연구용
제품 번호S1224
| 관련 타겟 | HDAC PARP ATM/ATR DNA-PK WRN Topoisomerase PPAR Sirtuin Casein Kinase eIF |
|---|---|
| 기타 DNA/RNA Synthesis 억제제 | CX-5461 (Pidnarulex) B02 SCR7 Favipiravir (T-705) EED226 RK-33 BMH-21 Triapine (3-AP) Carmofur YK-4-279 |
| 세포주 | 분석 유형 | 농도 | 배양 시간 | 제형 | 활성 설명 | PMID |
|---|---|---|---|---|---|---|
| Caco2 | Function Assay | 30/100 μM | 16 h | DMSO | activates Nrf2 | 24556415 |
| Caco2 | Function Assay | 3/10/30 μM | 16 h | DMSO | increases the mRNA levels of AKR1C1, NQO1, HO-1, MRP2, andMRP3 dose-dependently | 24556415 |
| Caco2 | Function Assay | 30 μM | 24 h | DMSO | induces the expression of HO-1, AKR1C, and NQO1 | 24556415 |
| SW620 | Growth Inhibition Assay | 10-70 mg/L | 24/48/72 h | inhibits cell growth in both time and dose dependent manner | 24646305 | |
| SW480 | Growth Inhibition Assay | 48 h | IC50=20.8 ug/mL | 24720675 | ||
| HCT116 | Function Assay | 2/5 µM | 24/48 h | suppresses survivin mRNA expression | 24761411 | |
| HT-29 | Growth Inhibition Assay | 1 μM | 0-72 h | inhibits cell growth in a time dependent manner | 24997451 | |
| SW480 | Growth Inhibition Assay | 1 μM | 0-72 h | inhibits cell growth in a time dependent manner | 24997451 | |
| HUVEC | Growth Inhibition Assay | IC50=11.30 ± 1.02 μM | 25307448 | |||
| HEK293 | Growth Inhibition Assay | IC50=8.82 ± 5.59 μM | 25307448 | |||
| HT-29 | Growth Inhibition Assay | IC50>50 μM | 25307448 | |||
| HCT-116 | Growth Inhibition Assay | IC50=6.24 ± 2.97 μM | 25307448 | |||
| MCF-7 | Growth Inhibition Assay | IC50=14.24 ± 1.82 μM | 25307448 | |||
| HepG2 | Growth Inhibition Assay | IC50=14.24 ± 1.82 μM | 25307448 | |||
| A549 | Growth Inhibition Assay | IC50=51.08 ± 10.96 μM | 25307448 | |||
| SGC7901 | Growth Inhibition Assay | IC50=21.73 ± 3.08 μM | 25307448 | |||
| COC1 | Growth Inhibition Assay | IC50=46.20 ± 3.14 μM | 25307448 | |||
| HCT116 | Growth Inhibition Assay | 72 h | IC50=6.23±0.75 µg/mL | 25360631 | ||
| SW480 | Growth Inhibition Assay | 72 h | IC50=10.7±2.26 µg/mL | 25360631 | ||
| MIAPaCa-2 | Function Assay | 25 µM | 24/48 h | induces cleavage of PARP, caspase-9, caspase-8 and caspase-3 | 25444914 | |
| Panc-1 | Function Assay | 25 µM | 24/48 h | induces cleavage of PARP, caspase-9, caspase-8 and caspase-3 | 25444914 | |
| MIAPaCa-2 | Apoptosis Assay | 25 µM | 24 h | induces apoptosis in a synergistic manner combined with WA | 25444914 | |
| Panc-1 | Apoptosis Assay | 25 µM | 24 h | induces apoptosis in a synergistic manner combined with WA | 25444914 | |
| HPDE | Cell Viability Assay | 25/50 μM | 24/48 h | inhibits proliferation of PC cells in a synergistic manner combined with WA | 25444914 | |
| SW1990 | Cell Viability Assay | 25/50 μM | 24/48 h | inhibits proliferation of PC cells in a synergistic manner combined with WA | 25444914 | |
| MIAPaCa-2 | Cell Viability Assay | 25/50 μM | 24/48 h | inhibits proliferation of PC cells in a synergistic manner combined with WA | 25444914 | |
| Panc-1 | Cell Viability Assay | 25/50 μM | 24/48 h | inhibits proliferation of PC cells in a synergistic manner combined with WA | 25444914 | |
| A549/CDDP | Growth Inhibition Assay | IC50=18.6 ± 1.2 μM | 25625243 | |||
| A549 | Growth Inhibition Assay | IC50=5.8 ± 0.6 μM | 25625243 | |||
| SW480 | Function Assay | 10 µg/ml | 24 h | enhances cellular autophagic flux | 25749420 | |
| SW620 | Function Assay | 10 µg/ml | 24 h | enhances cellular autophagic flux | 25749420 | |
| SW480 | Function Assay | 10 µg/ml | 24 h | increases LC3-II accumulation and decreases P62 expression | 25749420 | |
| SW620 | Function Assay | 10 µg/ml | 24 h | increases LC3-II accumulation and decreases P62 expression | 25749420 | |
| HT-29 | Growth Inhibition Assay | IC50=5.22 μM | 25761479 | |||
| SNU-175 | Growth Inhibition Assay | IC50=1.51 μM | 25761479 | |||
| COLO-320DM | Growth Inhibition Assay | IC50=5.38 μM | 25761479 | |||
| DLD-1 | Growth Inhibition Assay | IC50=8.65 μM | 25761479 | |||
| DiFi | Growth Inhibition Assay | IC50=10.95 μM | 25761479 | |||
| HCT-15 | Growth Inhibition Assay | IC50=8.64 μM | 25761479 | |||
| SCM-1 | Growth Inhibition Assay | IC50=17.5 μM | 25789057 | |||
| TMK-1 | Growth Inhibition Assay | IC50=22.6 μM | 25789057 | |||
| MKN-45 | Growth Inhibition Assay | IC50=14.0 μM | 25789057 | |||
| AGS | Growth Inhibition Assay | IC50=10.6 μM | 25789057 | |||
| S3 | Growth Inhibition Assay | IC50=53.5 ± 1.5 μM | 25801007 | |||
| SiHa | Growth Inhibition Assay | IC50=0.8 ± 0.1 μM | 25801007 | |||
| HT-29 | Growth Inhibition Assay | IC50=35.6 μM | 26003085 | |||
| DLD-1 | Growth Inhibition Assay | IC50=32.2 μM | 26003085 | |||
| HT29 | Growth Inhibition Assay | IC50=63 μM ± 18 | 26004084 | |||
| MC38 | Growth Inhibition Assay | IC50=23 μM ± 2 | 26004084 | |||
| SW620 | Growth Inhibition Assay | IC50=3.68 μM | 26023085 | |||
| SW480 | Growth Inhibition Assay | IC50=2.86 μM | 26023085 | |||
| RKO | Growth Inhibition Assay | IC50=1.23 μM | 26023085 | |||
| LoVo | Growth Inhibition Assay | IC50=1.2 μM | 26023085 | |||
| KM12 | Growth Inhibition Assay | IC50=4.37 μM | 26023085 | |||
| HCT116p53- | Growth Inhibition Assay | IC50=1.08 μM | 26023085 | |||
| HCT116 | Growth Inhibition Assay | IC50=1.04 μM | 26023085 | |||
| HCT15 | Growth Inhibition Assay | IC50=1.43 μM | 26023085 | |||
| HT29 | Growth Inhibition Assay | IC50=2.69 μM | 26023085 | |||
| DLD1 | Growth Inhibition Assay | IC50=2.01 μM | 26023085 | |||
| Colo205 | Growth Inhibition Assay | IC50=3.33 μM | 26023085 | |||
| BE | Growth Inhibition Assay | IC50=3.33 μM | 26023085 | |||
| CT26 | Cell Viability Assay | 4 mM | 48 h | decreases cell viability to 53.2% | 26137012 | |
| CT26 | Function Assay | 4 mM | 48 h | increases the expression levels of autophagy-related proteins, such as LC3-II, Beclin1 and ATG5 | 26137012 | |
| CT26 | Function Assay | 4 mM | 48 h | induces autophagy | 26137012 | |
| SK-OV-3 | Function Assay | 50 μM | 48 h | promotes sensitivity of ovarian carcinoma to NK cell-mediated cytolysis | 26138671 | |
| OVCAR-5 | Function Assay | 20 μM | 24h | promotes sensitivity of ovarian carcinoma to NK cell-mediated cytolysis | 26138671 | |
| PA-1 | Function Assay | 10 μM | 24h | promotes sensitivity of ovarian carcinoma to NK cell-mediated cytolysis | 26138671 | |
| SK-OV-3 | Function Assay | 50 μM | 96 h | up-regulates the stress ligands for NK cell-activating receptors and TRAIL receptors | 26138671 | |
| OVCAR-5 | Function Assay | 30 μM | 48h | up-regulates the stress ligands for NK cell-activating receptors and TRAIL receptors | 26138671 | |
| PA-1 | Function Assay | 10 μM | 48h | up-regulates the stress ligands for NK cell-activating receptors and TRAIL receptors | 26138671 | |
| SK-OV-3 | Function Assay | 50 μM | 96 h | triggeres the production of type I IFNs and chemokines | 26138671 | |
| OVCAR-5 | Function Assay | 30 μM | 48h | triggeres the production of type I IFNs and chemokines | 26138671 | |
| PA-1 | Function Assay | 10 μM | 24h | triggeres the production of type I IFNs and chemokines | 26138671 | |
| SK-OV-3 | Cell Viability Assay | 0-100 μM | 24/48/72 h | inhibits cell viability in both time and dose dependent manner | 26138671 | |
| OVCAR-5 | Cell Viability Assay | 0-60 μM | 24/48/72 h | inhibits cell viability in both time and dose dependent manner | 26138671 | |
| PA-1 | Cell Viability Assay | 0-20 μM | 24/48 h | inhibits cell viability in both time and dose dependent manner | 26138671 | |
| HCT116 | Growth Inhibition Assay | IC50=0.41 ± 0.02 μM | 26148596 | |||
| HT29 | Growth Inhibition Assay | IC50=0.88 ± 0.2 μM | 26148596 | |||
| SNU-387 | Growth Inhibition Assay | IC50=25 ± 2.7 μM | 26160429 | |||
| SNU-475 | Growth Inhibition Assay | IC50>30 μM | 26160429 | |||
| Hep-G2 | Growth Inhibition Assay | IC50=13.1 ± 1.6 μM | 26160429 | |||
| SNU-398 | Growth Inhibition Assay | IC50=6.5 ± 1.1 μM | 26160429 | |||
| LoVo | Function Assay | 1/5 μM | 24/48 h | induces transcriptional repression of DUT-N | 26208523 | |
| HCT116 p53+/+ | Function Assay | 1/5 μM | 24/48 h | induces transcriptional repression of DUT-N | 26208523 | |
| MDA-MB-231 | Growth Inhibition Assay | IC50=23.1 ± 0.1 μM | 26211591 | |||
| MCF-7 | Growth Inhibition Assay | IC50=15.4 ± 0.3 μM | 26211591 | |||
| SK-BR-3 | Growth Inhibition Assay | IC50=31.0 ± 0.1 μM | 26211591 | |||
| LoVo | Growth Inhibition Assay | 48 h | IC50=94.83 μM | 26269759 | ||
| HCT116 | Growth Inhibition Assay | 48 h | IC50=11.86 μM | 26269759 | ||
| SW480 | Growth Inhibition Assay | 48 h | IC50=1.87 μM | 26269759 | ||
| CaES-17 | Cytotoxicity Assay | 0–160 μM | 48 h | IC50=5.5 ± 0.2 μM | 26474693 | |
| HKESC-2 | Cytotoxicity Assay | 0–160 μM | 48 h | IC50=5.8 ± 0.5 μM | 26474693 | |
| 클릭하여 더 많은 세포주 실험 데이터 보기 | ||||||
| 분자량 | 397.29 | 화학식 | C8H14N2O4Pt |
보관 (수령일로부터) | 2 years 4°C(in the dark) powder |
|---|---|---|---|---|---|
| CAS 번호 | 61825-94-3 | SDF 다운로드 | 원액 보관 | 용액은 불안정합니다. 신선하게 준비하거나 소량의 사전 포장된 크기를 구매하십시오. 수령 즉시 재포장하십시오. | |
| 동의어 | L-OHP,NSC 266046 | Smiles | C1CCC(C(C1)[NH-])[NH-].C(=O)(C(=O)O)O.[Pt+2] | ||
|
In vitro |
Water : 2 mg/mL Ethanol : Insoluble |
|
In vivo |
|||||
1단계: 아래 정보 입력 (권장: 실험 중 손실을 고려하여 추가 동물 포함)
2단계: 생체 내 제형 입력 (이것은 계산기일 뿐 제형이 아닙니다. 용해도 섹션에 생체 내 제형이 없는 경우 먼저 당사에 문의하십시오.)
계산 결과:
작업 농도: mg/ml;
DMSO 원액 준비 방법: mg 약물 사전 용해 μL DMSO ( 원액 농도 mg/mL, 농도가 해당 약물 배치의 DMSO 용해도를 초과하는 경우 먼저 당사에 문의하십시오. )
생체 내 제형 준비 방법: 취하다 μL DMSO 원액, 다음 추가μL PEG300, 혼합하고 투명하게 한 다음 추가μL Tween 80, 혼합하고 투명하게 한 다음 추가 μL ddH2O, 혼합하고 투명하게 합니다.
생체 내 제형 준비 방법: 취하다 μL DMSO 원액, 다음 추가 μL 옥수수 기름, 혼합하고 투명하게 합니다.
참고: 1. 다음 용매를 추가하기 전에 액체가 투명한지 확인하십시오.
2. 용매를 순서대로 추가해야 합니다. 다음 용매를 추가하기 전에 이전 추가에서 얻은 용액이 투명한 용액인지 확인해야 합니다. 와동, 초음파 또는 뜨거운 물 중탕과 같은 물리적 방법을 사용하여 용해를 도울 수 있습니다.
| 특징 |
This product is not recommended to be dissolved in dimethylsulfoxide (DMSO).
|
|---|---|
| Targets/IC50/Ki |
DNA synthesis
(RT4, TCCSUP, A2780, HT-29, U-373MG, U-87MG, SK-MEL-2, HT-144 cells) |
| 시험관 내(In vitro) |
Oxaliplatin의 주요 작용 메커니즘은 DNA-부가물 형성을 통해 매개됩니다. 이 화합물은 세포 사멸로 이어지는 1차 및 2차 DNA 손상을 유도합니다. 이는 인간 흑색종 세포주 C32 및 G361에 대해 각각 0.98 mM 및 0.14 mM의 IC50을 가지며 활성을 나타냅니다. 이 화학물질은 방광암 세포주 RT4 및 TCCSUP, 난소암 세포주 A2780, 결장암 세포주 HT-29, 교모세포종 세포주 U-373MG 및 U-87MG, 흑색종 세포주 SK-MEL-2 및 HT-144를 각각 11 μM, 15 μM, 0.17 μM, 0.97 μM, 2.95 μM, 17.6 μM, 30.9 μM 및 7.85 μM의 IC50으로 효과적으로 억제합니다. |
| 생체 내(In vivo) |
HCCLM3 간세포암종 종양을 이식한 누드 마우스에 Oxaliplatin을 10 mg/kg 주 1회 복강내 주사하면 종양 부피와 세포 사멸 지수가 유의하게 감소합니다. 이 화합물(5mg/kg, 1, 5, 9일차에 정맥 주사)은 L40 AKR T-백혈병-림프종에 대해 T/C 1.77로 활성을 나타냅니다. 또한 뇌내 이식된 L1210 백혈병, MA 16-C 이종이식편, B16 흑색종 이종이식편, 루이스 폐암 이종이식편 및 C26 결장암 이종이식편에도 효과적입니다. 이 화학물질은 마우스에서 역행성 신경 수송 장애를 유도합니다. |
참조 |
|
| 방법 | 바이오마커 | 이미지 | PMID |
|---|---|---|---|
| Western blot | VEGFR-1 / NRP-1 p-AKT(Ser473) / AKT / PTEN / p-Src(Tyr416) |