeLa Cytotoxicity assay IC50 = 0.0025 μM 24422592
Bel7402 Cytotoxicity assay 96 h IC50 = 0.011 μM 24467317
HCT8 Cytotoxicity assay 96 h IC50 = 0.02 μM 24467317
BGC823 Cytotoxicity assay 96 h IC50 = 0.026 μM 24467317
A549 Cytotoxicity assay 96 h IC50 = 0.032 μM 24467317
A2780 Cytotoxicity assay 96 h IC50 = 0.59 μM 24467317
ViBo Antiproliferative activity assay 24 h IC50 = 1.6 μM 24487193
CaSki Antiproliferative activity assay 24 h IC50 = 2.9 μM 24487193
DU145 Cytotoxicity assay GI50 = 0.006 μM 24502232
KB Cytotoxicity assay GI50 = 0.0064 μM 24502232
A549 Cytotoxicity assay GI50 = 0.0076 μM 24502232
KBVIN Cytotoxicity assay GI50 = 1.21 μM 24502232
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 0.0056 μM 24564494
KB Cytotoxicity assay 72 h IC50 = 0.0051 μM 24657567
KB-7d Cytotoxicity assay 72 h IC50 = 0.0084 μM 24657567
KB-S15 Cytotoxicity assay 72 h IC50 = 0.135 μM 24657567
A2780 Cytotoxicity assay IC50 = 0.00138 μM 24680057
1A9PTX22 Cytotoxicity assay IC50 = 0.1607 μM 24680057
1A9PTX10 Cytotoxicity assay IC50 = 0.53295 μM 24680057
BCG823 Cytotoxicity assay IC50 = 0.0028 μM 24684840
HepG2 Cytotoxicity assay IC50 = 0.0064 μM 24684840
HL-7702 Cytotoxicity assay IC50 = 0.0518 μM 24684840
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 24697496
A549 Cytotoxicity assay 48 h IC50 = 0.008 μM 24697496
SW480 Cytotoxicity assay 48 h IC50 = 0.008 μM 24697496
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 24697496
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 24697496
HT-29 Growth inhibition assay 48 h GI50 = 0.001 μM 24727464
U251 Growth inhibition assay 48 h GI50 = 0.003 μM 24727464
MCF7 Growth inhibition assay 48 h GI50 = 0.005 μM 24727464
UACC62 Growth inhibition assay 48 h GI50 = 0.01 μM 24727464
786-0 Growth inhibition assay 48 h GI50 = 0.02 μM 24727464
African green monkey Vero Growth inhibition assay 48 h GI50 = 0.03 μM 24727464
NCI-ADR-RES Growth inhibition assay 48 h GI50 = 0.04 μM 24727464
NCI-H460 Growth inhibition assay 48 h GI50 = 0.1 μM 24727464
PC3 Growth inhibition assay 48 h GI50 = 0.1 μM 24727464
K562 Growth inhibition assay 48 h GI50 = 0.1 μM 24727464
OVCAR3 Growth inhibition assay 48 h GI50 = 0.2 μM 24727464
HepG2 Cytotoxicity assay 3 days IC50 = 0.00019 μM 24745968
KB Cytotoxicity assay 3 days IC50 = 0.0039 μM 24745968
NCI-ADR-RES Cytotoxicity assay EC50 = 0.013 μM 24801610
OVCAR8 Cytotoxicity assay EC50 = 0.018 μM 24801610
NALM6 Antiproliferative activity assay 48 to 72 h IC50 = 0.0041 μM 24852281
Jurkat Antiproliferative activity assay 48 to 72 h IC50 = 0.0045 μM 24852281
K562 Antiproliferative activity assay 48 to 72 h IC50 = 0.0055 μM 24852281
HeLa Antiproliferative activity assay IC50 = 0.00121 μM 24890652
MDA-MB-435 Antiproliferative activity assay IC50 = 0.00193 μM 24890652
SKOV3 Antiproliferative activity assay IC50 = 0.003 μM 24890652
SKOV3 Cytotoxicity assay GI50 = 0.0047 μM 24893224
P-gp expressing SKOV3-M6/6 Cytotoxicity assay GI50 = 0.6 μM 24893224
PC3 Cytotoxicity assay 96 h IC50 = 0.0025 μM 24900437
HeLa Growth inhibition assay 96 h IC50 = 0.0053 μM 24900865
OVCAR8 Growth inhibition assay 96 h IC50 = 0.01 μM 24900865
NCI/ADR-RES Growth inhibition assay 96 h IC50 = 5 μM 24900865
MCF7 Cytotoxicity assay 72 h IC50 = 0.045 μM 24929344
HCT116 Cytotoxicity assay 72 h IC50 = 0.069 μM 24929344
HepG2 Cytotoxicity assay 72 h IC50 = 0.084 μM 24929344
HeLa Cytotoxicity assay 72 h IC50 = 0.096 μM 24929344
U251 Cytotoxicity assay 72 h IC50 = 0.128 μM 24929344
HT-29 Cytotoxicity assay IC50 = 0.001 μM 24937209
HT-29 Antiproliferative activity assay 24 and 72 h IC50 = 0.29 μM 24941130
HeLa Antiproliferative activity assay 24 and 72 h IC50 = 0.29 μM 24941130
Caco2 Antiproliferative activity assay 24 and 72 h IC50 = 0.31 μM 24941130
HL60 Antiproliferative activity assay 24 and 72 h IC50 = 0.32 μM 24941130
MCF7 Antiproliferative activity assay 24 and 72 h IC50 = 0.33 μM 24941130
Saos2 Antiproliferative activity assay 24 and 72 h IC50 = 0.35 μM 24941130
SKOV3-MDR1-M6/6 Anticancer assay 48 h IC50 = 0.97 μM 24946145
SKOV3 Anticancer assay 48 h IC50 = 1 μM 24946145
MDA435/LCC6 Cytotoxicity assay 5 days IC50 = 0.0026 μM 24952376
MDA435/LCC6MDR Cytotoxicity assay 5 days IC50 = 0.1493 μM 24952376
MCF7 Cytotoxicity assay IC50 = 0.0015 μM 24960143
HepG2 Cytotoxicity assay IC50 = 0.0046 μM 24960143
MDA-MB-231 Cytotoxicity assay IC50 = 0.0082 μM 24960143
HL7702 Cytotoxicity assay IC50 = 1.1 μM 24960143
MCF7 Antiproliferative activity assay 48 h IC50 = 0.02581 μM 24996136
HepG2 Antiproliferative activity assay 48 h IC50 = 0.06727 μM 24996136
A549 Antiproliferative activity assay 48 h IC50 = 1.525 μM 24996136
KB Cytotoxicity assay 72 h IC50 = 0.0039 μM 25008456
A549 Cytotoxicity assay 72 h IC50 = 0.0057 μM 25008456
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 0.0066 μM 25008456
KBVIN Cytotoxicity assay 72 h IC50 = 1.44 μM 25008456
MESSA Cytotoxicity assay 72 h IC50 = 0.004 μM 25025991
OVCAR8 Cytotoxicity assay 96 h IC50 = 0.005 μM 25025991
MESSA/DX5 Cytotoxicity assay 72 h IC50 = 1.764 μM 25025991
HepG2 Cytotoxicity assay 48 h IC50 = 2.037 μM 25025991
NCI/ADR-RES Cytotoxicity assay 96 h IC50 = 3.3 μM 25025991
PC3 Cytotoxicity assay 48 h IC50 = 3.99 μM 25025991
TCT1 Cytotoxicity assay 48 h IC50 = 2.5 μM 25046128
A2780 Cytotoxicity assay IC50 = 0.0004 μM 25047938
HeLa Cytotoxicity assay IC50 = 0.0007 μM 25047938
MCF7 Cytotoxicity assay IC50 = 0.0017 μM 25047938
1A9 Cytotoxicity assay IC50 = 0.0039 μM 25047938
1A9/A8 Cytotoxicity assay IC50 = 0.0042 μM 25047938
1A9PTX22 Cytotoxicity assay IC50 = 0.0328 μM 25047938
1A9PTX10 Cytotoxicity assay IC50 = 0.0814 μM 25047938
MCF7/R Cytotoxicity assay IC50 = 0.299 μM 25047938
A2780AD Cytotoxicity assay IC50 = 1.244 μM 25047938
KB Antiproliferative activity assay IC50 = 0.0033 μM 25059503
KB-7d Antiproliferative activity assay IC50 = 0.0079 μM 25059503
KB-S15 Antiproliferative activity assay IC50 = 0.273 μM 25059503
CNE2 Antiproliferative activity assay 48 h IC50 = 0.003 μM 25061803
A549 Antiproliferative activity assay 48 h IC50 = 0.005 μM 25061803
SW480 Antiproliferative activity assay 48 h IC50 = 0.007 μM 25061803
A2780 Antiproliferative activity assay 48 h IC50 = 0.015 μM 25061803
HCT8 Antiproliferative activity assay 48 h IC50 = 0.021 μM 25061803
MCF7 Antiproliferative activity assay 48 h IC50 = 0.023 μM 25061803
HepG2 Antiproliferative activity assay 48 h IC50 = 0.028 μM 25061803
MCF7 Cytotoxicity assay 48 h IC50 = 0.004 μM 25084144
A549 Cytotoxicity assay 48 h IC50 = 0.082 μM 25084144
COLO205 Cytotoxicity assay IC50 = 0.003 μM 25091926
K562 Cytotoxicity assay 72 h IC50 = 0.004 μM 25091926
A431 Cytotoxicity assay 72 h IC50 = 0.007 μM 25091926
MDA-MB-435S Cytotoxicity assay 72 h IC50 = 0.009 μM 25091926
NCI-H460 Cytotoxicity assay IC50 = 0.01 μM 25091926
HeLa Cytotoxicity assay 72 h IC50 = 0.41 μM 25091926
HepG2 Cytotoxicity assay 72 h IC50 = 0.99 μM 25091926
MDA-MB-DYT2 Cytotoxicity assay 4 days IC50 = 0.00608 μM 25098528
MDA-MB-468 Cytotoxicity assay 4 days IC50 = 0.00717 μM 25098528
NCI-N87 Cytotoxicity assay 4 days IC50 = 0.00753 μM 25098528
NCI-H1975 Cytotoxicity assay 4 days IC50 = 0.00794 μM 25098528
BT474 Cytotoxicity assay 4 days IC50 = 0.00836 μM 25098528
DU145 Cytotoxicity assay IC50 = 1.5 μM 25105722
MCF7 Cytotoxicity assay IC50 = 1.8 μM 25105722
HeLa Cytotoxicity assay IC50 = 5 μM 25105722
MCF7 Cytotoxicity assay 48 h IC50 = 0.2 μM 25176329
NCI-H358 Antiproliferative activity assay 48 h IC50 = 0.002 μM 25208345
A2780S Antiproliferative activity assay 48 h IC50 = 0.004 μM 25208345
HCT8 Antiproliferative activity assay 48 h IC50 = 0.005 μM 25208345
AGS Antiproliferative activity assay 48 h IC50 = 0.008 μM 25208345
DLD1 Antiproliferative activity assay 48 h IC50 = 0.016 μM 25208345
HCT116 Antiproliferative activity assay 48 h IC50 = 0.018 μM 25208345
ES2 Antiproliferative activity assay 48 h IC50 = 0.02 μM 25208345
U251 Antiproliferative activity assay 48 h IC50 = 0.023 μM 25208345
HCT15 Antiproliferative activity assay 48 h IC50 = 0.024 μM 25208345
HepG2 Antiproliferative activity assay 48 h IC50 = 0.038 μM 25208345
MCF7 Antiproliferative activity assay 48 h IC50 = 0.132 μM 25208345
C26 Antiproliferative activity assay 48 h IC50 = 0.21 μM 25208345
HL60 Cytotoxicity assay 48 h IC50 = 1.5 μM 25211032
K562 Cytotoxicity assay 48 h IC50 = 2.4 μM 25211032
HepG2 Cytotoxicity assay 48 h IC50 = 2.7 μM 25211032
MCF7 Cytotoxicity assay 48 h IC50 = 3.2 μM 25211032
HT-29 Cytotoxicity assay 48 h IC50 = 3.5 μM 25211032
KB Cytotoxicity assay 48 h IC50 = 3.8 μM 25211032
NCI-H1688 Cytotoxicity assay 24 h IC50 = 0.85 μM 25226363
PC3 Cytotoxicity assay 24 h IC50 = 0.94 μM 25226363
A549 Cytotoxicity assay 24 h IC50 = 1.04 μM 25226363
DU145 Cytotoxicity assay 24 h IC50 = 1.79 μM 25226363
A549 Antiproliferative activity assay 3 days IC50 = 0.0024 μM 25241925
KB Antiproliferative activity assay 3 days IC50 = 0.0037 μM 25241925
DU145 Antiproliferative activity assay 3 days IC50 = 0.00488 μM 25241925
KBVIN Antiproliferative activity assay 3 days IC50 = 1.58 μM 25241925
HeLa Growth inhibition assay 48 h GI50 = 0.025 μM 25264072
MiaPaCa Growth inhibition assay 48 h GI50 = 0.056 μM 25264072
IMR32 Growth inhibition assay 48 h GI50 = 0.075 μM 25264072
MDA-MB-231 Growth inhibition assay 48 h GI50 = 0.091 μM 25264072
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 25375202
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 25375202
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 25375202
A549 Cytotoxicity assay 48 h IC50 = 0.008 μM 25375202
SW480 Cytotoxicity assay 48 h IC50 = 0.15 μM 25375202
HepG2 Cytotoxicity assay 3 days IC50 = 0.00019 μM 25442315
KB Cytotoxicity assay 3 days IC50 = 0.0039 μM 25442315
MDA-MB-231 Antiproliferative activity assay 4 h IC50 = 6.2 μM 25453798
MDA435 Cytotoxicity assay 24 h IC50 = 0.005 μM 25462222
HL60 Cytotoxicity assay 24 h IC50 = 0.007 μM 25462222
MES-SA Cytotoxicity assay 24 h IC50 = 0.008 μM 25462222
MDA-MB-231 Cytotoxicity assay 24 h IC50 = 0.457 μM 25462222
MES-SA/Dx5 Cytotoxicity assay 24 h IC50 = 5.1 μM 25462222
HeLa Antiproliferative activity assay 48 h GI50 = 0.025 μM 25462234
MiaPaCa Antiproliferative activity assay 48 h GI50 = 0.056 μM 25462234
IMR32 Antiproliferative activity assay 48 h GI50 = 0.075 μM 25462234
MDA-MB-231 Antiproliferative activity assay 48 h GI50 = 0.091 μM 25462234
HCT116 Cytotoxicity assay 72 h IC50 = 0.004 μM 25462279
A549 Cytotoxicity assay 72 h IC50 = 0.006 μM 25462279
HeLa Cytotoxicity assay 72 h IC50 = 0.008 μM 25462279
SKOV3 Cytotoxicity assay 48 h IC50 = 0.001 μM 25462285
PANC1 Cytotoxicity assay IC50 = 1.18 μM 25466201
HeLa Cytotoxicity assay IC50 = 1.3 μM 25466201
Calu1 Cytotoxicity assay IC50 = 1.33 μM 25466201
H460 Cytotoxicity assay IC50 = 1.43 μM 25466201
HCT116 Cytotoxicity assay IC50 = 1.55 μM 25466201
ACHN Cytotoxicity assay IC50 = 2.33 μM 25466201
HCT116 Cytotoxicity assay 72 h IC50 = 0.0027 μM 25499433
MCF7 Cytotoxicity assay 48 h IC50 = 2.58 μM 25563891
A549 Cytotoxicity assay 48 h IC50 = 4.9 μM 25563891
A375 Cytotoxicity assay 48 h IC50 = 8 μM 25563891
LC2/ad Antiproliferative activity assay 72 h IC50 = 0.0025 μM 25625617
GSS Antiproliferative activity assay 72 h IC50 = 0.0034 μM 25625617
MKN45 Antiproliferative activity assay 72 h IC50 = 0.004 μM 25625617
PC14 Antiproliferative activity assay 72 h IC50 = 0.0044 μM 25625617
Lu116 Antiproliferative activity assay 72 h IC50 = 0.0051 μM 25625617
LU99A Antiproliferative activity assay 72 h IC50 = 0.0052 μM 25625617
MIAPaCa2 Antiproliferative activity assay 72 h IC50 = 0.0061 μM 25625617
HCT116 Antiproliferative activity assay 72 h IC50 = 0.0061 μM 25625617
HT-29 Antiproliferative activity assay 72 h IC50 = 0.007 μM 25625617
NCI-H358 Antiproliferative activity assay 72 h IC50 = 0.0079 μM 25625617
HL60 Antiproliferative activity assay 72 h IC50 = 0.0079 μM 25625617
NCI-H460 Antiproliferative activity assay 72 h IC50 = 0.01 μM 25625617
MRC5 Antiproliferative activity assay 72 h IC50 = 0.08 μM 25625617
HCT15 Antiproliferative activity assay 72 h IC50 = 0.24 μM 25625617
HeLa Cytotoxicity assay 48 h IC50 = 0.01 μM 25647428
PC3 Cytotoxicity assay 48 h IC50 = 0.012 μM 25647428
A549 Cytotoxicity assay 48 h IC50 = 0.025 μM 25647428
MES-SA Antiproliferative activity assay 48 h GI50 = 0.007 μM 25671501
MES-SA/Dx5 Antiproliferative activity assay 48 h GI50 = 9.8 μM 25671501
A549 Antiproliferative activity assay 48 h IC50 = 0.003 μM 25682561
MCF7 Antiproliferative activity assay 48 h IC50 = 0.003 μM 25682561
A549/CDDP Antiproliferative activity assay 48 h IC50 = 0.006 μM 25682561
A2780 Antiproliferative activity assay 48 h IC50 = 0.006 μM 25682561
HepG2 Antiproliferative activity assay 48 h IC50 = 0.009 μM 25682561
SW480 Antiproliferative activity assay 48 h IC50 = 0.021 μM 25682561
HCT8 Antiproliferative activity assay 48 h IC50 = 0.066 μM 25682561
NIH/3T3 Antiproliferative activity assay 48 h IC50 = 0.58 μM 25682561
A2780/TAX Antiproliferative activity assay 48 h IC50 = 4.4 μM 25682561
MCF7/DX Antiproliferative activity assay 48 h IC50 = 6.2 μM 25682561
HeLa Growth inhibition assay IC50 = 0.0035 μM 25685941
DU145 Growth inhibition assay IC50 = 0.004 μM 25685941
PC3 Growth inhibition assay IC50 = 0.04 μM 25685941
SKOV3 Growth inhibition assay IC50 = 6.2 μM 25685941
MCF7 Cytotoxicity assay 48 h IC50 = 0.032 μM 25728023
HepG2 Cytotoxicity assay 48 h IC50 = 0.045 μM 25728023
Hep3B2 Cytotoxicity assay IC50 = 0.000016 μM 25760674
PANC1 Cytotoxicity assay IC50 = 0.0011 μM 25760674
CNE1-LMP1 Cytotoxicity assay IC50 = 0.0042 μM 25760674
MGC Cytotoxicity assay IC50 = 0.0064 μM 25760674
A375 Cytotoxicity assay IC50 = 0.0089 μM 25760674
MCF7 Cytotoxicity assay IC50 = 0.014 μM 25760674
HaCaT Cytotoxicity assay IC50 = 0.024 μM 25760674
A549 Cytotoxicity assay IC50 = 0.03 μM 25760674
EC109 Cytotoxicity assay IC50 = 0.14 μM 25760674
NIH/3T3 Cytotoxicity assay IC50 = 4.2 μM 25760674
DU145 Antiproliferative activity assay GI50 = 0.0057 μM 25770782
KB Antiproliferative activity assay GI50 = 0.0064 μM 25770782
A549 Antiproliferative activity assay GI50 = 0.0071 μM 25770782
KBVIN Antiproliferative activity assay GI50 = 0.95 μM 25770782
HL60 Antiproliferative activity assay 72 h IC50 = 0.0017 μM 25771484
HCT116 Antiproliferative activity assay 72 h IC50 = 0.0049 μM 25771484
KB Antiproliferative activity assay 72 h IC50 = 0.015 μM 25771484
A549 Antiproliferative activity assay 72 h IC50 = 0.058 μM 25771484
SMMC7721 Antiproliferative activity assay 72 h IC50 = 0.12 μM 25771484
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 25798528
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 25798528
A549 Cytotoxicity assay 48 h IC50 = 0.008 μM 25798528
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 25798528
SW480 Cytotoxicity assay 48 h IC50 = 0.008 μM 25798528
HL60 Cytotoxicity assay 72 h IC50 = 0.0018 μM 25819096
MOLT4 Cytotoxicity assay 72 h IC50 = 0.0022 μM 25819096
U937 Cytotoxicity assay 72 h IC50 = 0.0025 μM 25819096
HeLa Cytotoxicity assay 72 h IC50 = 0.0032 μM 25819096
DU145 Cytotoxicity assay 72 h IC50 = 0.0034 μM 25819096
A549 Cytotoxicity assay 72 h IC50 = 0.0044 μM 25819096
SGC7901 Cytotoxicity assay 72 h IC50 = 0.0051 μM 25819096
K562 Cytotoxicity assay 72 h IC50 = 0.0052 μM 25819096
MCF7 Cytotoxicity assay 72 h IC50 = 0.0062 μM 25819096
NCI-H1975 Cytotoxicity assay 72 h IC50 = 0.0077 μM 25819096
MX1 Cytotoxicity assay 72 h IC50 = 0.00559 μM 25819334
ID8 Cytotoxicity assay 72 h IC50 = 0.0138 μM 25819334
L1210 Cytotoxicity assay 72 h IC50 = 0.0276 μM 25819334
WI38 Cytotoxicity assay 72 h IC50 = 0.0557 μM 25819334
MDA-MB-231 Antiproliferative activity assay 48 h GI50 = 0.01 μM 25827522
A549 Antiproliferative activity assay 48 h GI50 = 0.01 μM 25827522
PANC1 Antiproliferative activity assay 48 h GI50 = 0.012 μM 25827522
HeLa Antiproliferative activity assay 48 h GI50 = 0.02 μM 25827522
HEK293 Cytotoxicity assay 72 h IC50 = 0.04 μM 25842364
SW480 Cytotoxicity assay 48 h IC50 = 0.008 μM 25871261
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 25871261
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 25871261
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 25871261
A549 Cytotoxicity assay 48 h IC50 = 0.008 μM 25871261
SCC114 Antiproliferative activity assay 72 h IC50 = 0.0003 μM 25872984
HeLa Antiproliferative activity assay 48 h IC50 = 0.0019 μM 25882519
MDA-MB-435 Antiproliferative activity assay 48 h IC50 = 0.0033 μM 25882519
SKOV3 Antiproliferative activity assay 48 h IC50 = 0.0063 μM 25882519
SKOV3-MDR1-M6/6 Antiproliferative activity assay 48 h IC50 = 1.1872 μM 25882519
A549 Antiproliferative activity assay 48 h IC50 = 0.0023 μM 25937236
taxol-resistant A549 Antiproliferative activity assay 48 h IC50 = 0.52 μM 25937236
EL4 Cytotoxicity assay 48 h IC50 = 1.7 μM 25951057
HeLa Antiproliferative activity assay 48 h IC50 = 0.38 μM 25959813
A549 Antiproliferative activity assay 48 h IC50 = 2.82 μM 25959813
LCC-6 Cytotoxicity assay 3 days IC50 = 0.0016 μM 25985195
MDA435/LCC6MDR Cytotoxicity assay 3 days IC50 = 0.1446 μM 25985195
A2780 Antiproliferative activity assay 2 days IC50 = 0.028 μM 26042470
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 26068802
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 26068802
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 26068802
A549 Cytotoxicity assay 48 h IC50 = 0.008 μM 26068802
SW480 Cytotoxicity assay 48 h IC50 = 0.008 μM 26068802
BEAS2B Cytotoxicity assay 48 h IC50 = 0.58 μM 26068802
NB4 Cytotoxicity assay 48 h IC50 = 0.0023 μM 26132075
NCI-H1975 Cytotoxicity assay 72 h IC50 = 0.0025 μM 26132075
OVCAR8 Cytotoxicity assay 48 h IC50 = 0.0037 μM 26132075
MESSA Cytotoxicity assay 72 h IC50 = 0.004 μM 26132075
MDA-MB-468 Cytotoxicity assay 72 h IC50 = 0.005 μM 26132075
A549 Cytotoxicity assay 72 h IC50 = 0.007 μM 26132075
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 0.007 μM 26132075
MDA-MB-436 Cytotoxicity assay 72 h IC50 = 0.008 μM 26132075
MESSA/DX5 Cytotoxicity assay 72 h IC50 = 1.764 μM 26132075
HepG2 Cytotoxicity assay 48 h IC50 = 2.6 μM 26132075
PC3 Cytotoxicity assay 48 h IC50 = 4.9 μM 26132075
NCI-ADR-RES Cytotoxicity assay 48 h IC50 = 6 μM 26132075
KB Antiproliferative activity assay 72 h IC50 = 0.0051 μM 26160020
KB-7d Antiproliferative activity assay 72 h IC50 = 0.0084 μM 26160020
KB-S15 Antiproliferative activity assay 72 h IC50 = 0.135 μM 26160020
DU145 Antiproliferative activity assay GI50 = 0.006 μM 26242242
KB Antiproliferative activity assay GI50 = 0.0064 μM 26242242
A549 Antiproliferative activity assay GI50 = 0.0076 μM 26242242
vincristine-resistant KBVIN Antiproliferative activity assay GI50 = 1.21 μM 26242242
K562 Cytotoxicity assay IC50 = 0.9 μM 26287401
U937 Cytotoxicity assay 72 h IC50 = 2.1 μM 26316467
A549 Cytotoxicity assay 72 h IC50 = 2.1 μM 26316467
MCF7 Cytotoxicity assay 72 h IC50 = 2.3 μM 26316467
MOLT4 Cytotoxicity assay 72 h IC50 = 2.7 μM 26316467
NCI-H1975 Cytotoxicity assay 72 h IC50 = 2.8 μM 26316467
HeLa Cytotoxicity assay 72 h IC50 = 2.9 μM 26316467
DU145 Cytotoxicity assay 72 h IC50 = 3.1 μM 26316467
K562 Cytotoxicity assay 72 h IC50 = 3.8 μM 26316467
HL60 Cytotoxicity assay 72 h IC50 = 3.8 μM 26316467
SGC7901 Cytotoxicity assay 72 h IC50 = 9.8 μM 26316467
MES-SA Cytotoxicity assay 48 h GI50 = 0.007 μM 26360047
Rhabdomyosarcoma Antiproliferative activity assay 96 h IC50 = 0.0084 μM 26386818
HT-29 Cytotoxicity assay 3 days IC50 = 0.0008 μM 26422131
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 0.001 μM 26448037
PC3 Cytotoxicity assay 72 h IC50 = 0.001 μM 26448037
HCT116 Cytotoxicity assay 48 h IC50 = 0.0028 μM 26448037
A549 Cytotoxicity assay IC50 = 0.0063 μM 26448037
HepG2 Cytotoxicity assay 48 h IC50 = 1.217 μM 26448037
H460 Cytotoxicity assay 48 h IC50 = 4.287 μM 26448037
cells after 48 hrs by SRB assay Cytotoxicity assay GI50 = 0.00148 μM 26462052
HeLa Antiproliferative activity assay 72 h IC50 = 2.29 μM 26602827
184B5 Antiproliferative activity assay 72 h IC50 = 2.32 μM 26602827
MDA-MB-231 Antiproliferative activity assay 72 h IC50 = 2.56 μM 26602827
MDA-MB-468 Antiproliferative activity assay 72 h IC50 = 3.87 μM 26602827
MCF7 Antiproliferative activity assay 72 h IC50 = 3.99 μM 26602827
Jurkat Cytotoxicity assay 48 h IC50 = 0.0005 μM 26638041
U937 Cytotoxicity assay 48 h IC50 = 0.006 μM 26638041
HeLa Cytotoxicity assay 48 h IC50 = 0.099 μM 26638041
cells assessed as cell growth inhibition after 48 hrs by MTT assay Cytotoxicity assay IC50 = 0.65 μM 26638041
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 0.0039 μM 26690274
MCF7 Cytotoxicity assay 72 h IC50 = 0.0074 μM 26690274
U937 Cytotoxicity assay 72 h IC50 = 0.00166 μM 26697718
HL60 Cytotoxicity assay 72 h IC50 = 0.00199 μM 26697718
A549 Cytotoxicity assay 72 h IC50 = 0.00212 μM 26697718
DU145 Cytotoxicity assay 72 h IC50 = 0.0023 μM 26697718
HeLa Cytotoxicity assay 72 h IC50 = 0.00301 μM 26697718
HT-29 Cytotoxicity assay 72 h IC50 = 0.00304 μM 26697718
K562 Cytotoxicity assay 72 h IC50 = 0.00717 μM 26697718
MCF7 Cytotoxicity assay 72 h IC50 = 0.00732 μM 26697718
NCI-H292 Cytotoxicity assay 72 h IC50 = 0.006 μM 26712098
KB Growth inhibition assay 72 h GI50 = 0.001 μM 26778612
DU145 Antiproliferative activity assay 48 h IC50 = 0.0038 μM 26785306
PC3 Antiproliferative activity assay 48 h IC50 = 0.02 μM 26785306
A549 Antiproliferative activity assay 3 days IC50 = 0.00003 μM 26865176
KB Antiproliferative activity assay 3 days IC50 = 0.00004 μM 26865176
MCF7 Antiproliferative activity assay 3 days IC50 = 0.0039 μM 26865176
MDA-MB-231 Antiproliferative activity assay 3 days IC50 = 0.018 μM 26865176
KBVIN Antiproliferative activity assay 3 days IC50 = 2.6 μM 26865176
PC3 Cytotoxicity assay 72 h IC50 = 0.002 μM 26904921
SKOV3 Cytotoxicity assay 72 h IC50 = 0.0047 μM 26974508
A549 Cytotoxicity assay 48 h IC50 = 0.0132 μM 26985296
SKMES1 Cytotoxicity assay 48 h IC50 = 0.0135 μM 26985296
HeLa Cytotoxicity assay 48 h IC50 = 0.0189 μM 26985296
WPMY-1 Cytotoxicity assay 48 h GI50 = 0.01 μM 26994690
A549 Antiproliferative activity assay 48 h GI50 = 0.01 μM 26994690
MDA-MB-231 Antiproliferative activity assay 48 h GI50 = 0.01 μM 26994690
HeLa Antiproliferative activity assay 48 h GI50 = 0.023 μM 26994690
HepG2 Antiproliferative activity assay 48 h IC50 = 0.02171 μM 27017265
MCF7 Antiproliferative activity assay 48 h IC50 = 0.02581 μM 27017265
HCT116 Antiproliferative activity assay 48 h IC50 = 0.06727 μM 27017265
A2780 Cytotoxicity assay 48 h IC50 = 0.005 μM 27149641
A549 Cytotoxicity assay 48 h IC50 = 0.009 μM 27149641
MCF7 Cytotoxicity assay 48 h IC50 = 0.012 μM 27149641
HCT8 Cytotoxicity assay 48 h IC50 = 0.019 μM 27149641
A549/CDDP Cytotoxicity assay 48 h IC50 = 0.023 μM 27149641
HCT8/VCT Cytotoxicity assay 48 h IC50 = 0.125 μM 27149641
MCF7/DX Cytotoxicity assay 48 h IC50 = 0.135 μM 27149641
A2780/TAX Cytotoxicity assay 48 h IC50 = 5.68 μM 27149641
HeLa Antiproliferative activity assay 48 h GI50 = 0.025 μM 27209232
MiaPaCa Antiproliferative activity assay 48 h GI50 = 0.056 μM 27209232
IMR32 Antiproliferative activity assay 48 h GI50 = 0.075 μM 27209232
MDA-MB-231 Antiproliferative activity assay 48 h GI50 = 0.091 μM 27209232
PC3 Antiproliferative activity assay 72 h IC50 = 0.002 μM 27214307
NCI-H1993 Antiproliferative activity assay 48 to 96 h GI50 = 0.004 μM 27218860
MES-SA Antiproliferative activity assay 48 to 96 h GI50 = 0.007 μM 27218860
NCI-H2073 Antiproliferative activity assay 48 to 96 h GI50 = 2.4 μM 27218860
KBVIN Antiproliferative activity assay 48 h GI50 = 2.6 μM 27238842
A549 Antiproliferative activity assay 48 h GI50 = 2.6 μM 27238842
MCF7 Cytotoxicity assay 72 h IC50 = 0.00125 μM 27311893
HeLa Cytotoxicity assay 72 h IC50 = 0.01262 μM 27311893
MDA-MB-231 Anticancer assay 72 h IC50 = 0.003388 μM 27317645
HeLa Anticancer assay 72 h IC50 = 0.01987 μM 27317645
HT-29 Cytotoxicity assay 72 h IC50 = 0.02 μM 27329938
PC3 Cytotoxicity assay 72 h IC50 = 0.03 μM 27329938
HL-7702 Cytotoxicity assay 72 h IC50 = 0.06 μM 27329938
A549 Cytotoxicity assay 72 h IC50 = 0.08 μM 27329938
HepG2 Cytotoxicity assay 72 h IC50 = 0.2 μM 27329938
MCF7 Cytotoxicity assay 96 h IC50 = 0.0002 μM 27434426
HeLa Cytotoxicity assay 96 h IC50 = 0.0064 μM 27434426
MCF7 Cytotoxicity assay IC50 = 0.0006 μM 27441892
HCT116 Cytotoxicity assay IC50 = 0.0009 μM 27441892
BGC823 Cytotoxicity assay IC50 = 0.0033 μM 27441892
HepG2 Cytotoxicity assay IC50 = 0.012 μM 27441892
Capan2 Cytotoxicity assay IC50 = 0.017 μM 27441892
A375 Cytotoxicity assay IC50 = 0.022 μM 27441892
A549 Cytotoxicity assay IC50 = 0.023 μM 27441892
A2780 Cytotoxicity assay IC50 = 0.038 μM 27441892
NCI-H1650 Cytotoxicity assay IC50 = 0.068 μM 27441892
NCI60 Cytotoxicity assay 48 h GI50 = 0.0315 μM 27448924
HepG2 Cytotoxicity assay 48 h IC50 = 0.006 μM 27627130
Hep3B Cytotoxicity assay 48 h IC50 = 0.02 μM 27627130
A549 Cytotoxicity assay 48 h IC50 = 0.03 μM 27627130
MCF7 Cytotoxicity assay 48 h IC50 = 0.06 μM 27627130
A549 Cytotoxicity assay 48 h IC50 = 0.008 μM 27704807
SW480 Cytotoxicity assay 48 h IC50 = 0.008 μM 27704807
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 27704807
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 27704807
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 27704807
HeLa Cytotoxicity assay 48 h IC50 = 0.008 μM 27704807
A549 Cytotoxicity assay 48 h IC50 = 0.02 μM 27704822
MCF7 Cytotoxicity assay 48 h IC50 = 0.1 μM 27704822
HeLa Cytotoxicity assay 72 h IC50 = 1.7 μM 27748595
K562 Cytotoxicity assay 72 h IC50 = 2.7 μM 27748595
HCT116 Cytotoxicity assay 72 h IC50 = 3.3 μM 27748595
A549 Cytotoxicity assay 72 h IC50 = 5.5 μM 27748595
HepG2 Cytotoxicity assay 72 h IC50 = 6.7 μM 27748595
HELF Cytotoxicity assay 24 h IC50 = 7.14 μM 27769031
BGC823 Cytotoxicity assay 24 h IC50 = 9.26 μM 27769031
KB Cytotoxicity assay 48 h IC50 = 0.0008 μM 27797192
A549 Cytotoxicity assay 48 h IC50 = 0.00099 μM 27797192
MDA-MB-231 Cytotoxicity assay 48 h IC50 = 0.00305 μM 27797192
MCF7 Cytotoxicity assay 48 h IC50 = 0.02275 μM 27797192
KBVIN Cytotoxicity assay 48 h IC50 = 1.896 μM 27797192
HCT116 Cytotoxicity assay 48 h IC50 = 0.1 μM 27887843
Bel7402 Cytotoxicity assay 48 h IC50 = 0.1 μM 27887843
OVCAR8 Growth inhibition assay 96 h IC50 = 5 μM 27894589
HeLa Growth inhibition assay 96 h IC50 = 5.3 μM 27894589
HeLa Growth inhibition assay 48 h GI50 = 0.0389 μM 27964883
MiaPaCa Growth inhibition assay 48 h GI50 = 0.06 μM 27964883
IMR32 Growth inhibition assay 48 h GI50 = 0.086 μM 27964883
MDA-MB-231 Growth inhibition assay 48 h GI50 = 0.092 μM 27964883
DU145 Antiproliferative activity assay 48 h IC50 = 0.011 μM 27979593
HeLa Antiproliferative activity assay 48 h IC50 = 0.036 μM 27979593
MCF7 Antiproliferative activity assay 48 h IC50 = 0.63 μM 27979593
ECA109 Antiproliferative activity assay 48 h IC50 = 0.94 μM 27979593
MDA-MB-435 Cytotoxicity assay 72 h IC50 = 0.0002 μM 27983842
HT-29 Cytotoxicity assay 72 h IC50 = 0.0008 μM 27983842
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 0.0027 μM 27983842
OVCAR3 Cytotoxicity assay 72 h IC50 = 0.0033 μM 27983842
H1299 Cytotoxicity assay 24 h IC50 = 1.5 μM 27983842
HEK-Blue Function assay 3 h IC50 = 7.94328 μM 28075581
A549 Antiproliferative activity assay 72 h IC50 = 0.0062 μM 28099003
KB Antiproliferative activity assay 72 h IC50 = 0.00627 μM 28099003
MDA-MB-231 Antiproliferative activity assay 72 h IC50 = 0.00882 μM 28099003
MCF7 Antiproliferative activity assay 72 h IC50 = 0.0104 μM 28099003
KBVIN Antiproliferative activity assay 72 h IC50 = 1.926 μM 28099003
MDA-MB-435 Antiproliferative activity assay GI50 = 0.001 μM 28112516
A549 Cytotoxicity assay 48 h IC50 = 6.195 μM 28237662
KB Cytotoxicity assay 48 h IC50 = 6.587 μM 28237662
MDA-MB-231 Cytotoxicity assay 48 h IC50 = 9.384 μM 28237662
HeLa Cytotoxicity assay 72 h IC50 = 0.0014 μM 28240909
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 0.0026 μM 28252962
MDA-MB-435 Cytotoxicity assay 72 h IC50 = 0.0031 μM 28252962
OVCAR3 Cytotoxicity assay 72 h IC50 = 0.0075 μM 28252962
MDA-MB-231 Cytotoxicity assay 48 h IC50 = 0.08 μM 28262526
HepG2 Cytotoxicity assay IC50 = 0.3 μM 28262527
Hep3B Cytotoxicity assay IC50 = 0.73 μM 28262527
MRC5 Cytotoxicity assay 72 h IC50 = 0.00052 μM 28282127
A549 Antiproliferative activity assay 72 h IC50 = 0.0062 μM 28290698
KB Antiproliferative activity assay 72 h IC50 = 0.0063 μM 28290698
MDA-MB-231 Antiproliferative activity assay 72 h IC50 = 0.0088 μM 28290698
MCF7 Antiproliferative activity assay 72 h IC50 = 0.0104 μM 28290698
KBVIN Antiproliferative activity assay 72 h IC50 = 1.926 μM 28290698
PC3 Antiproliferative activity assay 72 h IC50 = 0.004 μM 28335606
UACC62 Antiproliferative activity assay 72 h IC50 = 0.006 μM 28335606
M14 Antiproliferative activity assay 72 h IC50 = 0.007 μM 28335606
SK-MEL-2 Antiproliferative activity assay 72 h IC50 = 0.009 μM 28335606
NCI-H460 Antiproliferative activity assay 72 h IC50 = 0.01 μM 28335606
A375 Antiproliferative activity assay 72 h IC50 = 0.01 μM 28335606
SF295 Antiproliferative activity assay 72 h IC50 = 0.056 μM 28335606
ACHN Antiproliferative activity assay 72 h IC50 = 0.066 μM 28335606
HeLa Cytotoxicity assay 48 h IC50 = 0.00821 μM 28340411
A549 Cytotoxicity assay 48 h IC50 = 0.00952 μM 28340411
A549/TR Cytotoxicity assay 48 h IC50 = 1.51 μM 28340411
HeLa/TR Cytotoxicity assay 48 h IC50 = 1.53 μM 28340411
LO2 Cytotoxicity assay 72 h IC50 = 0.002 μM 28395199
A549 Antiproliferative activity assay 72 h IC50 = 0.023 μM 28395199
HT-29 Antiproliferative activity assay 72 h IC50 = 0.025 μM 28395199
NCI-H596 Antiproliferative activity assay 72 h IC50 = 0.035 μM 28395199
HT-29 Cytotoxicity assay 3 days IC50 = 0.0014 μM 28409637
HeLa Antiproliferative activity assay 48 h IC50 = 0.0015 μM 28433513
MDA-MB-435 Antiproliferative activity assay 48 h IC50 = 0.002 μM 28433513
SKOV3 Antiproliferative activity assay 48 h IC50 = 0.003 μM 28433513
SKOV3-MDR1-M6/6 Antiproliferative activity assay 48 h IC50 = 2.33 μM 28433513
KB Antiproliferative activity assay IC50 = 0.0059 μM 28457756
A549 Antiproliferative activity assay IC50 = 0.00685 μM 28457756
MDA-MB-231 Antiproliferative activity assay IC50 = 0.00963 μM 28457756
MCF7 Antiproliferative activity assay IC50 = 0.01146 μM 28457756
KBVIN Antiproliferative activity assay IC50 = 2.035 μM 28457756
A2780 Antiproliferative activity assay 2 days IC50 = 0.028 μM 28463001
BGC823 Cytotoxicity assay 96 h IC50 = 0.0008 μM 28530828
NCI-H460 Cytotoxicity assay 96 h IC50 = 0.001 μM 28530828
HepG2 Cytotoxicity assay 96 h IC50 = 0.0063 μM 28530828
OVPF008 Antiproliferative activity assay 6 days IC50 = 1.1 μM 28548825
OVPF038 Antiproliferative activity assay 6 days IC50 = 1.4 μM 28548825
KB Cytotoxicity assay 72 h IC50 = 0.0036 μM 28590124
KBv200 Cytotoxicity assay 72 h IC50 = 2.117 μM 28590124
MDA-MB-435 Cytotoxicity assay 72 h IC50 = 0.0005 μM 28594169
OVCAR3 Cytotoxicity assay 72 h IC50 = 0.002 μM 28594169
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 0.009 μM 28594169
U937 Cytotoxicity assay 72 h IC50 = 0.0017 μM 28598633
HL60 Cytotoxicity assay 72 h IC50 = 0.002 μM 28598633
A549 Cytotoxicity assay 72 h IC50 = 0.0021 μM 28598633
DU145 Cytotoxicity assay 72 h IC50 = 0.0023 μM 28598633
HeLa Cytotoxicity assay 72 h IC50 = 0.003 μM 28598633
HT-29 Cytotoxicity assay 72 h IC50 = 0.003 μM 28598633
K562 Cytotoxicity assay 72 h IC50 = 0.0072 μM 28598633
MCF7 Cytotoxicity assay 72 h IC50 = 0.0073 μM 28598633
A2780 Cytotoxicity assay 48 h IC50 = 0.00107 μM 28624703
HeLa Cytotoxicity assay 48 h IC50 = 0.0011 μM 28624703
KB Cytotoxicity assay 48 h IC50 = 0.0019 μM 28624703
Hela-beta3 Cytotoxicity assay 48 h IC50 = 0.009 μM 28624703
A2780AD Cytotoxicity assay 48 h IC50 = 1.282 μM 28624703
KBV1 Cytotoxicity assay 48 h IC50 = 9.8 μM 28624703
BGC823 Growth inhibition assay 3 days IC50 = 0.001 μM 28625363
HepG2 Growth inhibition assay 3 days IC50 = 0.02 μM 28625363
HCT116 Growth inhibition assay 3 days IC50 = 0.03 μM 28625363
A2780 Growth inhibition assay 3 days IC50 = 0.03 μM 28625363
NCI-H1650 Growth inhibition assay 3 days IC50 = 0.07 μM 28625363
A2780 Antiproliferative activity assay 2 days IC50 = 0.0137 μM 28648491
KB Cytotoxicity assay 48 h GI50 = 0.00512 μM 28653846
A549 Cytotoxicity assay 48 h GI50 = 0.00703 μM 28653846
MDA-MB-231 Cytotoxicity assay 48 h GI50 = 0.01 μM 28653846
MCF7 Cytotoxicity assay 48 h GI50 = 0.0119 μM 28653846
KBVIN Cytotoxicity assay 48 h GI50 = 2.716 μM 28653846
MCF7 Antiproliferative activity assay 48 h IC50 = 0.008 μM 28654256
HL60 Antiproliferative activity assay 48 h IC50 = 0.008 μM 28654256
SMMC7721 Antiproliferative activity assay 48 h IC50 = 0.008 μM 28654256
A549 Antiproliferative activity assay 48 h IC50 = 0.008 μM 28654256
SW480 Antiproliferative activity assay 48 h IC50 = 0.008 μM 28654256
A375 Antiproliferative activity assay 48 h IC50 = 0.7 μM 28667872
MIAPaCa2 Antiproliferative activity assay 48 h IC50 = 2.5 μM 28667872
HEY Cytotoxicity assay 48 h IC50 = 0.1041 μM 28719204
A2780 Cytotoxicity assay 48 h IC50 = 0.1642 μM 28719204
HCT116 Growth inhibition assay 96 h IC50 = 0.0002 μM 28737396
BGC823 Growth inhibition assay 96 h IC50 = 0.0006 μM 28737396
HepG2 Growth inhibition assay 96 h IC50 = 0.0076 μM 28737396
A2780 Growth inhibition assay 96 h IC50 = 0.0204 μM 28737396
A549 Growth inhibition assay 4 days GI50 = 0.0037 μM 28740601
PC3 Growth inhibition assay 4 days GI50 = 0.0058 μM 28740601
NCI-H460 Cytotoxicity assay 72 h IC50 = 0.006 μM 28740613
HT-29 Cytotoxicity assay 72 h IC50 = 0.014 μM 28740613
A2780S Antiproliferative activity assay 48 h IC50 = 0.0123 μM 28763646
HCT8 Antiproliferative activity assay 48 h IC50 = 0.0174 μM 28763646
HCT8/T Antiproliferative activity assay 48 h IC50 = 9.885 μM 28763646
A549 Cytotoxicity assay 24 h IC50 = 0.0041 μM 28835794
1A9 Cytotoxicity assay IC50 = 0.00371 μM 28850227
LNCAP Antiproliferative activity assay 72 h IC50 = 0.0019 μM 28857558
PA1 Antiproliferative activity assay 72 h IC50 = 0.003 μM 28857558
HCT116 Antiproliferative activity assay 72 h IC50 = 0.0041 μM 28857558
MDA-MB-468 Antiproliferative activity assay 72 h IC50 = 0.0054 μM 28857558
HCT116/VP35 Antiproliferative activity assay 72 h IC50 = 0.0063 μM 28857558
NCI-H520 Antiproliferative activity assay 72 h IC50 = 0.0082 μM 28857558
LS174T Antiproliferative activity assay 72 h IC50 = 0.0095 μM 28857558
MCF10A Cytotoxicity assay 72 h IC50 = 0.0058 μM 28926237
MDA-MB-468 Cytotoxicity assay 72 h IC50 = 0.0061 μM 28926237
MCF7 Cytotoxicity assay 72 h IC50 = 0.0088 μM 28926237
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 0.059 μM 28926237
HeLa Cytotoxicity assay 72 h IC50 = 0.001 μM 29043798
A2780 Cytotoxicity assay 2 days IC50 = 0.013 μM 29048892
A549 Cytotoxicity assay 72 h IC50 = 0.0062 μM 29131631
KB Cytotoxicity assay 72 h IC50 = 0.0066 μM 29131631
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 0.0094 μM 29131631
MCF7 Cytotoxicity assay 72 h IC50 = 0.0114 μM 29131631
KBVIN Cytotoxicity assay 72 h IC50 = 1.86 μM 29131631
A2780 Function assay 48 h GI50 = 0.00753 μM 29138028
OVCAR5 Function assay 48 h GI50 = 0.021 μM 29138028
HCT116 Antiproliferative activity assay 48 h IC50 = 1.37 μM 29172082
PC3 Antiproliferative activity assay 48 h IC50 = 4.57 μM 29172082
HeLa Antiproliferative activity assay 48 h IC50 = 6.42 μM 29172082
H1299 Antiproliferative activity assay 48 h IC50 = 7.83 μM 29172082
HCT116 Antiproliferative activity assay 48 h IC50 = 0.014 μM 29223717
MCF7 Antiproliferative activity assay 48 h IC50 = 1.428 μM 29223717
143B Antiproliferative activity assay 48 h IC50 = 5.56 μM 29223717
MES-SA/Dx5 Growth inhibition assay 72 h IC50 = 0.21 μM 29251920
MDA435/LCC6 Growth inhibition assay 72 h IC50 = 0.346 μM 29251920
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 29286250
A549 Cytotoxicity assay 48 h IC50 = 0.008 μM 29286250
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 29286250
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 29286250
SW480 Cytotoxicity assay 48 h IC50 = 0.008 μM 29286250
A2780 Antiproliferative activity assay 48 h IC50 = 0.001 μM 29306206
SKOV3 Antiproliferative activity assay 48 h IC50 = 0.002 μM 29306206
HeLa Antiproliferative activity assay 48 h IC50 = 0.003 μM 29306206
MDA-MB-231 Antiproliferative activity assay 48 h IC50 = 0.003 μM 29306206
KB Antiproliferative activity assay 72 h IC50 = 0.0036 μM 29319316
A549 Antiproliferative activity assay 72 h IC50 = 0.0045 μM 29319316
MDA-MB-231 Antiproliferative activity assay 72 h IC50 = 0.007 μM 29319316
MCF7 Antiproliferative activity assay 72 h IC50 = 0.0088 μM 29319316
KBVIN Antiproliferative activity assay 72 h IC50 = 2.36 μM 29319316
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 29338226
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 29338226
A549 Cytotoxicity assay 48 h IC50 = 0.008 μM 29338226
SW480 Cytotoxicity assay 48 h IC50 = 0.008 μM 29338226
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 29338226
SMMC7721 Cytotoxicity assay 48 h IC50 = 0.008 μM 29338260
A549 Cytotoxicity assay 48 h IC50 = 0.008 μM 29338260
MCF7 Cytotoxicity assay 48 h IC50 = 0.008 μM 29338260
SW480 Cytotoxicity assay 48 h IC50 = 0.008 μM 29338260
HL60 Cytotoxicity assay 48 h IC50 = 0.008 μM 29338260
HT-29 Cytotoxicity assay 72 h IC50 = 0.0008 μM 29350920
HeLa Cytotoxicity assay 48 h IC50 = 0.0046 μM 29359935
A2780 Cytotoxicity assay 48 h IC50 = 0.0134 μM 29359935
Hela-beta3 Cytotoxicity assay 48 h IC50 = 0.041 μM 29359935
HL60 Cytotoxicity assay 48 h IC50 = 0.002 μM 29373791
LS180 Cytotoxicity assay 48 h IC50 = 0.0028 μM 29373791
MDA-MB-231 Cytotoxicity assay 48 h IC50 = 0.003 μM 29373791
A549 Cytotoxicity assay 48 h IC50 = 0.0068 μM 29373791
HCT116 Cytotoxicity assay 24 h IC50 = 0.02 μM 29395979
SW480 Cytotoxicity assay 24 h IC50 = 0.19 μM 29395979
T98G Cytotoxicity assay 24 h IC50 = 0.74 μM 29395979
U87 Cytotoxicity assay 24 h IC50 = 4.67 μM 29395979
DU145 Cytotoxicity assay 72 h IC50 = 0.0011 μM 29406710
PC3 Cytotoxicity assay 72 h IC50 = 0.0037 μM 29406710
PC3-TxR Cytotoxicity assay 72 h IC50 = 0.1107 μM 29406710
ViBo Antiproliferative activity assay 24 h IC50 = 1.59 μM 29407986
CaSki Antiproliferative activity assay 24 h IC50 = 2.9 μM 29407986
A549 Growth inhibition assay 48 h IC50 = 0.008 μM 29412669
HL60 Growth inhibition assay 48 h IC50 = 0.008 μM 29412669
MCF7 Growth inhibition assay 48 h IC50 = 0.008 μM 29412669
SMMC7721 Growth inhibition assay 48 h IC50 = 0.008 μM 29412669
SW480 Growth inhibition assay 48 h IC50 = 0.008 μM 29412669
HCT116 Growth inhibition assay 72 h IC50 = 0.0041 μM 29439899
A549 Growth inhibition assay IC50 = 0.0071 μM 29439899
A549-T24 Growth inhibition assay IC50 = 0.07 μM 29439899
HCT116 Cytotoxicity assay IC50 = 0.0338 μM 29468872
paclitaxel-resistant MCF7 Cytotoxicity assay 72 h IC50 = 2.29087 μM 29468872
HL60 Antiproliferative activity assay 48 h IC50 = 0.0026 μM 29475587
HeLa Antiproliferative activity assay 48 h IC50 = 0.023 μM 29475587
293T Cytotoxicity assay 4 days IC50 = 0.0023 μM 29486949
HAC Cytotoxicity assay 4 days IC50 = 0.0121 μM 29486949
KB-3-1 Cytotoxicity assay 72 h IC50 = 0.0005 μM 29501942
SW620 Cytotoxicity assay 72 h IC50 = 0.03 μM 29501942
KB-C2 Cytotoxicity assay 72 h IC50 = 0.25 μM 29501942
SW620/AD300 Cytotoxicity assay 72 h IC50 = 1.97 μM 29501942
A549 Antiproliferative activity assay 72 h IC50 = 0.007 μM 29501947
A549/TR Antiproliferative activity assay 72 h IC50 = 3.112 μM 29501947
SKOV3 Cytotoxicity assay 72 to 120 h IC50 = 0.00239 μM 29517223
HEY Cytotoxicity assay 72 to 120 h IC50 = 2.7 μM 29517223
SKVLB1 Function assay 72 to 120 h IC50 = 3.733 μM 29517223
A2780cis Growth inhibition assay 72 h IC50 = 0.003 μM 29519737
A2780 Growth inhibition assay 72 h IC50 = 0.009 μM 29519737
OVCAR8 Growth inhibition assay 72 h IC50 = 0.01 μM 29519737
ovarian epithelial Growth inhibition assay 48 h IC50 = 0.03 μM 29519737
MCF7 Cytotoxicity assay 72 h IC50 = 0.0024 μM 29648818
PC9 Cytotoxicity assay 72 h IC50 = 0.0027 μM 29648818
A549 Cytotoxicity assay 72 h IC50 = 0.0032 μM 29648818
HCC2998 Growth inhibition assay 48 h GI50 = 0.001 μM 29655610
HeLa Antiproliferative activity assay IC50 = 0.0016 μM 29655610
SKOV3 Antiproliferative activity assay IC50 = 0.003 μM 29655610
NCI-H226 Growth inhibition assay 48 h GI50 = 0.0039 μM 29655610
SW620 Growth inhibition assay 48 h GI50 = 0.004 μM 29655610
OVCAR3 Growth inhibition assay 48 h GI50 = 0.004 μM 29655610
MCF7 Growth inhibition assay 48 h GI50 = 0.004 μM 29655610
HL-60(TB) Growth inhibition assay 48 h GI50 = 0.004 μM 29655610
HCT116 Growth inhibition assay 48 h GI50 = 0.004 μM 29655610
MDA-MB-435 Growth inhibition assay 48 h GI50 = 0.004 μM 29655610
BT549 Growth inhibition assay 48 h GI50 = 0.004 μM 29655610
SF539 Growth inhibition assay 48 h GI50 = 0.005 μM 29655610
KM12 Growth inhibition assay 48 h GI50 = 0.005 μM 29655610
UACC62 Growth inhibition assay 48 h GI50 = 0.005 μM 29655610
LOXIMVI Growth inhibition assay 48 h GI50 = 0.005 μM 29655610
M14 Growth inhibition assay 48 h GI50 = 0.005 μM 29655610
SF268 Growth inhibition assay 48 h GI50 = 0.005 μM 29655610
MOLT4 Growth inhibition assay 48 h GI50 = 0.005 μM 29655610
HT-29 Growth inhibition assay 48 h GI50 = 0.005 μM 29655610
Hs578T Growth inhibition assay 48 h GI50 = 0.005 μM 29655610
SK-MEL-5 Growth inhibition assay 48 h GI50 = 0.005 μM 29655610
CCRF-CEM Growth inhibition assay 48 h GI50 = 0.005 μM 29655610
NCI-H23 Growth inhibition assay 48 h GI50 = 0.0063 μM 29655610
U251 Growth inhibition assay 48 h GI50 = 0.0063 μM 29655610
SN12C Growth inhibition assay 48 h GI50 = 0.0063 μM 29655610
IGROV1 Growth inhibition assay 48 h GI50 = 0.0063 μM 29655610
A549/ATCC Growth inhibition assay 48 h GI50 = 0.0063 μM 29655610
PC3 Growth inhibition assay 48 h GI50 = 0.0063 μM 29655610
DU145 Growth inhibition assay 48 h GI50 = 0.0063 μM 29655610
NCI-H460 Growth inhibition assay 48 h GI50 = 0.0063 μM 29655610
K562 Growth inhibition assay 48 h GI50 = 0.0063 μM 29655610
SR Growth inhibition assay 48 h GI50 = 0.0063 μM 29655610
SNB75 Growth inhibition assay 48 h GI50 = 0.0079 μM 29655610
A498 Growth inhibition assay 48 h GI50 = 0.0079 μM 29655610
COLO205 Growth inhibition assay 48 h GI50 = 0.0079 μM 29655610
OVCAR5 Growth inhibition assay 48 h GI50 = 0.0079 μM 29655610
OVCAR8 Growth inhibition assay 48 h GI50 = 0.0079 μM 29655610
SNB19 Growth inhibition assay 48 h GI50 = 0.01 μM 29655610
NCI-H322M Growth inhibition assay 48 h GI50 = 0.0125 μM 29655610
MDA-MB-468 Growth inhibition assay 48 h GI50 = 0.0125 μM 29655610
MDA-MB-231 Growth inhibition assay 48 h GI50 = 0.0125 μM 29655610
RXF393 Growth inhibition assay 48 h GI50 = 0.0158 μM 29655610
NCI-H522 Growth inhibition assay 48 h GI50 = 0.0158 μM 29655610
HOP62 Growth inhibition assay 48 h GI50 = 0.019 μM 29655610
TK10 Growth inhibition assay 48 h GI50 = 0.0199 μM 29655610
RPMI8226 Growth inhibition assay 48 h GI50 = 0.0199 μM 29655610
HOP92 Growth inhibition assay 48 h GI50 = 0.025 μM 29655610
SF295 Growth inhibition assay 48 h GI50 = 0.025 μM 29655610
786-0 Growth inhibition assay 48 h GI50 = 0.039 μM 29655610
MALME-3M Growth inhibition assay 48 h GI50 = 0.05 μM 29655610
EKVX Growth inhibition assay 48 h GI50 = 0.079 μM 29655610
UO31 Growth inhibition assay 48 h GI50 = 0.125 μM 29655610
HCT15 Growth inhibition assay 48 h GI50 = 0.125 μM 29655610
ACHN Growth inhibition assay 48 h GI50 = 0.158 μM 29655610
Caki1 Growth inhibition assay 48 h GI50 = 0.158 μM 29655610
SK-MEL-28 Growth inhibition assay 48 h GI50 = 0.4 μM 29655610
SK-MEL-2 Growth inhibition assay 48 h GI50 = 0.4 μM 29655610
NCI/ADR-RES Growth inhibition assay 48 h GI50 = 0.63 μM 29655610
OVCAR4 Growth inhibition assay 48 h GI50 = 0.63 μM 29655610
SKOV3-MDR1-M6/6 Antiproliferative activity assay IC50 = 2.6 μM 29655610
SKHEP1 Growth inhibition assay 48 h GI50 = 0.011 μM 29655982
PC3 Growth inhibition assay 48 h GI50 = 0.013 μM 29655982
HT-29 Cytotoxicity assay 24 to 72 h IC50 = 0.011 μM 29656990
OVCAR3 Cytotoxicity assay 24 to 72 h IC50 = 0.011 μM 29656990
OVCAR8 Growth inhibition assay 96 h IC50 = 0.004 μM 29730191
MCF7 Growth inhibition assay 96 h IC50 = 0.0055 μM 29730191
HepG2 Growth inhibition assay 48 h IC50 = 2.66 μM 29730191
NCI/ADR-RES Growth inhibition assay 96 h IC50 = 3.1 μM 29730191
A2780 Cytotoxicity assay 2 days IC50 = 0.013 μM 29738243
A2780S Antiproliferative activity assay 48 to 72 h IC50 = 0.01894 μM 29754076
A549 Antiproliferative activity assay 48 to 72 h IC50 = 0.02318 μM 29754076
A549/TR Antiproliferative activity assay 48 to 72 h IC50 = 0.75939 μM 29754076
MCF7 Cytotoxicity assay 48 h IC50 = 0.005 μM 29759727
MIAPaCa2 Cytotoxicity assay 48 h IC50 = 0.006 μM 29759727
PC3 Cytotoxicity assay 48 h IC50 = 0.007 μM 29759727
HeLaS3 Antiproliferative activity assay 72 h IC50 = 0.013 μM 29803003
KBVIN Antiproliferative activity assay 72 h IC50 = 1.01 μM 29803003
MCF7 Cytotoxicity assay 4 days IC50 = 0.008 μM 29884535
HL60 Cytotoxicity assay 4 days IC50 = 0.008 μM 29884535
SMMC7721 Cytotoxicity assay 4 days IC50 = 0.008 μM 29884535
A549 Cytotoxicity assay 4 days IC50 = 0.008 μM 29884535
SW480 Cytotoxicity assay 4 days IC50 = 0.008 μM 29884535
A549 Antiproliferative activity assay 72 h IC50 = 0.0063 μM 30010341
KB Antiproliferative activity assay 72 h IC50 = 0.0068 μM 30010341
MDA-MB-231 Antiproliferative activity assay 72 h IC50 = 0.0081 μM 30010341
MCF7 Antiproliferative activity assay 72 h IC50 = 0.0112 μM 30010341
KBVIN Antiproliferative activity assay 72 h IC50 = 2.786 μM 30010341
MCF7 Cytotoxicity assay 72 h IC50 = 0.0096 μM 30036834
KB Cytotoxicity assay 72 h IC50 = 0.0103 μM 30036834
KB/VCR Cytotoxicity assay 72 h IC50 = 4 μM 30036834
HT-29 Cytotoxicity assay 72 h IC50 = 0.009 μM 30057155
MDA-MB-435 Cytotoxicity assay 72 h IC50 = 0.013 μM 30057155
OVCAR3 Cytotoxicity assay 72 h IC50 = 0.013 μM 30057155
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 0.017 μM 30057155
HeLa Antiproliferative activity assay 72 h IC50 = 0.0028 μM 30098869
MDA-MB-435 Antiproliferative activity assay 72 h IC50 = 0.0045 μM 30098869
SKOV3 Antiproliferative activity assay 72 h IC50 = 0.005 μM 30098869
wild-type Hela-beta3 Antiproliferative activity assay 72 h IC50 = 0.024 μM 30098869
SKOV3-MDR1-M6/6 Antiproliferative activity assay 72 h IC50 = 1.2 μM 30098869
A375 Antiproliferative activity assay 72 h IC50 = 0.0478 μM 30099258
KB Antiproliferative activity assay 72 h IC50 = 0.00571 μM 30106296
MCF7 Antiproliferative activity assay 72 h IC50 = 0.00752 μM 30106296
MDA-MB-231 Antiproliferative activity assay 72 h IC50 = 0.00851 μM 30106296
A549 Antiproliferative activity assay 72 h IC50 = 0.00876 μM 30106296
KBVIN Antiproliferative activity assay 72 h IC50 = 2.383 μM 30106296
PC3 Cytotoxicity assay 72 h IC50 = 0.0011 μM 30122035
DU145 Cytotoxicity assay 72 h IC50 = 0.0015 μM 30122035
PC3-TxR Cytotoxicity assay 72 h IC50 = 0.1139 μM 30122035
KB Antiproliferative activity assay 72 h IC50 = 5.9 μM 30189396
A549 Antiproliferative activity assay 72 h IC50 = 6.8 μM 30189396
MDA-MB-231 Antiproliferative activity assay 72 h IC50 = 9.6 μM 30189396
MDA-MB-231 Cytotoxicity assay 72 h IC50 = 0.0026 μM 30192537
MDA-MB-435 Cytotoxicity assay 72 h IC50 = 0.0031 μM 30192537
OVCAR3 Cytotoxicity assay 72 h IC50 = 0.0075 μM 30192537
MV411 Antiproliferative activity assay 72 h IC50 = 0.017 μM 30212198
HGC27 Antiproliferative activity assay 72 h IC50 = 0.028 μM 30212198
HeLa Antiproliferative activity assay 72 h IC50 = 0.046 μM 30212198
A549 Antiproliferative activity assay 72 h IC50 = 0.051 μM 30212198
HeLa Antiproliferative activity assay 48 h IC50 = 0.0028 μM 30297118
SKOV3 Antiproliferative activity assay 48 h IC50 = 0.005 μM 30297118
SKOV3-MDR1-M6/6 Antiproliferative activity assay 48 h IC50 = 1.2 μM 30297118
HCC1806 Antiproliferative activity assay 24 h IC50 = 0.001 μM 30392953
BEAS2B Antiproliferative activity assay 24 h IC50 = 0.007 μM 30392953
HT-29 Antiproliferative activity assay 24 h IC50 = 0.008 μM 30392953
HepG2 Antiproliferative activity assay 24 h IC50 = 0.009 μM 30392953
PANC1 Antiproliferative activity assay 24 h IC50 = 0.04 μM 30392953
MDA-MB-231 Cytotoxicity assay 48 h IC50 = 0.004 μM 30433783
A549 Cytotoxicity assay 48 h IC50 = 0.004 μM 30433783
PANC1 Cytotoxicity assay 48 h IC50 = 0.06 μM 30433783
4T1 Cytotoxicity assay 48 h IC50 = 0.094 μM 30433783
A375 Cytotoxicity assay 48 h IC50 = 0.1 μM 30433783
LLC Cytotoxicity assay 48 h IC50 = 0.189 μM 30433783
B16F10 Cytotoxicity assay 48 h IC50 = 0.53 μM 30433783
B16F10 spheroid Cytotoxicity assay 48 h IC50 = 8.01 μM 30433783
클릭하여 더 많은 세포주 실험 데이터 보기

화학 정보, 보관 및 안정성

분자량 853.91 화학식

C47H51NO14

 보관 (수령일로부터)
CAS 번호 33069-62-4 SDF 다운로드 원액 보관

동의어 NSC 125973，PTX Smiles CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)OC(=O)C

용해도

In vitro
배치:

DMSO : 100 mg/mL (117.1 mM)
(수분으로 오염된 DMSO는 용해도를 감소시킬 수 있습니다. 신선하고 무수 DMSO를 사용하십시오.)

Ethanol : 23 mg/mL

Water : Insoluble

몰농도 계산기

질량 농도 부피 분자량
희석 계산기 분자량 계산기

In vivo
배치:

생체 내 제형 계산기 (투명한 용액)

1단계: 아래 정보 입력 (권장: 실험 중 손실을 고려하여 추가 동물 포함)

mg/kg g μL

2단계: 생체 내 제형 입력 (이것은 계산기일 뿐 제형이 아닙니다. 용해도 섹션에 생체 내 제형이 없는 경우 먼저 당사에 문의하십시오.)

% DMSO % % Tween 80 % ddH2O
%DMSO %

계산 결과:

작업 농도: mg/ml;

DMSO 원액 준비 방법: mg 약물 사전 용해 μL DMSO ( 원액 농도 mg/mL, 농도가 해당 약물 배치의 DMSO 용해도를 초과하는 경우 먼저 당사에 문의하십시오. )

생체 내 제형 준비 방법: 취하다 μL DMSO 원액, 다음 추가μL PEG300, 혼합하고 투명하게 한 다음 추가μL Tween 80, 혼합하고 투명하게 한 다음 추가 μL ddH2O, 혼합하고 투명하게 합니다.

생체 내 제형 준비 방법: 취하다 μL DMSO 원액, 다음 추가 μL 옥수수 기름, 혼합하고 투명하게 합니다.

참고: 1. 다음 용매를 추가하기 전에 액체가 투명한지 확인하십시오.
2. 용매를 순서대로 추가해야 합니다. 다음 용매를 추가하기 전에 이전 추가에서 얻은 용액이 투명한 용액인지 확인해야 합니다. 와동, 초음파 또는 뜨거운 물 중탕과 같은 물리적 방법을 사용하여 용해를 도울 수 있습니다.

작용 메커니즘

Targets/IC50/Ki
Microtubule (human endothelial cells)
0.1 pM
시험관 내(In vitro)

Paclitaxel은 1 nM-10 nM의 IC50으로 104에서 105배 더 높은 농도에서 비내피형 인간 세포를 억제합니다. 이 화합물의 세포 증식 억제 선택성은 종 특이적이며, 마우스 EC는 초저농도에서 이 화학 물질에 민감하지 않습니다. 초저농도에서 이 화합물에 의한 인간 EC의 억제는 세포 microtubule 구조에 영향을 미치지 않으며, 처리된 세포는 G2/M 세포 주기 정지 및 세포 사멸을 보이지 않아 새롭지만 아직 확인되지 않은 작용 메커니즘을 시사합니다. 시험관 내 혈관 신생 분석에서, 이 화학 물질은 초저농도에서 인간 EC가 3차원 피브린 매트릭스에서 새싹과 튜브를 형성하는 것을 차단합니다. SMF 존재 시 K562 세포에 대한 이 화합물의 유효 농도는 50에서 10 ng/mL로 감소합니다. SMF 유무에 관계없이 K562 세포에 대한 이 화학 물질의 세포 주기 정지 효과는 DNA 손상과 관련이 있습니다. 이 화합물 단독으로 A549 세포, H358, H1395 세포 및 H1666 세포를 포함한 4개 세포주에서 CDK1의 시간 의존적 억제를 유발합니다.

생체 내(In vivo)

Paclitaxel 단독의 BC-V 및 BC-ER 종양에 대한 억제율은 각각 49.78% 및 51.23%입니다. 이 화합물 20 mg/kg을 6회 투여하면 BC-V 종양에서 Ki-67 양성 세포 비율이 20.4%로, BC-ER 종양에서 25.1%로 유의하게 감소합니다.

참조
  • [4] https://pubmed.ncbi.nlm.nih.gov/22374518/
  • [5] https://pubmed.ncbi.nlm.nih.gov/15015572/

적용 분야

방법 바이오마커 이미지 PMID
Western blot p-ERK / ERK MARCKS (pSer159/163) Src (pTyr416) p-JAK2 / p-STAT3 / p-AKT / p-MAPK / Bcl-xl / MCL-1 Id1 MARCKS
S1150-WB2
20068074
Growth inhibition assay Cell viability
S1150-viability1
28823711
Immunofluorescence α-tubulin Rab11a/BV9
S1150-IF1
22904633

임상시험 정보

(데이터 출처 https://clinicaltrials.gov, 업데이트 날짜 2024-05-22)

NCT 번호 모집 조건 스폰서/협력자 시작일 단계
NCT05312372 Withdrawn
Esophageal Squamous Cell Carcinoma
Institut de Recherches Internationales Servier|ADIR a Servier Group company|Servier
 May 2025 Phase 1|Phase 2
NCT04715542 Not yet recruiting
Chemotherapy Induced Peripheral Neuropathy (CIPN)
University of Bern|Insel Gruppe AG University Hospital Bern|Hospital of Thun|Tumor- und Brustzentrum ZeTuP St.Gallen|Gesundheitszentrum Fricktal AG|Kantonsspital Winterthur KSW|Kantonsspital Graubünden|Kantonsspital Aarau
 August 2024 Phase 3
NCT06387901 Not yet recruiting
Breast Cancer|Paclitaxel Adverse Reaction|Chemotherapeutic Toxicity|Chemotherapeutic Agent Toxicity|Body Weight|Physical Inactivity
Universitair Ziekenhuis Brussel|Vrije Universiteit Brussel|University Ghent
 May 6 2024 --
NCT05826015 Not yet recruiting
Recurrent High Grade Uterine Cancer
Washington University School of Medicine|National Cancer Institute (NCI)|Aravive Inc.
 May 31 2024 Phase 1
NCT05695313 Recruiting
Breast Cancer
Centre Georges Francois Leclerc
 April 12 2024 Phase 2

기술 지원

취급 설명서

Tel: +1-832-582-8158 Ext:3

다른 문의사항이 있으시면 메시지를 남겨주세요.

이름을 입력해주세요.
이메일을 입력해주세요. 유효한 이메일 주소를 입력해주세요.
저희에게 무엇이든 작성해주세요.

자주 묻는 질문

질문 1:
I am interested in the product S1150 for in vivo studies, could you please give some suggestions for the formulation of it?

답변:
S1150 in 1% DMSO+30% polyethylene glycol+1% Tween 80 at 30mg/ml is a suspension. If you want to inject it, there is another vehicle, 5% DMSO+5% Tween 80+ddH2O. It can dissolve in it at 2.5mg/ml as a clear solution. This is a common formulation we used, but is not cited from reference.

질문 2:
It was dissolved into 1ml DMSO and diluted with 1x PBS or water (500ul + 9.5 ml PBS or water). I found the white precipitation goes out. How to figure it out?

답변:
It has very low solubility in water based solution and that's why it precipitated out once you dilute the stock with water. The vehicle we suggest is: 1% DMSO+30% polyethylene glycol+1% Tween 80.