연구용
제품 번호: S7397
| 세포주 | 분석 유형 | 농도 | 배양 시간 | 제형 | 활성 설명 | PMID |
|---|---|---|---|---|---|---|
| MV-4-11 | Growth Inhibition Assay | IC50=0.00000303 μM | SANGER | |||
| MONO-MAC-6 | Growth Inhibition Assay | IC50=0.00418 μM | SANGER | |||
| ALL-PO | Growth Inhibition Assay | IC50=0.03184 μM | SANGER | |||
| NKM-1 | Growth Inhibition Assay | IC50=0.07416 μM | SANGER | |||
| CGTH-W-1 | Growth Inhibition Assay | IC50=0.25022 μM | SANGER | |||
| BB65-RCC | Growth Inhibition Assay | IC50=0.47073 μM | SANGER | |||
| NOS-1 | Growth Inhibition Assay | IC50=0.5636 μM | SANGER | |||
| SH-4 | Growth Inhibition Assay | IC50=0.65613 μM | SANGER | |||
| HOP-62 | Growth Inhibition Assay | IC50=0.85088 μM | SANGER | |||
| HCC2998 | Growth Inhibition Assay | IC50=0.88818 μM | SANGER | |||
| GDM-1 | Growth Inhibition Assay | IC50=0.90698 μM | SANGER | |||
| KM12 | Growth Inhibition Assay | IC50=1.02098 μM | SANGER | |||
| LB2518-MEL | Growth Inhibition Assay | IC50=1.20809 μM | SANGER | |||
| NCI-H1436 | Growth Inhibition Assay | IC50=1.21678 μM | SANGER | |||
| EM-2 | Growth Inhibition Assay | IC50=1.35578 μM | SANGER | |||
| LAMA-84 | Growth Inhibition Assay | IC50=1.37648 μM | SANGER | |||
| KG-1 | Growth Inhibition Assay | IC50=1.47935 μM | SANGER | |||
| A388 | Growth Inhibition Assay | IC50=1.59165 μM | SANGER | |||
| no-10 | Growth Inhibition Assay | IC50=1.61726 μM | SANGER | |||
| SF126 | Growth Inhibition Assay | IC50=1.63812 μM | SANGER | |||
| MEG-01 | Growth Inhibition Assay | IC50=1.8098 μM | SANGER | |||
| A3-KAW | Growth Inhibition Assay | IC50=1.8842 μM | SANGER | |||
| D-247MG | Growth Inhibition Assay | IC50=2.1448 μM | SANGER | |||
| OVCAR-4 | Growth Inhibition Assay | IC50=2.21393 μM | SANGER | |||
| NCI-SNU-1 | Growth Inhibition Assay | IC50=2.3162 μM | SANGER | |||
| NCI-H2171 | Growth Inhibition Assay | IC50=2.39764 μM | SANGER | |||
| SIG-M5 | Growth Inhibition Assay | IC50=2.42242 μM | SANGER | |||
| BE-13 | Growth Inhibition Assay | IC50=2.69609 μM | SANGER | |||
| K052 | Growth Inhibition Assay | IC50=2.74616 μM | SANGER | |||
| L-540 | Growth Inhibition Assay | IC50=2.75789 μM | SANGER | |||
| KMOE-2 | Growth Inhibition Assay | IC50=2.8135 μM | SANGER | |||
| MFH-ino | Growth Inhibition Assay | IC50=2.92185 μM | SANGER | |||
| HL-60 | Growth Inhibition Assay | IC50=3.06299 μM | SANGER | |||
| HCC2218 | Growth Inhibition Assay | IC50=3.12003 μM | SANGER | |||
| TE-5 | Growth Inhibition Assay | IC50=3.13162 μM | SANGER | |||
| MZ1-PC | Growth Inhibition Assay | IC50=3.47509 μM | SANGER | |||
| MRK-nu-1 | Growth Inhibition Assay | IC50=3.61468 μM | SANGER | |||
| MZ7-mel | Growth Inhibition Assay | IC50=3.66099 μM | SANGER | |||
| BC-1 | Growth Inhibition Assay | IC50=3.7402 μM | SANGER | |||
| ST486 | Growth Inhibition Assay | IC50=3.83673 μM | SANGER | |||
| KS-1 | Growth Inhibition Assay | IC50=3.88198 μM | SANGER | |||
| SK-NEP-1 | Growth Inhibition Assay | IC50=4.16815 μM | SANGER | |||
| BC-3 | Growth Inhibition Assay | IC50=4.23391 μM | SANGER | |||
| NCI-H1581 | Growth Inhibition Assay | IC50=4.28798 μM | SANGER | |||
| MHH-PREB-1 | Growth Inhibition Assay | IC50=4.40484 μM | SANGER | |||
| NOMO-1 | Growth Inhibition Assay | IC50=4.48905 μM | SANGER | |||
| QIMR-WIL | Growth Inhibition Assay | IC50=5.07294 μM | SANGER | |||
| SF539 | Growth Inhibition Assay | IC50=5.13227 μM | SANGER | |||
| TE-12 | Growth Inhibition Assay | IC50=5.24929 μM | SANGER | |||
| NCI-H510A | Growth Inhibition Assay | IC50=5.41685 μM | SANGER | |||
| JAR | Growth Inhibition Assay | IC50=5.50824 μM | SANGER | |||
| no-11 | Growth Inhibition Assay | IC50=5.73568 μM | SANGER | |||
| BV-173 | Growth Inhibition Assay | IC50=5.95682 μM | SANGER | |||
| SR | Growth Inhibition Assay | IC50=6.00678 μM | SANGER | |||
| MOLT-16 | Growth Inhibition Assay | IC50=6.25266 μM | SANGER | |||
| MZ2-MEL | Growth Inhibition Assay | IC50=6.31839 μM | SANGER | |||
| SW954 | Growth Inhibition Assay | IC50=6.45866 μM | SANGER | |||
| ML-2 | Growth Inhibition Assay | IC50=6.52849 μM | SANGER | |||
| OCI-AML2 | Growth Inhibition Assay | IC50=6.61062 μM | SANGER | |||
| SIMA | Growth Inhibition Assay | IC50=7.00101 μM | SANGER | |||
| DOHH-2 | Growth Inhibition Assay | IC50=7.05676 μM | SANGER | |||
| 697 | Growth Inhibition Assay | IC50=7.05989 μM | SANGER | |||
| NB1 | Growth Inhibition Assay | IC50=7.40407 μM | SANGER | |||
| D-392MG | Growth Inhibition Assay | IC50=7.62663 μM | SANGER | |||
| ES8 | Growth Inhibition Assay | IC50=7.76503 μM | SANGER | |||
| RPMI-8226 | Growth Inhibition Assay | IC50=7.84511 μM | SANGER | |||
| IST-MEL1 | Growth Inhibition Assay | IC50=8.40002 μM | SANGER | |||
| NB14 | Growth Inhibition Assay | IC50=8.63133 μM | SANGER | |||
| HD-MY-Z | Growth Inhibition Assay | IC50=8.63746 μM | SANGER | |||
| TE-10 | Growth Inhibition Assay | IC50=8.76353 μM | SANGER | |||
| LC-1F | Growth Inhibition Assay | IC50=9.10834 μM | SANGER | |||
| OS-RC-2 | Growth Inhibition Assay | IC50=9.11243 μM | SANGER | |||
| NCI-SNU-16 | Growth Inhibition Assay | IC50=9.21026 μM | SANGER | |||
| SHP-77 | Growth Inhibition Assay | IC50=9.71662 μM | SANGER | |||
| A4-Fuk | Growth Inhibition Assay | IC50=9.7561 μM | SANGER | |||
| NB6 | Growth Inhibition Assay | IC50=9.76029 μM | SANGER | |||
| JiyoyeP-2003 | Growth Inhibition Assay | IC50=10.4745 μM | SANGER | |||
| DMS-114 | Growth Inhibition Assay | IC50=10.5441 μM | SANGER | |||
| NB7 | Growth Inhibition Assay | IC50=10.7526 μM | SANGER | |||
| NCI-H747 | Growth Inhibition Assay | IC50=11.1216 μM | SANGER | |||
| HH | Growth Inhibition Assay | IC50=11.3876 μM | SANGER | |||
| EW-18 | Growth Inhibition Assay | IC50=11.9044 μM | SANGER | |||
| CHP-126 | Growth Inhibition Assay | IC50=11.9738 μM | SANGER | |||
| NTERA-S-cl-D1 | Growth Inhibition Assay | IC50=12.0278 μM | SANGER | |||
| DEL | Growth Inhibition Assay | IC50=12.0985 μM | SANGER | |||
| LU-139 | Growth Inhibition Assay | IC50=12.5413 μM | SANGER | |||
| P30-OHK | Growth Inhibition Assay | IC50=12.5479 μM | SANGER | |||
| NCI-H1522 | Growth Inhibition Assay | IC50=12.746 μM | SANGER | |||
| NCI-H1299 | Growth Inhibition Assay | IC50=13.2911 μM | SANGER | |||
| UACC-257 | Growth Inhibition Assay | IC50=13.5126 μM | SANGER | |||
| Calu-6 | Growth Inhibition Assay | IC50=13.6046 μM | SANGER | |||
| NCI-H1882 | Growth Inhibition Assay | IC50=13.8555 μM | SANGER | |||
| BB30-HNC | Growth Inhibition Assay | IC50=14.0609 μM | SANGER | |||
| ES1 | Growth Inhibition Assay | IC50=14.1551 μM | SANGER | |||
| NCI-H1694 | Growth Inhibition Assay | IC50=14.4811 μM | SANGER | |||
| IST-SL1 | Growth Inhibition Assay | IC50=14.9616 μM | SANGER | |||
| ECC4 | Growth Inhibition Assay | IC50=15.0558 μM | SANGER | |||
| MDA-MB-134-VI | Growth Inhibition Assay | IC50=15.4131 μM | SANGER | |||
| SCH | Growth Inhibition Assay | IC50=15.4728 μM | SANGER | |||
| SK-N-FI | Growth Inhibition Assay | IC50=15.6534 μM | SANGER | |||
| HDLM-2 | Growth Inhibition Assay | IC50=16.0714 μM | SANGER | |||
| Ramos-2G6-4C10 | Growth Inhibition Assay | IC50=16.1297 μM | SANGER | |||
| EW-24 | Growth Inhibition Assay | IC50=16.1661 μM | SANGER | |||
| NCI-H2141 | Growth Inhibition Assay | IC50=16.189 μM | SANGER | |||
| LC4-1 | Growth Inhibition Assay | IC50=16.6119 μM | SANGER | |||
| HT-144 | Growth Inhibition Assay | IC50=17.006 μM | SANGER | |||
| SK-MEL-1 | Growth Inhibition Assay | IC50=17.0072 μM | SANGER | |||
| SCC-15 | Growth Inhibition Assay | IC50=17.1638 μM | SANGER | |||
| C8166 | Growth Inhibition Assay | IC50=17.6833 μM | SANGER | |||
| GOTO | Growth Inhibition Assay | IC50=17.8344 μM | SANGER | |||
| COR-L279 | Growth Inhibition Assay | IC50=18.1362 μM | SANGER | |||
| K-562 | Growth Inhibition Assay | IC50=18.7143 μM | SANGER | |||
| ES3 | Growth Inhibition Assay | IC50=18.8041 μM | SANGER | |||
| LU-165 | Growth Inhibition Assay | IC50=19.7008 μM | SANGER | |||
| KM-H2 | Growth Inhibition Assay | IC50=20.3184 μM | SANGER | |||
| RL | Growth Inhibition Assay | IC50=20.9692 μM | SANGER | |||
| EW-3 | Growth Inhibition Assay | IC50=21.1889 μM | SANGER | |||
| A101D | Growth Inhibition Assay | IC50=21.3752 μM | SANGER | |||
| HUTU-80 | Growth Inhibition Assay | IC50=21.3946 μM | SANGER | |||
| NCI-H23 | Growth Inhibition Assay | IC50=21.3992 μM | SANGER | |||
| PF-382 | Growth Inhibition Assay | IC50=21.4403 μM | SANGER | |||
| LB373-MEL-D | Growth Inhibition Assay | IC50=21.5615 μM | SANGER | |||
| TE-8 | Growth Inhibition Assay | IC50=21.6394 μM | SANGER | |||
| TE-9 | Growth Inhibition Assay | IC50=21.8513 μM | SANGER | |||
| Daudi | Growth Inhibition Assay | IC50=21.9304 μM | SANGER | |||
| D-542MG | Growth Inhibition Assay | IC50=22.0256 μM | SANGER | |||
| U-698-M | Growth Inhibition Assay | IC50=22.4603 μM | SANGER | |||
| ES6 | Growth Inhibition Assay | IC50=22.7366 μM | SANGER | |||
| DU-4475 | Growth Inhibition Assay | IC50=23.8897 μM | SANGER | |||
| ECC12 | Growth Inhibition Assay | IC50=24.2803 μM | SANGER | |||
| C2BBe1 | Growth Inhibition Assay | IC50=24.3239 μM | SANGER | |||
| IST-SL2 | Growth Inhibition Assay | IC50=24.4362 μM | SANGER | |||
| DJM-1 | Growth Inhibition Assay | IC50=24.5221 μM | SANGER | |||
| DMS-153 | Growth Inhibition Assay | IC50=24.8614 μM | SANGER | |||
| NB13 | Growth Inhibition Assay | IC50=25.0265 μM | SANGER | |||
| SK-N-DZ | Growth Inhibition Assay | IC50=26.3414 μM | SANGER | |||
| COR-L88 | Growth Inhibition Assay | IC50=26.5796 μM | SANGER | |||
| LU-65 | Growth Inhibition Assay | IC50=26.8535 μM | SANGER | |||
| TGBC1TKB | Growth Inhibition Assay | IC50=26.9828 μM | SANGER | |||
| THP-1 | Growth Inhibition Assay | IC50=27.2141 μM | SANGER | |||
| ONS-76 | Growth Inhibition Assay | IC50=27.332 μM | SANGER | |||
| LC-2-ad | Growth Inhibition Assay | IC50=27.6231 μM | SANGER | |||
| EW-13 | Growth Inhibition Assay | IC50=29.1746 μM | SANGER | |||
| MS-1 | Growth Inhibition Assay | IC50=30.7278 μM | SANGER | |||
| NCI-H2227 | Growth Inhibition Assay | IC50=30.9806 μM | SANGER | |||
| LXF-289 | Growth Inhibition Assay | IC50=31.4492 μM | SANGER | |||
| MC116 | Growth Inhibition Assay | IC50=32.0826 μM | SANGER | |||
| EVSA-T | Growth Inhibition Assay | IC50=32.2585 μM | SANGER | |||
| CTB-1 | Growth Inhibition Assay | IC50=33.1101 μM | SANGER | |||
| COLO-320-HSR | Growth Inhibition Assay | IC50=33.1603 μM | SANGER | |||
| NCI-H2196 | Growth Inhibition Assay | IC50=33.2557 μM | SANGER | |||
| LB2241-RCC | Growth Inhibition Assay | IC50=33.3135 μM | SANGER | |||
| LS-513 | Growth Inhibition Assay | IC50=33.8638 μM | SANGER | |||
| LP-1 | Growth Inhibition Assay | IC50=33.9956 μM | SANGER | |||
| A253 | Growth Inhibition Assay | IC50=34.2296 μM | SANGER | |||
| SK-MM-2 | Growth Inhibition Assay | IC50=34.9451 μM | SANGER | |||
| NCI-H1963 | Growth Inhibition Assay | IC50=35.3072 μM | SANGER | |||
| MMAC-SF | Growth Inhibition Assay | IC50=35.8785 μM | SANGER | |||
| LB831-BLC | Growth Inhibition Assay | IC50=36.0654 μM | SANGER | |||
| WSU-NHL | Growth Inhibition Assay | IC50=36.164 μM | SANGER | |||
| CESS | Growth Inhibition Assay | IC50=36.2848 μM | SANGER | |||
| NEC8 | Growth Inhibition Assay | IC50=36.5835 μM | SANGER | |||
| KNS-42 | Growth Inhibition Assay | IC50=37.1237 μM | SANGER | |||
| MHH-CALL-2 | Growth Inhibition Assay | IC50=37.1821 μM | SANGER | |||
| K5 | Growth Inhibition Assay | IC50=38.43 μM | SANGER | |||
| CP66-MEL | Growth Inhibition Assay | IC50=39.0733 μM | SANGER | |||
| OPM-2 | Growth Inhibition Assay | IC50=39.8432 μM | SANGER | |||
| IST-MES1 | Growth Inhibition Assay | IC50=40.3096 μM | SANGER | |||
| EC-GI-10 | Growth Inhibition Assay | IC50=41.5805 μM | SANGER | |||
| CTV-1 | Growth Inhibition Assay | IC50=42.8406 μM | SANGER | |||
| DG-75 | Growth Inhibition Assay | IC50=43.7595 μM | SANGER | |||
| KNS-81-FD | Growth Inhibition Assay | IC50=45.4058 μM | SANGER | |||
| NCI-H82 | Growth Inhibition Assay | IC50=45.5758 μM | SANGER | |||
| RPMI-8866 | Growth Inhibition Assay | IC50=46.1873 μM | SANGER | |||
| ACN | Growth Inhibition Assay | IC50=46.434 μM | SANGER | |||
| NCI-H1395 | Growth Inhibition Assay | IC50=46.4756 μM | SANGER | |||
| NCI-H209 | Growth Inhibition Assay | IC50=47.1405 μM | SANGER | |||
| TGW | Growth Inhibition Assay | IC50=49.0791 μM | SANGER | |||
| NCI-H748 | Growth Inhibition Assay | IC50=49.4753 μM | SANGER | |||
| EKVX | Growth Inhibition Assay | IC50=49.6628 μM | SANGER | |||
| MV4-11 | Antiproliferative activity assay | IC50 = 0.00087 μM | 19754199 | |||
| MV4-11 | Cytotoxicity assay | IC50 = 0.00087 μM | 19654408 | |||
| TT | Antiproliferative activity assay | IC50 = 0.0014 μM | 18849971 | |||
| RS4-11 | Function assay | IC50 = 0.002 μM | 19654408 | |||
| MOLM13 | Function assay | IC50 = 0.002 μM | 24641103 | |||
| Sf9 | Function assay | IC50 = 0.003 μM | 21708468 | |||
| RS4-11 | Function assay | IC50 = 0.0032 μM | 19654408 | |||
| MV4-11 | Growth inhibition assay | IC50 = 0.004 μM | 29357250 | |||
| A375 | Function assay | IC50 = 0.0044 μM | 29461827 | |||
| MOLM13 | Antiproliferative activity assay | IC50 = 0.005 μM | 24641103 | |||
| MV4-11 | Function assay | IC50 = 0.007 μM | 23362959 | |||
| MV4-11 | Cytotoxicity assay | IC50 = 0.007 μM | 26342867 | |||
| HEK293 | Function assay | Kd = 0.013 μM | 19754199 | |||
| Kasumi-1 | Antiproliferative activity assay | IC50 = 0.015 μM | 20570526 | |||
| MV4-11 | Antiproliferative activity assay | IC50 = 0.015 μM | 20570526 | |||
| sf9 | Function assay | IC50 = 0.015 μM | 29266937 | |||
| sf9 | Function assay | IC50 = 0.018 μM | 21708468 | |||
| sf9 | Function assay | IC50 = 0.02 μM | 23618709 | |||
| MV4-11 | Antiproliferative activity assay | GI50 = 0.03 μM | 21708468 | |||
| Sf9 | Function assay | IC50 = 0.042 μM | 26081023 | |||
| SF9 | Function assay | IC50 = 0.043 μM | 18473434 | |||
| MV4-11 | Cytotoxicity assay | GI50 = 0.043 μM | 23618709 | |||
| MV4-11 | Function assay | GI50 = 0.043 μM | 26081023 | |||
| SF9 | Function assay | IC50 = 0.044 μM | 26081023 | |||
| SF9 | Function assay | IC50 = 0.054 μM | 21708468 | |||
| SF9 | Function assay | IC50 = 0.054 μM | 23618709 | |||
| MOLM13 | Antiproliferative activity assay | GI50 = 0.056 μM | 21708468 | |||
| MOLM13 | Antiproliferative activity assay | GI50 = 0.056 μM | 22726931 | |||
| MOLM13 | Cytotoxicity assay | GI50 = 0.056 μM | 23618709 | |||
| MOLM-13 | Function assay | GI50 = 0.056 μM | 26081023 | |||
| SF9 | Function assay | IC50 = 0.058 μM | 29266937 | |||
| WM266.4 | Antiproliferative activity assay | IC50 = 0.06 μM | 25496804 | |||
| MDA-MB-231 | Function assay | IC50 = 0.063 μM | 28431342 | |||
| SF9 | Function assay | IC50 = 0.09 μM | 29266937 | |||
| Spodoptera frugiperda | Function assay | IC50 = 0.09 μM | 26922228 | |||
| SF9 | Function assay | IC50 = 0.09 μM | 23562241 | |||
| SF9 | Function assay | IC50 = 0.1 μM | 23442188 | |||
| SF9 | Function assay | IC50 = 0.1 μM | 23442188 | |||
| HEK293 | Function assay | IC50 = 0.12 μM | 26318998 | |||
| MCF7 | Antiproliferative activity assay | IC50 = 0.19 μM | 25496804 | |||
| MV4-11 | Antiproliferative activity human | IC50 = 0.3 μM | 28242553 | |||
| HepG2 | Antiproliferative activity assay | EC50 = 0.302 μM | 27010810 | |||
| THP1 | Antiproliferative activity assay | IC50 = 0.31 μM | 20570526 | |||
| SMMC7721 | Cytotoxicity assay | IC50 = 0.37 μM | 25982075 | |||
| HT-29 | Antiproliferative activity assay | IC50 = 0.39 μM | 25778995 | |||
| sf9 | Function assay | Kd = 0.6 μM | 28109791 | |||
| T47D | Antiproliferative activity assay | IC50 = 0.61 μM | 25778995 | |||
| A549 | Cytotoxicity assay | IC50 = 0.63 μM | 25982075 | |||
| HeLa | Cytotoxicity assay | IC50 = 0.64 μM | 30015070 | |||
| WM3629 | Antiproliferative activity assay | GI50 = 0.65 μM | 20466542 | |||
| SMMC7721 | Antiproliferative activity assay | IC50 = 0.65 μM | 26342134 | |||
| WM3629 | Growth inhibition assay | GI50 = 0.78 μM | 20149658 | |||
| WM3629 | Antiproliferative activity assay | GI50 = 0.78 μM | 26810260 | |||
| MCF7 | Antiproliferative activity assay | IC50 = 0.78 μM | 25778995 | |||
| K562 | Antiproliferative activity assay | IC50 = 0.86 μM | 24315192 | |||
| COLO205 | Antiproliferative activity assay | IC50 = 0.87 μM | 25778995 | |||
| T29 | Cytotoxicity assay | IC50 = 0.9 μM | 26318998 | |||
| MDA-MB-231 | Cytotoxicity assay | IC50 = 0.94 μM | 25086238 | |||
| MDA-MB-231 | Cytotoxicity assay | IC50 = 0.94 μM | 25440879 | |||
| HepG2 | Antiproliferative activity assay | IC50 = 1.06 μM | 29628325 | |||
| BL21(DE3) | Function assay | IC50 = 1.1 μM | 19928858 | |||
| K562 | Antiproliferative activity assay | IC50 = 1.22 μM | 25778995 | |||
| MDA-MB-231 | Growth inhibition assay | GI50 = 1.26 μM | 28088086 | |||
| MDA-MB-231 | Cytotoxicity assay | GI50 = 1.26 μM | 26590508 | |||
| MDA-MB-231 | Antiproliferative activity assay | GI50 = 1.26 μM | 27017549 | |||
| SK-MEL-28 | Antiproliferative activity assay | EC50 = 1.3 μM | 18942827 | |||
| sf9 | Function assay | Kd = 1.3 μM | 28109791 | |||
| F-6-8 | Cytotoxicity assay | IC50 = 1.3 μM | 26318998 | |||
| A549 | Antiproliferative activity assay | IC50 = 1.45 μM | 26342134 | |||
| rhabdomyosarcoma | Antiviral activity assay | EC50 = 1.5 μM | 27288186 | |||
| HL-60(TB) | Growth inhibition assay | GI50 = 1.58 μM | 28088086 | |||
| RPMI8226 | Growth inhibition assay | GI50 = 1.58 μM | 28088086 | |||
| KM12 | Growth inhibition assay | GI50 = 1.58 μM | 28088086 | |||
| LOXIMVI | Growth inhibition assay | GI50 = 1.58 μM | 28088086 | |||
| HCT116 | Growth inhibition assay | GI50 = 1.58 μM | 28088086 | |||
| HOP92 | Growth inhibition assay | GI50 = 1.58 μM | 28088086 | |||
| SF539 | Growth inhibition assay | GI50 = 1.58 μM | 28088086 | |||
| UACC62 | Growth inhibition assay | GI50 = 1.58 μM | 28088086 | |||
| SF295 | Growth inhibition assay | GI50 = 1.58 μM | 28088086 | |||
| MDA-MB-435 | Growth inhibition assay | GI50 = 1.58 μM | 28088086 | |||
| SK-MEL-5 | Growth inhibition assay | GI50 = 1.58 μM | 28088086 | |||
| T47D | Growth inhibition assay | GI50 = 1.58 μM | 28088086 | |||
| RPMI8266 | Cytotoxicity assay | GI50 = 1.58 μM | 26590508 | |||
| HL-60(TB) | Cytotoxicity assay | GI50 = 1.58 μM | 26590508 | |||
| KM12 | Cytotoxicity assay | GI50 = 1.58 μM | 26590508 | |||
| HCT116 | Cytotoxicity assay | GI50 = 1.58 μM | 26590508 | |||
| SF295 | Cytotoxicity assay | GI50 = 1.58 μM | 26590508 | |||
| SF539 | Cytotoxicity assay | GI50 = 1.58 μM | 26590508 | |||
| SK-MEL-2 | Cytotoxicity assay | GI50 = 1.58 μM | 26590508 | |||
| MDA-MB-435 | Cytotoxicity assay | GI50 = 1.58 μM | 26590508 | |||
| SK-MEL-5 | Cytotoxicity assay | GI50 = 1.58 μM | 26590508 | |||
| LOXIMVI | Cytotoxicity assay | GI50 = 1.58 μM | 26590508 | |||
| T47D | Cytotoxicity assay | GI50 = 1.58 μM | 26590508 | |||
| SMMC7721 | Antiproliferative activity assay | IC50 = 1.58 μM | 26753815 | |||
| LOXIMVI | Antiproliferative activity assay | GI50 = 1.58 μM | 27017549 | |||
| UACC62 | Antiproliferative activity assay | GI50 = 1.58 μM | 27017549 | |||
| SK-MEL-5 | Antiproliferative activity assay | GI50 = 1.58 μM | 27017549 | |||
| KM12 | Antiproliferative activity assay | GI50 = 1.58 μM | 27017549 | |||
| MDA-MB-435 | Antiproliferative activity assay | GI50 = 1.58 μM | 27017549 | |||
| SF539 | Antiproliferative activity assay | GI50 = 1.58 μM | 27017549 | |||
| SF295 | Antiproliferative activity assay | GI50 = 1.58 μM | 27017549 | |||
| HCT116 | Antiproliferative activity assay | GI50 = 1.58 μM | 27017549 | |||
| HOP92 | Antiproliferative activity assay | GI50 = 1.58 μM | 27017549 | |||
| RPMI8226 | Antiproliferative activity assay | GI50 = 1.58 μM | 27017549 | |||
| HL-60(TB) | Antiproliferative activity assay | GI50 = 1.58 μM | 27017549 | |||
| T47D | Antiproliferative activity assay | GI50 = 1.58 μM | 27017549 | |||
| 7dF3 | Function assay | IC50 = 1.62 μM | 29266937 | |||
| MDA-MB-435 | Antiproliferative activity assay | IC50 = 1.67 μM | 25778995 | |||
| HL60 | Cytotoxicity assay | IC50 = 1.68 μM | 24858546 | |||
| SW579 | Antiproliferative activity human | IC50 = 1.73 μM | 28242553 | |||
| MCF7 | Antiproliferative activity assay | IC50 = 1.88 μM | 25637123 | |||
| A375P | Antiproliferative activity assay | IC50 = 1.9 μM | 24128410 | |||
| A549 | Cytotoxicity assay | IC50 = 1.92 μM | 24826815 | |||
| HCT116 | Antiproliferative activity assay | IC50 = 2 μM | 22808911 | |||
| MDA-MB-231 | Cytotoxicity assay | IC50 = 2 μM | 23454017 | |||
| NCI-H23 | Growth inhibition assay | GI50 = 2 μM | 28088086 | |||
| NCI-H522 | Growth inhibition assay | GI50 = 2 μM | 28088086 | |||
| HOP62 | Growth inhibition assay | GI50 = 2 μM | 28088086 | |||
| NCI-H226 | Growth inhibition assay | GI50 = 2 μM | 28088086 | |||
| HT-29 | Growth inhibition assay | GI50 = 2 μM | 28088086 | |||
| U251 | Growth inhibition assay | GI50 = 2 μM | 28088086 | |||
| COLO205 | Growth inhibition assay | GI50 = 2 μM | 28088086 | |||
| CCRF-CEM | Growth inhibition assay | GI50 = 2 μM | 28088086 | |||
| MALME-3M | Growth inhibition assay | GI50 = 2 μM | 28088086 | |||
| M14 | Growth inhibition assay | GI50 = 2 μM | 28088086 | |||
| UACC257 | Growth inhibition assay | GI50 = 2 μM | 28088086 | |||
| PC3 | Growth inhibition assay | GI50 = 2 μM | 28088086 | |||
| SK-MEL-2 | Growth inhibition assay | GI50 = 2 μM | 28088086 | |||
| MDA-MB-468 | Growth inhibition assay | GI50 = 2 μM | 28088086 | |||
| CCRF-CEM | Cytotoxicity assay | GI50 = 2 μM | 26590508 | |||
| NCI-H23 | Cytotoxicity assay | GI50 = 2 μM | 26590508 | |||
| NCI-H522 | Cytotoxicity assay | GI50 = 2 μM | 26590508 | |||
| COLO205 | Cytotoxicity assay | GI50 = 2 μM | 26590508 | |||
| HT-29 | Cytotoxicity assay | GI50 = 2 μM | 26590508 | |||
| SK-MEL-28 | Cytotoxicity assay | GI50 = 2 μM | 26590508 | |||
| HOP62 | Cytotoxicity assay | GI50 = 2 μM | 26590508 | |||
| UACC257 | Cytotoxicity assay | GI50 = 2 μM | 26590508 | |||
| NCI-H226 | Cytotoxicity assay | GI50 = 2 μM | 26590508 | |||
| U251 | Cytotoxicity assay | GI50 = 2 μM | 26590508 | |||
| PC3 | Cytotoxicity assay | GI50 = 2 μM | 26590508 | |||
| M14 | Cytotoxicity assay | GI50 = 2 μM | 26590508 | |||
| MDA-MB-468 | Cytotoxicity assay | GI50 = 2 μM | 26590508 | |||
| PC3 | Antiproliferative activity assay | GI50 = 2 μM | 27017549 | |||
| MALME-3M | Antiproliferative activity assay | GI50 = 2 μM | 27017549 | |||
| U251 | Antiproliferative activity assay | GI50 = 2 μM | 27017549 | |||
| UACC257 | Antiproliferative activity assay | GI50 = 2 μM | 27017549 | |||
| SK-MEL-2 | Antiproliferative activity assay | GI50 = 2 μM | 27017549 | |||
| COLO205 | Antiproliferative activity assay | GI50 = 2 μM | 27017549 | |||
| NCI-H23 | Antiproliferative activity assay | GI50 = 2 μM | 27017549 | |||
| HT-29 | Antiproliferative activity assay | GI50 = 2 μM | 27017549 | |||
| M14 | Antiproliferative activity assay | GI50 = 2 μM | 27017549 | |||
| NCI-H226 | Antiproliferative activity assay | GI50 = 2 μM | 27017549 | |||
| HOP62 | Antiproliferative activity assay | GI50 = 2 μM | 27017549 | |||
| MDA-MB-468 | Antiproliferative activity assay | GI50 = 2 μM | 27017549 | |||
| CCRF-CEM | Antiproliferative activity assay | GI50 = 2 μM | 27017549 | |||
| NCI-H522 | Antiproliferative activity assay | GI50 = 2 μM | 27017549 | |||
| A549 | Antiproliferative activity assay | IC50 = 2.02 μM | 26753815 | |||
| MDA-MB-435 | Growth inhibition assay | IC50 = 2.11 μM | 29189002 | |||
| NCI-H460 | Antiproliferative activity assay | IC50 = 2.19 μM | 30216849 | |||
| H460 | Cytotoxicity assay | IC50 = 2.19 μM | 24826815 | |||
| H460 | Cytotoxicity assay | IC50 = 2.19 μM | 25086238 | |||
| H460 | Cytotoxicity assay | IC50 = 2.19 μM | 25440879 | |||
| A375 | Toxicity assay | IC50 = 2.2 μM | 19654408 | |||
| H460 | Antiproliferative activity assay | IC50 = 2.25 μM | 26991938 | |||
| HCT116 | Antiproliferative activity assay | IC50 = 2.3 μM | 23260578 | |||
| MKN45 | Antiproliferative activity assay | IC50 = 2.32 μM | 30216849 | |||
| MKN45 | Cytotoxicity assay | IC50 = 2.32 μM | 24826815 | |||
| MKN45 | Cytotoxicity assay | IC50 = 2.32 μM | 25086238 | |||
| MKN45 | Cytotoxicity assay | IC50 = 2.32 μM | 25440879 | |||
| U937 | Antiproliferative activity assay | GI50 = 2.34 μM | 29459144 | |||
| A375 | Antiproliferative activity assay | IC50 = 2.4 μM | 22808911 | |||
| HeLa | Growth inhibition assay | IC50 = 2.44 μM | 29102175 | |||
| MDA-MB-231 | Cytotoxicity assay | IC50 = 2.5 μM | 22414612 | |||
| MCF7 | Antiproliferative activity assay | IC50 = 2.51 μM | 30216849 | |||
| UO31 | Antiproliferative activity assay | IC50 = 2.51 μM | 30216849 | |||
| NCI-H322M | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| NCI-H460 | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| KM12 | Growth inhibition assay | TGI = 2.51 μM | 28088086 | |||
| LOXIMVI | Growth inhibition assay | TGI = 2.51 μM | 28088086 | |||
| EKVX | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| HCT116 | Growth inhibition assay | TGI = 2.51 μM | 28088086 | |||
| SW620 | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| SF268 | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| SF539 | Growth inhibition assay | TGI = 2.51 μM | 28088086 | |||
| A498 | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| UACC62 | Growth inhibition assay | TGI = 2.51 μM | 28088086 | |||
| IGROV1 | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| HCT15 | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| SK-MEL-28 | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| SK-MEL-28 | Growth inhibition assay | TGI = 2.51 μM | 28088086 | |||
| ACHN | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| SK-MEL-5 | Growth inhibition assay | TGI = 2.51 μM | 28088086 | |||
| NCI/ADR-RES | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| MCF7 | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| SN12C | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| Hs 578T | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| SKOV3 | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| UO31 | Growth inhibition assay | GI50 = 2.51 μM | 28088086 | |||
| NCI-H460 | Cytotoxicity assay | GI50 = 2.51 μM | 26590508 | |||
| HCT15 | Cytotoxicity assay | GI50 = 2.51 μM | 26590508 | |||
| SW620 | Cytotoxicity assay | GI50 = 2.51 μM | 26590508 | |||
| SF268 | Cytotoxicity assay | GI50 = 2.51 μM | 26590508 | |||
| IGROV1 | Cytotoxicity assay | GI50 = 2.51 μM | 26590508 | |||
| OVCAR8 | Cytotoxicity assay | GI50 = 2.51 μM | 26590508 | |||
| NCI/ADR-RES | Cytotoxicity assay | GI50 = 2.51 μM | 26590508 | |||
| SKOV3 | Cytotoxicity assay | GI50 = 2.51 μM | 26590508 | |||
| SN12C | Cytotoxicity assay | GI50 = 2.51 μM | 26590508 | |||
| NCI-H322M | Cytotoxicity assay | GI50 = 2.51 μM | 26590508 | |||
| MCF7 | Cytotoxicity assay | GI50 = 2.51 μM | 26590508 | |||
| UO31 | Cytotoxicity assay | GI50 = 2.51 μM | 26590508 | |||
| Hs578T | Cytotoxicity assay | GI50 = 2.51 μM | 26590508 | |||
| A498 | Cytotoxicity assay | GI50 = 2.51 μM | 26590508 | |||
| A498 | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| SKOV3 | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| UO31 | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| NCI-ADR-RES | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| SN12C | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| IGROV1 | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| ACHN | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| OVCAR8 | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| SK-MEL-28 | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| NCI-H322M | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| SF268 | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| HCT15 | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| NCI-H460 | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| SW620 | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| EKVX | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| MCF7 | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| Hs 578T | Antiproliferative activity assay | GI50 = 2.51 μM | 27017549 | |||
| HT-29 | Antiproliferative activity assay | IC50 = 2.58 μM | 29886324 | |||
| A375P | Antiproliferative activity assay | GI50 = 2.58 μM | 26810260 | |||
| TPC1 | Antiproliferative activity assay | EC50 = 2.6 μM | 22559926 | |||
| Hep3B | Growth inhibition assay | IC50 = 2.63 μM | 29102175 | |||
| A375P | Antiproliferative activity assay | IC50 = 2.7 μM | 22460030 | |||
| U937 | Antiproliferative activity assay | GI50 = 2.74 μM | 26318067 | |||
| U937 | Cytotoxicity assay | GI50 = 2.74 μM | 24878193 | |||
| MCF7 | Growth inhibition assay | IC50 = 2.78 μM | 29102175 | |||
| MDA-MB-231 | Antiproliferative activity assay | IC50 = 2.8 μM | 29202403 | |||
| HepG2 | Antiproliferative activity assay | IC50 = 2.84 μM | 28242553 | |||
| U937 | Growth inhibition assay | GI50 = 2.85 μM | 22014755 | |||
| A549 | Cytotoxicity assay | IC50 = 2.92 μM | 28927801 | |||
| A549 | Cytotoxicity assay | IC50 = 2.92 μM | 27777009 | |||
| ZR75-30 | Growth inhibition assay | IC50 = 2.96 μM | 29102175 | |||
| PC3 | Cytotoxicity assay | IC50 = 3.03 μM | 28340913 | |||
| MDA-MB-231 | Antiproliferative activity assay | IC50 = 3.08 μM | 26991938 | |||
| A549 | Growth inhibition assay | IC50 = 3.1 μM | 29102175 | |||
| K562 | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| MOLT4 | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| A549/ATCC | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| RPMI8226 | Growth inhibition assay | TGI = 3.16 μM | 28088086 | |||
| SR | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| HOP62 | Growth inhibition assay | TGI = 3.16 μM | 28088086 | |||
| NCI-H226 | Growth inhibition assay | TGI = 3.16 μM | 28088086 | |||
| U251 | Growth inhibition assay | TGI = 3.16 μM | 28088086 | |||
| COLO205 | Growth inhibition assay | TGI = 3.16 μM | 28088086 | |||
| M14 | Growth inhibition assay | TGI = 3.16 μM | 28088086 | |||
| HCC2998 | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| SNB75 | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| 786-0 | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| A498 | Growth inhibition assay | TGI = 3.16 μM | 28088086 | |||
| HCT15 | Growth inhibition assay | TGI = 3.16 μM | 28088086 | |||
| OVCAR3 | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| OVCAR4 | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| Caki1 | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| SNB19 | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| OVCAR5 | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| DU145 | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| OVCAR8 | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| SN12C | Growth inhibition assay | TGI = 3.16 μM | 28088086 | |||
| MDA-MB-231 | Growth inhibition assay | TGI = 3.16 μM | 28088086 | |||
| RXF393 | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| BT549 | Growth inhibition assay | GI50 = 3.16 μM | 28088086 | |||
| K562 | Cytotoxicity assay | GI50 = 3.16 μM | 26590508 | |||
| MOLT4 | Cytotoxicity assay | GI50 = 3.16 μM | 26590508 | |||
| SNB19 | Cytotoxicity assay | GI50 = 3.16 μM | 26590508 | |||
| SR | Cytotoxicity assay | GI50 = 3.16 μM | 26590508 | |||
| A549 | Cytotoxicity assay | GI50 = 3.16 μM | 26590508 | |||
| OVCAR3 | Cytotoxicity assay | GI50 = 3.16 μM | 26590508 | |||
| OVCAR4 | Cytotoxicity assay | GI50 = 3.16 μM | 26590508 | |||
| SNB75 | Cytotoxicity assay | GI50 = 3.16 μM | 26590508 | |||
| OVCAR5 | Cytotoxicity assay | GI50 = 3.16 μM | 26590508 | |||
| DU145 | Cytotoxicity assay | GI50 = 3.16 μM | 26590508 | |||
| 786-0 | Cytotoxicity assay | GI50 = 3.16 μM | 26590508 | |||
| BT549 | Cytotoxicity assay | GI50 = 3.16 μM | 26590508 | |||
| ACHN | Cytotoxicity assay | GI50 = 3.16 μM | 26590508 | |||
| Caki1 | Cytotoxicity assay | GI50 = 3.16 μM | 26590508 | |||
| 786-0 | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| LOXIMVI | Antiproliferative activity assay | TGI = 3.16 μM | 27017549 | |||
| Caki1 | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| OVCAR5 | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| RXF393 | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| SNB75 | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| OVCAR3 | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| SNB19 | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| SK-MEL-5 | Antiproliferative activity assay | TGI = 3.16 μM | 27017549 | |||
| OVCAR4 | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| SK-MEL-2 | Antiproliferative activity assay | TGI = 3.16 μM | 27017549 | |||
| BT549 | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| MOLT4 | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| K562 | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| HCC2998 | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| HCC2998 | Antiproliferative activity assay | TGI = 3.16 μM | 27017549 | |||
| A549/ATCC | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| DU145 | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| SR | Antiproliferative activity assay | GI50 = 3.16 μM | 27017549 | |||
| MCF7 | Cytotoxicity assay | IC50 = 3.18 μM | 28927801 | |||
| PC3 | Cytotoxicity assay | IC50 = 3.18 μM | 28927801 | |||
| MCF7 | Cytotoxicity assay | IC50 = 3.18 μM | 27777009 | |||
| A549 | Antiproliferative activity assay | IC50 = 3.19 μM | 25778995 | |||
| PC3 | Cytotoxicity assay | IC50 = 3.24 μM | 27777009 | |||
| HeLa | Function assay | IC50 = 3.3 μM | 15225706 | |||
| HeLa | Function assay | IC50 = 3.3 μM | 15225706 | |||
| LoVo | Cytotoxicity assay | IC50 = 3.3 μM | 23454017 | |||
| A375 | Antiproliferative activity assay | IC50 = 3.36 μM | 29602674 | |||
| HT-29 | Antiproliferative activity assay | IC50 = 3.37 μM | 26991938 | |||
| FLT3 gene-deficient U937 | Antiproliferative activity assay | GI50 = 3.4 μM | 21708468 | |||
| FLT3 negative U937 | Cytotoxicity assay | GI50 = 3.4 μM | 23618709 | |||
| U937 | Cytotoxicity assay | GI50 = 3.4 μM | 26081023 | |||
| A375P | Antiproliferative activity assay | GI50 = 3.4 μM | 29459144 | |||
| ACHN | Cytotoxicity assay | IC50 = 3.4 μM | 29517908 | |||
| ACHN | Cytotoxicity assay | IC50 = 3.4 μM | 29297688 | |||
| HepG2 | Function assay | IC50 = 3.4 μM | 26071861 | |||
| A375P | Cytotoxicity assay | GI50 = 3.4 μM | 24878193 | |||
| HepG2 | Cytotoxicity assay | IC50 = 3.44 μM | 28927801 | |||
| HepG2 | Cytotoxicity assay | IC50 = 3.44 μM | 27777009 | |||
| ACHN | Cytotoxicity assay | IC50 = 3.5 μM | 29786436 | |||
| HepG2 | Antiproliferative activity assay | IC50 = 3.5 μM | 25462265 | |||
| HT-29 | Cytotoxicity assay | IC50 = 3.61 μM | 24826815 | |||
| HT-29 | Antiproliferative activity assay | IC50 = 3.61 μM | 30216849 | |||
| HT-29 | Cytotoxicity assay | IC50 = 3.61 μM | 25086238 | |||
| HT-29 | Cytotoxicity assay | IC50 = 3.61 μM | 25440879 | |||
| MCF7 | Anticancer activity assay | IC50 = 3.64 μM | 29549841 | |||
| Sf9 | Function assay | IC50 = 3.8 μM | 21708468 | |||
| Sf9 | Function assay | IC50 = 3.8 μM | 23618709 | |||
| Sf9 | Function assay | IC50 = 3.8 μM | 26081023 | |||
| A2058 | Cytotoxicity assay | IC50 = 3.8 μM | 22708987 | |||
| NCI-H460 | Cytotoxicity assay | IC50 = 3.9 μM | 23454017 | |||
| SK-MEL-30 | Cytotoxicity assay | IC50 = 3.9 μM | 29461827 | |||
| HT-29 | Anticancer activity assay | IC50 = 3.97 μM | 29549841 | |||
| SF268 | Growth inhibition assay | TGI = 3.98 μM | 28088086 | |||
| SNB75 | Growth inhibition assay | TGI = 3.98 μM | 28088086 | |||
| OVCAR3 | Growth inhibition assay | TGI = 3.98 μM | 28088086 | |||
| SNB19 | Growth inhibition assay | TGI = 3.98 μM | 28088086 | |||
| Hs 578T | Growth inhibition assay | TGI = 3.98 μM | 28088086 | |||
| TK10 | Growth inhibition assay | GI50 = 3.98 μM | 28088086 | |||
| BT549 | Growth inhibition assay | TGI = 3.98 μM | 28088086 | |||
| Caki1 | Antiproliferative activity assay | TGI = 3.98 μM | 27017549 | |||
| TK10 | Antiproliferative activity assay | GI50 = 3.98 μM | 27017549 | |||
| MDA-MB-435 | Antiproliferative activity assay | TGI = 3.98 μM | 27017549 | |||
| HCT116 | Antiproliferative activity assay | TGI = 3.98 μM | 27017549 | |||
| MDA-MB-231 | Antiproliferative activity assay | TGI = 3.98 μM | 27017549 | |||
| HepG2 | Cytotoxicity assay | IC50 = 4 μM | 23454017 | |||
| HT-29 | Cytotoxicity assay | IC50 = 4 μM | 23454017 | |||
| A549 | Cytotoxicity assay | IC50 = 4 μM | 23454017 | |||
| HuH7 | Cytotoxicity assay | GI50 = 4 μM | 23726028 | |||
| PC3 | Antiproliferative activity assay | IC50 = 4.13 μM | 25778995 | |||
| HeLa | Cytotoxicity assay | IC50 = 4.163 μM | 23362959 | |||
| MDA-MB-436 | Antiproliferative activity assay | IC50 = 4.2 μM | 29202403 | |||
| MCF7 | Cytotoxicity assay | IC50 = 4.21 μM | 27043268 | |||
| MCF7 | Cytotoxicity assay | IC50 = 4.21 μM | 28340913 | |||
| LOXIMVI | Antiproliferative activity assay | IC50 = 4.25 μM | 25778995 | |||
| OVCAR4 | Cytotoxicity assay | TGI = 4.31 μM | 26590508 | |||
| WM1361 | Antiproliferative activity assay | GI50 = 4.345 μM | 20148563 | |||
| WM266.4 | Growth inhibition assay | GI50 = 4.5 μM | 20199087 | |||
| HepG2 | Cytotoxicity assay | GI50 = 4.5 μM | 23726028 | |||
| A549 | Antiproliferative activity assay | IC50 = 4.5 μM | 23260578 | |||
| LS174T | Function assay | IC50 = 4.52 μM | 29266937 | |||
| 8505C | Antiproliferative activity assay | IC50 = 4.7 μM | 29032031 | |||
| OVCAR8 | Cytotoxicity assay | TGI = 4.73 μM | 26590508 | |||
| MDA-MB-231 | Cytotoxicity assay | IC50 = 4.77 μM | 20435479 | |||
| B16-F1 | Antiproliferative activity assay | IC50 = 4.9 μM | 18477505 | |||
| WM164 | Antiproliferative activity assay | IC50 = 4.9 μM | 17561392 | |||
| B16-F1 | Antiproliferative activity assay | IC50 = 4.9 μM | 20056548 | |||
| MDA-MB-468 | Cytotoxicity assay | IC50 = 4.9 μM | 26159483 | |||
| 786-O | Cytotoxicity assay | IC50 = 4.9 μM | 29517908 | |||
| 786-O | Cytotoxicity assay | IC50 = 4.9 μM | 29297688 | |||
| WM266.4 | Antiproliferative activity assay | GI50 = 4.933 μM | 20148563 | |||
| WM266.4 | Growth inhibition assay | IC50 = 5 μM | 19323560 | |||
| WM164 | Antiproliferative activity assay | IC50 = 5 μM | 20056548 | |||
| HepG2 | Antiproliferative activity assay | IC50 = 5 μM | 23260578 | |||
| HepG2 | Antiproliferative activity assay | IC50 = 5 μM | 23932071 | |||
| NCI-H23 | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| NCI-H322M | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| NCI-H460 | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| NCI-H522 | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| HT-29 | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| CCRF-CEM | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| SW620 | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| HOP92 | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| 786-0 | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| MDA-MB-435 | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| PC3 | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| UACC257 | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| SKOV3 | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| RXF393 | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| T47D | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| MDA-MB-468 | Growth inhibition assay | TGI = 5.01 μM | 28088086 | |||
| UACC62 | Antiproliferative activity assay | TGI = 5.01 μM | 27017549 | |||
| UACC257 | Antiproliferative activity assay | TGI = 5.01 μM | 27017549 | |||
| SK-MEL-5 | Antiproliferative activity assay | LC50 = 5.01 μM | 27017549 | |||
| M14 | Antiproliferative activity assay | TGI = 5.01 μM | 27017549 | |||
| NCI-H23 | Antiproliferative activity assay | TGI = 5.01 μM | 27017549 | |||
| SF295 | Antiproliferative activity assay | TGI = 5.01 μM | 27017549 | |||
| HOP92 | Antiproliferative activity assay | TGI = 5.01 μM | 27017549 | |||
| BT549 | Antiproliferative activity assay | TGI = 5.01 μM | 27017549 | |||
| MDA-MB-231 | Cytotoxicity assay | IC50 = 5.1 μM | 26159483 | |||
| DU145 | Cytotoxicity assay | IC50 = 5.1 μM | 22708987 | |||
| A549 | Cytotoxicity assay | IC50 = 5.21 μM | 20181414 | |||
| HeLa | Cytotoxicity assay | IC50 = 5.23 μM | 26342867 | |||
| 786-O | Cytotoxicity assay | IC50 = 5.3 μM | 29786436 | |||
| HCT116 | Antiproliferative activity assay | GI50 = 5.4 μM | 15225706 | |||
| A375 | Antiproliferative activity assay | IC50 = 5.4 μM | 18477505 | |||
| SK-MEL-188 | Antiproliferative activity assay | IC50 = 5.4 μM | 17561392 | |||
| A375 | Antiproliferative activity assay | IC50 = 5.4 μM | 20056548 | |||
| MCF7 | Cytotoxicity assay | IC50 = 5.5 μM | 26159483 | |||
| A375 | Antiproliferative activity assay | IC50 = 5.58 μM | 19464887 | |||
| A375P | Cytotoxicity assay | IC50 = 5.58 μM | 20797858 | |||
| A375P | Antiproliferative activity assay | GI50 = 5.58 μM | 21353571 | |||
| A375P | Growth inhibition assay | GI50 = 5.58 μM | 22014755 | |||
| A375P | Growth inhibition assay | GI50 = 5.58 μM | 20149658 | |||
| A375P | Antiproliferative activity assay | GI50 = 5.58 μM | 20466542 | |||
| A375P | Antiproliferative activity assay | IC50 = 5.6 μM | 19857963 | |||
| A375P | Antiproliferative activity assay | IC50 = 5.6 μM | 21592628 | |||
| A375P | Antiproliferative activity assay | IC50 = 5.6 μM | 22033063 | |||
| A375P | Cytotoxicity assay | IC50 = 5.6 μM | 19897366 | |||
| A375P | Antiproliferative activity assay | IC50 = 5.6 μM | 22647720 | |||
| HCT116 | Cytotoxicity assay | IC50 = 5.65 μM | 24215818 | |||
| SH-SY5Y | Antiproliferative activity assay | IC50 = 5.73 μM | 24315192 | |||
| HepG2 | Cytotoxicity assay | IC50 = 5.74 μM | 25461318 | |||
| Bel7402 | Cytotoxicity assay | IC50 = 5.8 μM | 23454017 | |||
| HT-29 | Cytotoxicity assay | IC50 = 5.9 μM | 28865276 | |||
| melanoma | Growth inhibition assay | IC50 = 6.1 μM | 16392826 | |||
| K562 | Antiproliferative activity assay | GI50 = 6.2 μM | 21708468 | |||
| HepG2 | Cytotoxicity assay | IC50 = 6.2 μM | 28865276 | |||
| A549 | Anticancer activity assay | IC50 = 6.21 μM | 29549841 | |||
| SMMC7721 | Antiproliferative activity assay | IC50 = 6.23 μM | 22721924 | |||
| HepG2 | Antiproliferative activity assay | IC50 = 6.3 μM | 23932071 | |||
| SF295 | Growth inhibition assay | TGI = 6.31 μM | 28088086 | |||
| SK-MEL-2 | Growth inhibition assay | TGI = 6.31 μM | 28088086 | |||
| OVCAR5 | Growth inhibition assay | TGI = 6.31 μM | 28088086 | |||
| UO31 | Growth inhibition assay | TGI = 6.31 μM | 28088086 | |||
| A498 | Antiproliferative activity assay | TGI = 6.31 μM | 27017549 | |||
| MALME-3M | Antiproliferative activity assay | TGI = 6.31 μM | 27017549 | |||
| U251 | Antiproliferative activity assay | TGI = 6.31 μM | 27017549 | |||
| SK-MEL-2 | Antiproliferative activity assay | LC50 = 6.31 μM | 27017549 | |||
| RPMI8226 | Antiproliferative activity assay | TGI = 6.31 μM | 27017549 | |||
| HCC2998 | Antiproliferative activity assay | LC50 = 6.31 μM | 27017549 | |||
| NCI-H522 | Antiproliferative activity assay | TGI = 6.31 μM | 27017549 | |||
| HUVEC | Antiproliferative activity assay | IC50 = 6.42 μM | 23644219 | |||
| A549 | Cytotoxicity assay | IC50 = 6.53 μM | 27043268 | |||
| A549 | Cytotoxicity assay | IC50 = 6.53 μM | 28340913 | |||
| LoVo | Antiproliferative activity assay | IC50 = 6.56 μM | 24315192 | |||
| A375 | Function assay | IC50 = 6.599 μM | 21807507 | |||
| HCT116 | Function assay | GI50 = 6.6 μM | 15225706 | |||
| HepG2 | Cytotoxicity assay | IC50 = 6.7 μM | 26159483 | |||
| BCPAP | Antiproliferative activity assay | IC50 = 6.7 μM | 29032031 | |||
| A549 | Cytotoxicity assay | IC50 = 6.7 μM | 28865276 | |||
| PC3 | Cytotoxicity assay | IC50 = 6.8 μM | 23021967 | |||
| SGC7901 | Cytotoxicity assay | IC50 = 6.9 μM | 23454017 | |||
| OS-RC2 | Cytotoxicity assay | IC50 = 7 μM | 29517908 | |||
| OS-RC2 | Cytotoxicity assay | IC50 = 7 μM | 29297688 | |||
| COLO205 | Antiproliferative activity human | IC50 = 7.04 μM | 28242553 | |||
| rhabdomyosarcoma | Cytotoxicity activity against human | CC50 = 7.05 μM | 27288186 | |||
| HuH7 | Cytotoxicity assay | IC50 = 7.1 μM | 26159483 | |||
| MDA-MB-231 | Antiproliferative activity assay | IC50 = 7.18 μM | 22721924 | |||
| FLT3-negative K562 | Cytotoxicity assay | GI50 = 7.3 μM | 23618709 | |||
| K562 | Function assay | GI50 = 7.3 μM | 26081023 | |||
| K562 | Function assay | GI50 = 7.3 μM | 26081023 | |||
| MCF7 | Antiproliferative activity assay | IC50 = 7.33 μM | 23644219 | |||
| A549 | Cytotoxicity assay | TGI = 7.36 μM | 26590508 | |||
| WI38 | Cytotoxicity assay | IC50 = 7.54 μM | 24826815 | |||
| A375 | Cytotoxicity assay | IC50 = 7.56 μM | 24215818 | |||
| MDA-MB-231 | Cytotoxicity assay | IC50 = 7.62 μM | 20181414 | |||
| 786-0 | Cytotoxicity assay | TGI = 7.62 μM | 26590508 | |||
| HS27 | Antiproliferative activity assay | IC50 = 7.8 μM | 19857963 | |||
| HS27 | Cytotoxicity assay | IC50 = 7.8 μM | 19897366 | |||
| HCT116 | Cytotoxicity assay | IC50 = 7.8 μM | 22483592 | |||
| HS27 | Antiproliferative activity assay | IC50 = 7.85 μM | 19464887 | |||
| HS27 | Antiproliferative activity assay | GI50 = 7.85 μM | 21353571 | |||
| A549/ATCC | Growth inhibition assay | TGI = 7.94 μM | 28088086 | |||
| DU145 | Growth inhibition assay | TGI = 7.94 μM | 28088086 | |||
| NCI/ADR-RES | Growth inhibition assay | TGI = 7.94 μM | 28088086 | |||
| MCF7 | Growth inhibition assay | TGI = 7.94 μM | 28088086 | |||
| PC3 | Antiproliferative activity assay | TGI = 7.94 μM | 27017549 | |||
| UO31 | Antiproliferative activity assay | TGI = 7.94 μM | 27017549 | |||
| NCI-ADR-RES | Antiproliferative activity assay | TGI = 7.94 μM | 27017549 | |||
| LOXIMVI | Antiproliferative activity assay | LC50 = 7.94 μM | 27017549 | |||
| SK-MEL-28 | Antiproliferative activity assay | TGI = 7.94 μM | 27017549 | |||
| KM12 | Antiproliferative activity assay | TGI = 7.94 μM | 27017549 | |||
| COLO205 | Antiproliferative activity assay | TGI = 7.94 μM | 27017549 | |||
| HT-29 | Antiproliferative activity assay | TGI = 7.94 μM | 27017549 | |||
| NCI-H226 | Antiproliferative activity assay | TGI = 7.94 μM | 27017549 | |||
| HOP62 | Antiproliferative activity assay | TGI = 7.94 μM | 27017549 | |||
| T47D | Antiproliferative activity assay | TGI = 7.94 μM | 27017549 | |||
| MDA-MB-468 | Antiproliferative activity assay | TGI = 7.94 μM | 27017549 | |||
| EKVX | Antiproliferative activity assay | TGI = 7.94 μM | 27017549 | |||
| MCF7 | Antiproliferative activity assay | TGI = 7.94 μM | 27017549 | |||
| Hs 578T | Antiproliferative activity assay | TGI = 7.94 μM | 27017549 | |||
| MGC803 | Antiproliferative activity assay | IC50 = 7.99 μM | 26560049 | |||
| HCT116 | Antiproliferative activity assay | IC50 = 8.08 μM | 24440479 | |||
| PC3 | Cytotoxicity assay | IC50 = 8.08 μM | 27043268 | |||
| HCT116 | Antiproliferative activity assay | IC50 = 8.08 μM | 23644219 | |||
| WM266.4 | Antiproliferative activity assay | GI50 = 8.1 μM | 23025996 | |||
| WM266.4 | Antiproliferative activity assay | GI50 = 8.12 μM | 22583669 | |||
| Ketr3 | Antiproliferative activity assay | IC50 = 8.27 μM | 30216849 | |||
| A375 | Antiproliferative activity assay | IC50 = 8.27 μM | 30216849 | |||
| HepG2 | Antiproliferative activity assay | IC50 = 8.27 μM | 30216849 | |||
| MX1 | Antiproliferative activity assay | IC50 = 8.27 μM | 30216849 | |||
| MX1 | Cytotoxicity assay | IC50 = 8.27 μM | 24675135 | |||
| WM266.4 | Growth inhibition assay | GI50 = 8.3 μM | 22361686 | |||
| PLC/PRF/5 | Cytotoxicity assay | IC50 = 8.3 μM | 21531053 | |||
| A375 | Antiproliferative activity assay | IC50 = 8.33 μM | 29886324 | |||
| HCT116 | Cytotoxicity assay | IC50 = 8.41 μM | 29631788 | |||
| WI38 | Cytotoxicity assay | IC50 = 8.42 μM | 26991938 | |||
| HepG2 | Cytotoxicity assay | IC50 = 8.42 μM | 27162123 | |||
| HepG2 | Cytotoxicity assay | IC50 = 8.42 μM | 23871909 | |||
| HT-29 | Antiproliferative activity assay | IC50 = 8.44 μM | 29602674 | |||
| HepG2 | Cytotoxicity assay | IC50 = 8.67 μM | 24675135 | |||
| MCF7 | Cytotoxicity assay | IC50 = 8.83 μM | 20435479 | |||
| MCF7 | Cytotoxicity assay | IC50 = 9.12 μM | 24300920 | |||
| HepG2 | Antiproliferative activity assay | IC50 = 9.14 μM | 26560049 | |||
| A375 | Cytotoxicity assay | IC50 = 9.17 μM | 24675135 | |||
| MGC803 | Antiproliferative activity assay | IC50 = 9.2 μM | 29032031 | |||
| SKOV3 | Cytotoxicity assay | IC50 = 9.25 μM | 24300920 | |||
| RS4:11 | Function assay | GI50 = 9.3 μM | 26081023 | |||
| RS4:11 | Cytotoxicity assay | GI50 = 9.3 μM | 23618709 | |||
| MIAPaCa2 | Antiproliferative activity assay | IC50 = 9.32 μM | 29032031 | |||
| PANC1 | Growth inhibition assay | IC50 = 9.32 μM | 29102175 | |||
| MHCC97H | Growth inhibition assay | IC50 = 9.32 μM | 29102175 | |||
| RS4:11 | Antiproliferative activity assay | GI50 = 9.4 μM | 21708468 | |||
| Hep3B | Cytotoxicity assay | IC50 = 9.4 μM | 28865276 | |||
| LoVo | Growth inhibition assay | IC50 = 9.47 μM | 29102175 | |||
| SMMC7721 | Antiproliferative activity assay | IC50 = 9.96 μM | 25637123 | |||
| MCF7 | Cytotoxicity assay | TGI = 9.97 μM | 26590508 | |||
| IGROV1 | Growth inhibition assay | TGI = 10 μM | 28088086 | |||
| ACHN | Growth inhibition assay | TGI = 10 μM | 28088086 | |||
| TK10 | Growth inhibition assay | TGI = 10 μM | 28088086 | |||
| 786-0 | Antiproliferative activity assay | TGI = 10 μM | 27017549 | |||
| SN12C | Antiproliferative activity assay | TGI = 10 μM | 27017549 | |||
| Caki1 | Antiproliferative activity assay | LC50 = 10 μM | 27017549 | |||
| TK10 | Antiproliferative activity assay | TGI = 10 μM | 27017549 | |||
| RXF393 | Antiproliferative activity assay | TGI = 10 μM | 27017549 | |||
| OVCAR8 | Antiproliferative activity assay | TGI = 10 μM | 27017549 | |||
| SNB75 | Antiproliferative activity assay | TGI = 10 μM | 27017549 | |||
| NCI-H322M | Antiproliferative activity assay | TGI = 10 μM | 27017549 | |||
| MDA-MB-435 | Antiproliferative activity assay | LC50 = 10 μM | 27017549 | |||
| SF539 | Antiproliferative activity assay | TGI = 10 μM | 27017549 | |||
| SF268 | Antiproliferative activity assay | TGI = 10 μM | 27017549 | |||
| NCI-H460 | Antiproliferative activity assay | TGI = 10 μM | 27017549 | |||
| DU145 | Antiproliferative activity assay | TGI = 10 μM | 27017549 | |||
| K1 | Antiproliferative activity assay | IC50 = 10.2 μM | 29032031 | |||
| Bel7402 | Cytotoxicity assay | IC50 = 10.26 μM | 21504204 | |||
| Bel7402 | Growth inhibition assay | IC50 = 10.31 μM | 29102175 | |||
| OVCAR3 | Cytotoxicity assay | TGI = 10.32 μM | 26590508 | |||
| SGC7901 | Cytotoxicity assay | IC50 = 10.37 μM | 20435479 | |||
| SNB75 | Cytotoxicity assay | TGI = 10.42 μM | 26590508 | |||
| A431 | Antiproliferative activity assay | IC50 = 10.46 μM | 29032031 | |||
| SMMC7721 | Antiproliferative activity assay | IC50 = 10.61 μM | 29032031 | |||
| GES-1 | Cytotoxicity assay | IC50 = 10.68 μM | 27162123 | |||
| H460 | Cytotoxicity assay | IC50 = 10.8 μM | 24300920 | |||
| BGC823 | Antiproliferative activity assay | IC50 = 10.91 μM | 22721924 | |||
| Hep3B | Cytotoxicity assay | IC50 = 11.2 μM | 28342400 | |||
| MCF7 | Cytotoxicity assay | IC50 = 11.34 μM | 27162123 | |||
| MCF7 | Cytotoxicity assay | IC50 = 11.34 μM | 23871909 | |||
| SK-MEL-2 | Antiproliferative activity human | IC50 = 11.35 μM | 28242553 | |||
| HepG2 | Cytotoxicity assay | IC50 = 11.49 μM | 21504204 | |||
| A375P | Antiproliferative activity assay | IC50 = 11.5 μM | 22014559 | |||
| SGC7901 | Cytotoxicity assay | IC50 = 11.5 μM | 24300920 | |||
| HeLa | Antiproliferative activity assay | IC50 = 12.01 μM | 29103873 | |||
| PANC1 | Cytotoxicity assay | IC50 = 12.3 μM | 24300920 | |||
| HepG2 | Antiproliferative activity assay | IC50 = 12.54 μM | 29032031 | |||
| A549 | Antiproliferative activity assay | IC50 = 12.54 μM | 23644219 | |||
| Caki1 | Growth inhibition assay | TGI = 12.59 μM | 28088086 | |||
| OVCAR8 | Growth inhibition assay | TGI = 12.59 μM | 28088086 | |||
| SKOV3 | Antiproliferative activity assay | TGI = 12.6 μM | 27017549 | |||
| ACHN | Antiproliferative activity assay | TGI = 12.6 μM | 27017549 | |||
| OVCAR3 | Antiproliferative activity assay | TGI = 12.6 μM | 27017549 | |||
| OVCAR4 | Antiproliferative activity assay | TGI = 12.6 μM | 27017549 | |||
| HCT15 | Antiproliferative activity assay | TGI = 12.6 μM | 27017549 | |||
| SW620 | Antiproliferative activity assay | TGI = 12.6 μM | 27017549 | |||
| A549/ATCC | Antiproliferative activity assay | TGI = 12.6 μM | 27017549 | |||
| MDA-MB-468 | Cytotoxicity assay | TGI = 13.09 μM | 26590508 | |||
| SK-MEL-28 | Cytotoxicity assay | TGI = 13.39 μM | 26590508 | |||
| A549 | Antiproliferative activity assay | IC50 = 13.64 μM | 26560049 | |||
| A375 | Antiproliferative activity human | IC50 = 13.64 μM | 28242553 | |||
| A375 | Antiproliferative activity assay | IC50 = 13.64 μM | 25462267 | |||
| K562 | Antiproliferative activity assay | IC50 = 13.85 μM | 23644219 | |||
| Hep3B | Cytotoxicity assay | IC50 = 14.08 μM | 21504204 | |||
| T47D | Cytotoxicity assay | TGI = 14.38 μM | 26590508 | |||
| NCI-H226 | Cytotoxicity assay | TGI = 14.42 μM | 26590508 | |||
| MDA-MB-231 | Antiproliferative activity assay | IC50 = 14.62 μM | 24440479 | |||
| MDA-MB-231 | Antiproliferative activity assay | IC50 = 14.62 μM | 23644219 | |||
| NCI-H522 | Cytotoxicity assay | TGI = 14.82 μM | 26590508 | |||
| SK-MEL-2 | Cytotoxicity assay | TGI = 14.85 μM | 26590508 | |||
| OS-RC2 | Cytotoxicity assay | IC50 = 15 μM | 29786436 | |||
| HepG2 | Antiproliferative activity assay | IC50 = 15 μM | 29103873 | |||
| fibroblast | Antiproliferative activity assay | IC50 = 15.1 μM | 18477505 | |||
| HT-29 | Cytotoxicity assay | IC50 = 15.2 μM | 24675135 | |||
| U87MG | Cytotoxicity assay | IC50 = 15.57 μM | 24826815 | |||
| BT549 | Antiproliferative activity assay | LC50 = 15.8 μM | 27017549 | |||
| GES-1 | Cytotoxicity assay | IC50 = 15.8 μM | 23871909 | |||
| SNB19 | Antiproliferative activity assay | TGI = 15.85 μM | 27017549 | |||
| IGROV1 | Antiproliferative activity assay | TGI = 15.9 μM | 27017549 | |||
| HCT116 | Antiproliferative activity assay | LC50 = 15.9 μM | 27017549 | |||
| OS-RC2 | Cytotoxicity assay | IC50 = 16 μM | 23454017 | |||
| A375 | Cytotoxicity assay | IC50 = 16.24 μM | 25461318 | |||
| SKOV3 | Cytotoxicity assay | TGI = 16.36 μM | 26590508 | |||
| WM1361 | Antiproliferative activity assay | IC50 = 16.44 μM | 29602674 | |||
| MKN28 | Antiproliferative activity assay | IC50 = 17 μM | 29032031 | |||
| SMMC7721 | Cytotoxicity assay | IC50 = 17.3 μM | 21504204 | |||
| UACC257 | Cytotoxicity assay | TGI = 17.33 μM | 26590508 | |||
| EAhy926 | Antiangiogenic activity assay | IC50 = 18.52 μM | 29032031 | |||
| SMMC7721 | Cytotoxicity assay | IC50 = 18.7 μM | 24300920 | |||
| Ketr3 | Cytotoxicity assay | IC50 = 18.8 μM | 24675135 | |||
| NCI-H522 | Cytotoxicity assay | IC50 = 19.26 μM | 25461318 | |||
| A549 | Cytotoxicity assay | IC50 = 19.54 μM | 27162123 | |||
| SH-SY5Y | Cytotoxicity assay | IC50 = 19.54 μM | 23871909 | |||
| MGC803 | Antiproliferative activity assay | IC50 = 19.92 μM | 29103873 | |||
| EKVX | Growth inhibition assay | TGI = 19.95 μM | 28088086 | |||
| OVCAR5 | Antiproliferative activity assay | TGI = 20 μM | 27017549 | |||
| UACC62 | Antiproliferative activity assay | LC50 = 20 μM | 27017549 | |||
| UACC257 | Antiproliferative activity assay | LC50 = 20 μM | 27017549 | |||
| MDA-MB-231 | Antiproliferative activity assay | LC50 = 20 μM | 27017549 | |||
| U87 | Cytotoxicity assay | IC50 = 21.07 μM | 20435479 | |||
| EJ | Cytotoxicity assay | IC50 = 22.9 μM | 24300920 | |||
| HCT116 | Antiproliferative activity assay | IC50 = 23.31 μM | 29602674 | |||
| HOP62 | Cytotoxicity assay | TGI = 23.55 μM | 26590508 | |||
| MDA-MB-231 | Cytotoxicity assay | TGI = 23.93 μM | 26590508 | |||
| PC3 | Antiproliferative activity assay | IC50 = 24.2 μM | 24440479 | |||
| PC3 | Antiproliferative activity assay | IC50 = 24.2 μM | 23644219 | |||
| EAhy926 | Antiproliferative activity assay | IC50 = 24.36 μM | 28068599 | |||
| EAhy926 | Anti-angiogenic activity in human | IC50 = 24.36 μM | 29102175 | |||
| U251 | Cytotoxicity assay | IC50 = 24.71 μM | 20435479 | |||
| NIH/3T3 | Antiproliferative activity assay | IC50 = 24.75 μM | 21592628 | |||
| NIH/3T3 | Antiproliferative activity assay | IC50 = 24.75 μM | 22647720 | |||
| DU145 | Cytotoxicity assay | IC50 = 24.91 μM | 27162123 | |||
| DU145 | Cytotoxicity assay | IC50 = 24.91 μM | 23871909 | |||
| U251 | Antiproliferative activity assay | LC50 = 25.1 μM | 27017549 | |||
| M14 | Antiproliferative activity assay | LC50 = 25.1 μM | 27017549 | |||
| NCI-H522 | Antiproliferative activity assay | LC50 = 25.1 μM | 27017549 | |||
| OVCAR4 | Growth inhibition assay | TGI = 25.12 μM | 28088086 | |||
| SH-SY5Y | Cytotoxicity assay | IC50 = 27.71 μM | 27162123 | |||
| A549 | Cytotoxicity assay | IC50 = 27.71 μM | 23871909 | |||
| PLC/PRF/5 | Cytotoxicity assay | IC50 = 29.9 μM | 28109948 | |||
| SK-MEL-5 | Cytotoxicity assay | TGI = 31.26 μM | 26590508 | |||
| A498 | Antiproliferative activity assay | LC50 = 31.6 μM | 27017549 | |||
| SK-MEL-28 | Antiproliferative activity assay | LC50 = 31.6 μM | 27017549 | |||
| KM12 | Antiproliferative activity assay | LC50 = 31.6 μM | 27017549 | |||
| COLO205 | Antiproliferative activity assay | LC50 = 31.6 μM | 27017549 | |||
| NCI-H226 | Antiproliferative activity assay | LC50 = 31.6 μM | 27017549 | |||
| SF295 | Antiproliferative activity assay | LC50 = 31.6 μM | 27017549 | |||
| HOP62 | Antiproliferative activity assay | LC50 = 31.6 μM | 27017549 | |||
| T47D | Antiproliferative activity assay | LC50 = 31.6 μM | 27017549 | |||
| MHCC97L | Cytotoxicity assay | IC50 = 34.41 μM | 28109948 | |||
| MDA-MB-231 | Antiproliferative activity assay | IC50 = 35 μM | 24315192 | |||
| MDA-MB-231 | Cytotoxicity assay | IC50 = 36 μM | 22483592 | |||
| B16-BL6 | Cytotoxicity assay | IC50 = 36.48 μM | 29631788 | |||
| UO31 | Antiproliferative activity assay | LC50 = 39.8 μM | 27017549 | |||
| SN12C | Antiproliferative activity assay | LC50 = 39.8 μM | 27017549 | |||
| RXF393 | Antiproliferative activity assay | LC50 = 39.8 μM | 27017549 | |||
| SNB75 | Antiproliferative activity assay | LC50 = 39.8 μM | 27017549 | |||
| SF268 | Antiproliferative activity assay | LC50 = 39.8 μM | 27017549 | |||
| NCI-H23 | Antiproliferative activity assay | LC50 = 39.8 μM | 27017549 | |||
| HT-29 | Antiproliferative activity assay | LC50 = 39.8 μM | 27017549 | |||
| HOP92 | Antiproliferative activity assay | LC50 = 39.8 μM | 27017549 | |||
| NCI-H460 | Antiproliferative activity assay | LC50 = 39.8 μM | 27017549 | |||
| SW620 | Antiproliferative activity assay | LC50 = 39.8 μM | 27017549 | |||
| MDA-MB-468 | Antiproliferative activity assay | LC50 = 39.8 μM | 27017549 | |||
| MALME-3M | Growth inhibition assay | TGI = 39.81 μM | 28088086 | |||
| 클릭하여 더 많은 세포주 실험 데이터 보기 | ||||||
| 분자량 | 464.82 | 화학식 | C21H16ClF3N4O3 |
보관 (수령일로부터) | |
|---|---|---|---|---|---|
| CAS 번호 | 284461-73-0 | SDF 다운로드 | 원액 보관 |
|
|
| 동의어 | NSC-724772,BAY 43-9006 | Smiles | CNC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F | ||
|
In vitro |
DMSO
: 92 mg/mL
(197.92 mM)
Water : Insoluble Ethanol : Insoluble |
|
In vivo |
|||||
1단계: 아래 정보 입력 (권장: 실험 중 손실을 고려하여 추가 동물 포함)
2단계: 생체 내 제형 입력 (이것은 계산기일 뿐 제형이 아닙니다. 용해도 섹션에 생체 내 제형이 없는 경우 먼저 당사에 문의하십시오.)
계산 결과:
작업 농도: mg/ml;
DMSO 원액 준비 방법: mg 약물 사전 용해 μL DMSO ( 원액 농도 mg/mL, 농도가 해당 약물 배치의 DMSO 용해도를 초과하는 경우 먼저 당사에 문의하십시오. )
생체 내 제형 준비 방법: 취하다 μL DMSO 원액, 다음 추가μL PEG300, 혼합하고 투명하게 한 다음 추가μL Tween 80, 혼합하고 투명하게 한 다음 추가 μL ddH2O, 혼합하고 투명하게 합니다.
생체 내 제형 준비 방법: 취하다 μL DMSO 원액, 다음 추가 μL 옥수수 기름, 혼합하고 투명하게 합니다.
참고: 1. 다음 용매를 추가하기 전에 액체가 투명한지 확인하십시오.
2. 용매를 순서대로 추가해야 합니다. 다음 용매를 추가하기 전에 이전 추가에서 얻은 용액이 투명한 용액인지 확인해야 합니다. 와동, 초음파 또는 뜨거운 물 중탕과 같은 물리적 방법을 사용하여 용해를 도울 수 있습니다.
| Targets/IC50/Ki |
Raf-1
(Cell-free assay) 6 nM
mVEGFR2(Flk1)
(Cell-free assay) 15 nM
mVEGFR3
(Cell-free assay) 20 nM
B-Raf
(Cell-free assay) 22 nM
B-Raf (V599E)
(Cell-free assay) 38 nM
mPDGFRβ
(Cell-free assay) 57 nM
FLT3
(Cell-free assay) 58 nM
c-Kit
(Cell-free assay) 68 nM
VEGFR2
(Cell-free assay) 90 nM
FGFR1
(Cell-free assay) 580 nM
|
|---|---|
| 시험관 내(In vitro) |
Sorafenib inhibits both wild-type and V599E mutant B-Raf activity with IC50 of 22 nM and 38 nM, respectively. This compound also potently inhibits mVEGFR2 (Flk-1), mVEGFR3, mPDGFRβ, Flt3, and c-Kit with IC50 of 15 nM, 20 nM, 57 nM, 58 nM, and 68 nM, respectively. It weakly inhibits FGFR-1 with IC50 of 580 nM. This chemical is not active against ERK-1, MEK-1, EGFR, HER-2, IGFR-1, c-Met, PKB, PKA, cdk1/cyclinB, PKCα, PKCγ, and pim-1. It markedly inhibits VEGFR2 phosphorylation in NIH 3T3 cells with IC50 of 30 nM, and Flt-3 phosphorylation in HEK-293 cells with IC50 of 20 nM. This agent potently blocks MEK 1/2 and ERK 1/2 phosphorylation in most cell lines but not in A549 or H460 cells, while having no effect on inhibition of the PKB pathway. It inhibits the proliferation of HAoSMC and MDA-MB-231 cells with IC50 of 0.28 μM and 2.6 μM, respectively. In addition to inhibition of the RAF/MEK/ERK signaling pathway, this compound significantly inhibits the phosphorylation of eIF4E and down-regulates Mcl-1 levels in hepatocellular carcinoma (HCC) cells in a MEK/ERK-independent manner. It inhibits the proliferation of PLC/PRF/5 and HepG2 cells with IC50 of 6.3 μM and 4.5 μM, respectively, and leads to the significant induction of apoptosis.
|
| 키나아제 분석 |
Biochemical assays
|
|
Recombinant baculoviruses expressing Raf-1 (residues 305–648) and B-Raf (residues 409–765) are purified as fusion proteins. Full-length human MEK-1 is generated by PCR and purified as a fusion protein from Escherichia coli lysates. Sorafenib tosylate is added to a mixture of Raf-1 (80 ng), or B-Raf (80 ng) with MEK-1 (1 μg) in assay buffer [20 mM Tris (pH 8.2), 100 mM NaCl, 5 mM MgCl2, and 0.15% β-mercaptoethanol] at a final concentration of 1% DMSO. The Raf kinase assay (final volume of 50 μL) is initiated by adding 25 μL of 10 μM γ[33P]ATP (400 Ci/mol) and incubated at 32 °C for 25 minutes. Phosphorylated MEK-1 is harvested by filtration onto a phosphocellulose mat, and 1% phosphoric acid is used to wash away unbound radioactivity. After drying by microwave heating, a β-plate counter is used to quantify filter-bound radioactivity. Human VEGFR2 (KDR) kinase domain is expressed and purified from Sf9 lysates. Time-resolved fluorescence energy transfer assays for VEGFR2 are performed in 96-well opaque plates in the time-resolved fluorescence energy transfer format. Final reaction conditions are as follows: 1 to 10 μM ATP, 25 nM poly GT-biotin, 2 nM Europium-labeled phospho (p)-Tyr antibody (PY20), 10 nM APC, 1 to 7 nM cytoplasmic kinase domain in final concentrations of 1% DMSO, 50 mM HEPES (pH 7.5), 10 mM MgCl2, 0.1 mM EDTA, 0.015% Brij-35, 0.1 mg/mL BSA, and 0.1% β-mercaptoethanol. Reaction volumes are 100 μL and are initiated by addition of enzyme. Plates are read at both 615 and 665 nM on a Perkin-Elmer VictorV Multilabel counter at ~1.5 to 2.0 hours after reaction initiation. Signal is calculated as a ratio: (665 nm/615 nM) × 10,000 for each well. For IC50 generation, this compound is added before the enzyme initiation. A 50-fold stock plate is made with this compound serially diluted 1:3 in a 50% DMSO/50% distilled water solution. Final concentrations of this chemical range from 10 μM to 4.56 nM in 1% DMSO.
|
|
| 생체 내(In vivo) |
Oral administration of Sorafenib (~60 mg/kg) demonstrates broad spectrum, dose-dependent anti-tumor activity against a variety of human tumor xenograft models including MDA-MB-231, Colo-205, HT-29, DLD-1, NCI-H460, and A549, with no evidence of toxicity. In association with the anti-tumor efficacy, this compound treatment potently inhibits MEK 1/2 phosphorylation and pERK 1/2 levels in HT-29 and MDA-MB-231 xenografts but not in Colo-205 xenografts, and significantly suppresses tumor microvessel area (MVA) and microvessel density (MVD) in MDA MB-231, HT-29 and Colo-205 tumor xenografts. This agent produces dose-dependent growth inhibition of PLC/PRF/5 tumor xenografts in SCID mice with TGIs of 49% and 78% at 10 mg/kg and 30 mg/kg, respectively, consistent with the inhibition of ERK and eIF4E phosphorylation, reduction of the microvessel area, and induction of tumor cell apoptosis. It sensitizes bax-/- cells to TRAIL in a dose-dependent manner, through a mechanism involving down-regulating NF-κB mediated Mcl-1 and cIAP2 expression. Combining this compound (30-60 mg/kg) with TRAIL (5 mg/kg) show dramatic efficacy in TRAIL-resistant HCT116 bax-/- and HT29 tumor xenografts.
|
참조 |
|
| 방법 | 바이오마커 | 이미지 | PMID |
|---|---|---|---|
| Western blot | LC3-I / LC-3II / ATG5 p-STAT3 / STAT3 / Mcl-1 β-catenin / Survivin / Mcl-1 / PTMA pERK / ERK p-PKM2(y105) / PMK2 / Caspase-9 RET(pY1016) / VEGFR2(pY1214) / MEK1(pT292) / ERK(pY204) Cyclin D1 |
|
23392173 |
| Growth inhibition assay | Cell viability |
|
26039995 |
| Immunofluorescence | p65 cytochrome c |
|
22286758 |
| ELISA | TGF-beta / CD206 Caspase-9 / Caspase-3 |
|
26158762 |
(데이터 출처 https://clinicaltrials.gov, 업데이트 날짜 2024-05-22)
| NCT 번호 | 모집 | 조건 | 스폰서/협력자 | 시작일 | 단계 |
|---|---|---|---|---|---|
| NCT05068752 | Recruiting | Pancreas Cancer |
HonorHealth Research Institute|Bayer|Genentech Inc. |
October 28 2021 | Phase 2 |
| NCT04763408 | Active not recruiting | Carcinoma Hepatocellular |
Eisai Inc. |
April 9 2021 | -- |